mirror of
https://github.com/simon987/sist2.git
synced 2025-12-14 07:49:06 +00:00
Compare commits
5 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| e03625838b | |||
| 86840b46f4 | |||
| e57f9916eb | |||
| 565ba6ee76 | |||
| d83fc2c373 |
@@ -3,7 +3,7 @@ MAINTAINER simon987 <me@simon987.net>
|
||||
|
||||
RUN apt update
|
||||
RUN apt install -y libglib2.0-0 libcurl4 libmagic1 libharfbuzz-bin libopenjp2-7 libarchive13 liblzma5 libzstd1 liblz4-1 \
|
||||
curl libtiff5 libpng16-16
|
||||
curl libtiff5 libpng16-16 libpcre3
|
||||
|
||||
RUN mkdir -p /usr/share/tessdata && \
|
||||
cd /usr/share/tessdata/ && \
|
||||
|
||||
79
README.md
79
README.md
@@ -8,9 +8,12 @@ sist2 (Simple incremental search tool)
|
||||
|
||||
*Warning: sist2 is in early development*
|
||||
|
||||

|
||||
|
||||
## Features
|
||||
|
||||
* Fast, low memory usage, multi-threaded
|
||||
* Mobile-friendly Web interface
|
||||
* Portable (all its features are packaged in a single executable)
|
||||
* Extracts text from common file types \*
|
||||
* Generates thumbnails \*
|
||||
@@ -26,66 +29,39 @@ sist2 (Simple incremental search tool)
|
||||
|
||||
## Getting Started
|
||||
|
||||
1. Have an [Elasticsearch](https://www.elastic.co/downloads/elasticsearch) instance running
|
||||
1.
|
||||
1. Have an Elasticsearch (>= 6.X.X) instance running
|
||||
1. Download [from official website](https://www.elastic.co/downloads/elasticsearch)
|
||||
1. *(or)* Run using docker:
|
||||
```bash
|
||||
docker run -d --name es1 --net sist2_net -p 9200:9200 \
|
||||
-e "discovery.type=single-node" elasticsearch:7.5.2
|
||||
```
|
||||
1. *(or)* Run using docker-compose:
|
||||
```yaml
|
||||
elasticsearch:
|
||||
image: docker.elastic.co/elasticsearch/elasticsearch:7.5.2
|
||||
environment:
|
||||
- discovery.type=single-node
|
||||
- "ES_JAVA_OPTS=-Xms1G -Xmx2G"
|
||||
```
|
||||
1. Download sist2 executable
|
||||
1. Download the [latest sist2 release](https://github.com/simon987/sist2/releases) *
|
||||
1. *(or)* Download a [development snapshot](https://files.simon987.net/artifacts/Sist2/Build/) *(Not recommended!)*
|
||||
1. *(or)* `docker pull simon987/sist2:latest`
|
||||
|
||||
1. See [Usage guide](USAGE.md)
|
||||
|
||||
|
||||
\* *Windows users*: **sist2** runs under [WSL](https://en.wikipedia.org/wiki/Windows_Subsystem_for_Linux)
|
||||
\* *Mac users*: See [#1](https://github.com/simon987/sist2/issues/1)
|
||||
|
||||
|
||||
## Example usage
|
||||
|
||||
See [Usage guide](USAGE.md) for more details
|
||||
|
||||

|
||||
|
||||
See help page `sist2 --help` for more details.
|
||||
|
||||
**Scan a directory**
|
||||
```bash
|
||||
sist2 scan ~/Documents -o ./orig_idx/
|
||||
sist2 scan --threads 4 --content-size 16384 /mnt/Pictures
|
||||
sist2 scan --incremental ./orig_idx/ -o ./updated_idx/ ~/Documents
|
||||
```
|
||||
|
||||
**Push index to Elasticsearch or file**
|
||||
```bash
|
||||
sist2 index --force-reset ./my_idx
|
||||
sist2 index --print ./my_idx > raw_documents.ndjson
|
||||
```
|
||||
|
||||
**Start web interface**
|
||||
```bash
|
||||
sist2 web --bind 0.0.0.0 --port 4321 ./my_idx1 ./my_idx2 ./my_idx3
|
||||
```
|
||||
|
||||
### Use sist2 with docker
|
||||
|
||||
**scan**
|
||||
```bash
|
||||
docker run -it \
|
||||
-v /path/to/files/:/files \
|
||||
-v $PWD/out/:/out \
|
||||
simon987/sist2 scan -t 4 /files -o /out/my_idx1
|
||||
```
|
||||
**index**
|
||||
```bash
|
||||
docker run -it --network host\
|
||||
-v $PWD/out/:/out \
|
||||
simon987/sist2 index /out/my_idx1
|
||||
```
|
||||
|
||||
**web**
|
||||
```bash
|
||||
docker run --rm --network host -d --name sist2\
|
||||
-v $PWD/out/my_idx:/idx \
|
||||
-v $PWD/my/files:/files
|
||||
simon987/sist2 web --bind 0.0.0.0 /idx
|
||||
docker stop sist2
|
||||
```
|
||||
1. Scan a directory: `sist2 scan ~/Documents -o ./docs_idx`
|
||||
1. Push index to Elasticsearch: `sist2 index ./docs_idx`
|
||||
1. Start web interface: `sist2 web ./docs_idx`
|
||||
|
||||
|
||||
## Format support
|
||||
@@ -145,8 +121,9 @@ binaries.
|
||||
```bash
|
||||
apt install git cmake pkg-config libglib2.0-dev \
|
||||
libssl-dev uuid-dev python3 libmagic-dev libfreetype6-dev \
|
||||
libcurl-dev libbz2-dev yasm libharfbuzz-dev ragel \
|
||||
libarchive-dev libtiff5 libpng16-16 libpango1.0-dev
|
||||
libcurl4-openssl-dev libbz2-dev yasm libharfbuzz-dev ragel \
|
||||
libarchive-dev libtiff5 libpng16-16 libpango1.0-dev \
|
||||
libxml2-dev
|
||||
```
|
||||
|
||||
2. Build
|
||||
|
||||
275
USAGE.md
Normal file
275
USAGE.md
Normal file
@@ -0,0 +1,275 @@
|
||||
# Usage
|
||||
|
||||
*More examples (specifically with docker/compose) are in progress*
|
||||
|
||||
* [scan](#scan)
|
||||
* [options](#scan-options)
|
||||
* [examples](#scan-examples)
|
||||
* [index format](#index-format)
|
||||
* [index](#index)
|
||||
* [options](#index-options)
|
||||
* [examples](#index-examples)
|
||||
* [web](#web)
|
||||
* [options](#web-options)
|
||||
* [examples](#web-examples)
|
||||
* [rewrite_url](#rewrite_url)
|
||||
* [link to specific indices](#link-to-specific-indices)
|
||||
|
||||
```
|
||||
Usage: sist2 scan [OPTION]... PATH
|
||||
or: sist2 index [OPTION]... INDEX
|
||||
or: sist2 web [OPTION]... INDEX...
|
||||
Lightning-fast file system indexer and search tool.
|
||||
|
||||
-h, --help show this help message and exit
|
||||
-v, --version Show version and exit
|
||||
--verbose Turn on logging
|
||||
--very-verbose Turn on debug messages
|
||||
|
||||
Scan options
|
||||
-t, --threads=<int> Number of threads. DEFAULT=1
|
||||
-q, --quality=<flt> Thumbnail quality, on a scale of 1.0 to 31.0, 1.0 being the best. DEFAULT=5
|
||||
--size=<int> Thumbnail size, in pixels. Use negative value to disable. DEFAULT=500
|
||||
--content-size=<int> Number of bytes to be extracted from text documents. Use negative value to disable. DEFAULT=32768
|
||||
--incremental=<str> Reuse an existing index and only scan modified files.
|
||||
-o, --output=<str> Output directory. DEFAULT=index.sist2/
|
||||
--rewrite-url=<str> Serve files from this url instead of from disk.
|
||||
--name=<str> Index display name. DEFAULT: (name of the directory)
|
||||
--depth=<int> Scan up to DEPTH subdirectories deep. Use 0 to only scan files in PATH. DEFAULT: -1
|
||||
--archive=<str> Archive file mode (skip|list|shallow|recurse). skip: Don't parse, list: only get file names as text, shallow: Don't parse archives inside archives. DEFAULT: recurse
|
||||
--ocr=<str> Tesseract language (use tesseract --list-langs to see which are installed on your machine)
|
||||
-e, --exclude=<str> Files that match this regex will not be scanned
|
||||
--fast Only index file names & mime type
|
||||
|
||||
Index options
|
||||
--es-url=<str> Elasticsearch url with port. DEFAULT=http://localhost:9200
|
||||
-p, --print Just print JSON documents to stdout.
|
||||
--script-file=<str> Path to user script.
|
||||
--batch-size=<int> Index batch size. DEFAULT: 100
|
||||
-f, --force-reset Reset Elasticsearch mappings and settings. (You must use this option the first time you use the index command)
|
||||
|
||||
Web options
|
||||
--es-url=<str> Elasticsearch url. DEFAULT=http://localhost:9200
|
||||
--bind=<str> Listen on this address. DEFAULT=localhost
|
||||
--port=<str> Listen on this port. DEFAULT=4090
|
||||
--auth=<str> Basic auth in user:password format
|
||||
Made by simon987 <me@simon987.net>. Released under GPL-3.0
|
||||
|
||||
```
|
||||
|
||||
## Scan
|
||||
|
||||
### Scan options
|
||||
|
||||
* `-t, --threads`
|
||||
Number of threads for file parsing. **Do not set a number higher than `$(nproc)`!**.
|
||||
* `-q, --quality`
|
||||
Thumbnail quality, on a scale of 1.0 to 31.0, 1.0 being the best. *Does not affect PDF thumbnails quality*
|
||||
* `--size`
|
||||
Thumbnail size in pixels.
|
||||
* `--content-size`
|
||||
Number of bytes of text to be extracted from the content of files (plain text and PDFs).
|
||||
Repeated whitespace and special characters do not count toward this limit.
|
||||
* `--incremental`
|
||||
Specify an existing index. Information about files in this index that were not modified (based on *mtime* attribute)
|
||||
will be copied to the new index and will not be parsed again.
|
||||
* `-o, --output` Output directory.
|
||||
* `--rewrite-url` Set the `rewrite_url` option for the web module (See [rewrite_url](#rewrite_url))
|
||||
* `--name` Set the `name` option for the web module
|
||||
* `--depth` Maximum scan dept. Set to 0 only scan files directly in the root directory, set to -1 for infinite depth
|
||||
* `--archive` Archive file mode.
|
||||
* skip: Don't parse
|
||||
* list: Only get file names as text
|
||||
* shallow: Don't parse archives inside archives.
|
||||
* recurse: Scan archives recursively (default)
|
||||
* `--ocr` See [OCR](README.md#OCR)
|
||||
* `-e, --exclude` Regex pattern to exclude files. A file is excluded if the pattern matches any
|
||||
part of the full absolute path.
|
||||
|
||||
Examples:
|
||||
* `-e ".*\.ttf"`: Ignore ttf files
|
||||
* `-e ".*\.(ttf|rar)"`: Ignore ttf and rar files
|
||||
* `-e "^/mnt/backups/"`: Ignore all files in the `/mnt/backups/` directory
|
||||
* `-e "^/mnt/Data[12]/"`: Ignore all files in the `/mnt/Data1/` and `/mnt/Data2/` directory
|
||||
* `-e "(^/usr/)|(^/var/)|(^/media/DRIVE-A/tmp/)|(^/media/DRIVE-B/Trash/)"` Exclude the
|
||||
`/usr`, `/var`, `/media/DRIVE-A/tmp`, `/media/DRIVE-B/Trash` directories
|
||||
* `--fast` Only index file names and mime type
|
||||
|
||||
### Scan examples
|
||||
|
||||
Simple scan
|
||||
```bash
|
||||
sist2 scan ~/Documents
|
||||
|
||||
sist2 scan \
|
||||
--threads 4 --content-size 16000000 --quality 1.0 --archive shallow \
|
||||
--name "My Documents" --rewrite-url "http://nas.domain.local/My Documents/" \
|
||||
~/Documents -o ./documents.idx/
|
||||
```
|
||||
|
||||
Incremental scan
|
||||
```
|
||||
sist2 scan --incremental ./orig_idx/ -o ./updated_idx/ ~/Documents
|
||||
```
|
||||
|
||||
### Index format
|
||||
|
||||
A typical `binary` type index structure looks like this:
|
||||
```
|
||||
documents.idx/
|
||||
├── descriptor.json
|
||||
├── _index_139965416830720
|
||||
├── _index_139965425223424
|
||||
├── _index_139965433616128
|
||||
├── _index_139965442008832
|
||||
└── thumbs
|
||||
├── data.mdb
|
||||
└── lock.mdb
|
||||
```
|
||||
|
||||
The `_index_*` files contain the raw binary index data and are not meant to be
|
||||
read by other applications. The format is generally compatible across different
|
||||
sist2 versions.
|
||||
|
||||
The `thumbs/` folder is a [LMDB](https://en.wikipedia.org/wiki/Lightning_Memory-Mapped_Database)
|
||||
database containing the thumbnails.
|
||||
|
||||
The `descriptor.json` file contains general information about the index. The
|
||||
following fields are safe to modify manually: `root`, `name`, [rewrite_url](#rewrite_url) and `timestamp`.
|
||||
|
||||
|
||||
*Advanced usage*
|
||||
|
||||
Instead of using the `scan` module, you can also import an index generated
|
||||
by a third party application. The 'external' index must have the following format:
|
||||
|
||||
```
|
||||
my_index/
|
||||
├── descriptor.json
|
||||
├── _index_0
|
||||
└── thumbs
|
||||
├── data.mdb
|
||||
└── lock.mdb
|
||||
```
|
||||
|
||||
*descriptor.json*:
|
||||
```json
|
||||
{
|
||||
"uuid": "<valid UUID4>",
|
||||
"version": "_external_v1",
|
||||
"root": "(optional)",
|
||||
"name": "<name>",
|
||||
"rewrite_url": "(optional)",
|
||||
"type": "json",
|
||||
"timestamp": 1578971024
|
||||
}
|
||||
```
|
||||
|
||||
*_index_0*: NDJSON format (One json object per line)
|
||||
|
||||
```json
|
||||
{
|
||||
"_id": "unique uuid for the file",
|
||||
"index": "index uuid4 (same one as descriptor.json!)",
|
||||
"mime": "application/x-cbz",
|
||||
"size": 14341204,
|
||||
"mtime": 1578882996,
|
||||
"extension": "cbz",
|
||||
"name": "my_book",
|
||||
"path": "path/to/books",
|
||||
"content": "text contents of the book",
|
||||
"title": "Title of the book",
|
||||
"tag": ["genre.fiction", "author.someguy", "etc..."],
|
||||
"_keyword": [
|
||||
{"k": "ISBN", "v": "ABCD34789231"}
|
||||
],
|
||||
"_text": [
|
||||
{"k": "other", "v": "This will be indexed as text"}
|
||||
]
|
||||
}
|
||||
```
|
||||
|
||||
You can find the full list of supported fields [here](src/io/serialize.c#L90)
|
||||
|
||||
The `_keyword.*` items will be indexed and searchable as **keyword** fields (only full matches allowed).
|
||||
The `_text.*` items will be indexed and searchable as **text** fields (fuzzy searching allowed)
|
||||
|
||||
|
||||
*thumbs/*:
|
||||
|
||||
LMDB key-value store. Keys are **binary** 128-bit UUID4s (`_id` field)
|
||||
and values are raw image bytes.
|
||||
|
||||
Importing an external `binary` type index is technically possible but
|
||||
it is currently unsupported and has no guaranties of back/forward compatibility.
|
||||
|
||||
|
||||
## Index
|
||||
### Index options
|
||||
* `--es-url`
|
||||
Elasticsearch url and port. If you are using docker, make sure that both containers are on the
|
||||
same network.
|
||||
* `-p, --print`
|
||||
Print index in JSON format to stdout.
|
||||
* `--script-file`
|
||||
Path to user script. See [Scripting](scripting/README.md).
|
||||
* `--batch-size=<int>`
|
||||
Index batch size. Indexing is generally faster with larger batches, but payloads that
|
||||
are too large will fail and additional overhead for retrying with smaller sizes may slow
|
||||
down the process.
|
||||
* `-f, --force-reset`
|
||||
Reset Elasticsearch mappings and settings.
|
||||
**(You must use this option the first time you use the index command)**.
|
||||
|
||||
### Index examples
|
||||
|
||||
**Push to elasticsearch**
|
||||
```bash
|
||||
sist2 index --force-reset --batch-size 1000 --es-url http://localhost:9200 ./my_index/
|
||||
sist2 index ./my_index/
|
||||
```
|
||||
|
||||
**Save index in JSON format**
|
||||
```bash
|
||||
sist2 index --print ./my_index/ > my_index.ndjson
|
||||
```
|
||||
|
||||
**Inspect contents of an index**
|
||||
```bash
|
||||
sist2 index --print ./my_index/ | jq | less
|
||||
```
|
||||
|
||||
## Web
|
||||
|
||||
### Web options
|
||||
* `--es-url=<str>` Elasticsearch url.
|
||||
* `--bind=<str>` Listen on this address.
|
||||
* `--port=<str>` Listen on this port.
|
||||
* `--auth=<str>` Basic auth in user:password format
|
||||
|
||||
### Web examples
|
||||
|
||||
**Single index**
|
||||
```bash
|
||||
sist2 web --auth admin:hunter2 --bind 0.0.0.0 --port 8888 my_index
|
||||
```
|
||||
|
||||
**Multiple indices**
|
||||
```bash
|
||||
# Indices will be displayed in this order in the web interface
|
||||
sist2 web index1 index2 index3 index4
|
||||
```
|
||||
|
||||
### rewrite_url
|
||||
|
||||
When the `rewrite_url` field is not empty, the web module ignores the `root`
|
||||
field and will return a HTTP redirect to `<rewrite_url><path>/<name><extension>`
|
||||
instead of serving the file from disk.
|
||||
Both the `root` and `rewrite_url` fields are safe to manually modify from the
|
||||
`descriptor.json` file.
|
||||
|
||||
### Link to specific indices
|
||||
|
||||
To link to specific indices, you can add a list of comma-separated index name to
|
||||
the URL: `?i=<name>,<name>`. By default, indices with `"(nsfw)"` in their name are
|
||||
not displayed.
|
||||
@@ -54,6 +54,11 @@ script.painless.regex.enabled: true
|
||||
```
|
||||
Or, if you're using docker add `-e "script.painless.regex.enabled=true"`
|
||||
|
||||
**Tag color**
|
||||
|
||||
You can specify the color for an individual tag by appending an
|
||||
hexadecimal color code (`#RRGGBBAA`) to the tag name.
|
||||
|
||||
### Examples
|
||||
|
||||
If `(20XX)` is in the file name, add the `year.<year>` tag:
|
||||
@@ -115,3 +120,33 @@ if (ctx._source.path != "") {
|
||||
tags.add("studio." + names[names.length-1]);
|
||||
}
|
||||
```
|
||||
|
||||
Parse `EXIF:F Number` tag
|
||||
```Java
|
||||
if (ctx._source?.exif_fnumber != null) {
|
||||
String[] values = ctx._source.exif_fnumber.splitOnToken(' ');
|
||||
String aperture = String.valueOf(Float.parseFloat(values[0]) / Float.parseFloat(values[1]));
|
||||
if (aperture == "NaN") {
|
||||
aperture = "0,0";
|
||||
}
|
||||
tags.add("Aperture.f/" + aperture.replace(".", ","));
|
||||
}
|
||||
```
|
||||
|
||||
Display year and months from `EXIF:DateTime` tag
|
||||
```Java
|
||||
if (ctx._source?.exif_datetime != null) {
|
||||
SimpleDateFormat parser = new SimpleDateFormat("yyyy:MM:dd HH:mm:ss");
|
||||
Date date = parser.parse(ctx._source.exif_datetime);
|
||||
|
||||
SimpleDateFormat yp = new SimpleDateFormat("yyyy");
|
||||
SimpleDateFormat mp = new SimpleDateFormat("MMMMMMMMM");
|
||||
|
||||
String year = yp.format(date);
|
||||
String month = mp.format(date);
|
||||
|
||||
tags.add("Month." + month);
|
||||
tags.add("Year." + year);
|
||||
}
|
||||
|
||||
```
|
||||
|
||||
@@ -6,7 +6,7 @@
|
||||
#define EPILOG "Made by simon987 <me@simon987.net>. Released under GPL-3.0"
|
||||
|
||||
|
||||
static const char *const Version = "1.2.15";
|
||||
static const char *const Version = "1.2.17";
|
||||
static const char *const usage[] = {
|
||||
"sist2 scan [OPTION]... PATH",
|
||||
"sist2 index [OPTION]... INDEX",
|
||||
|
||||
@@ -259,8 +259,10 @@ char *abspath(const char *path) {
|
||||
if (abs == NULL) {
|
||||
return NULL;
|
||||
}
|
||||
abs = realloc(abs, strlen(abs) + 2);
|
||||
strcat(abs, "/");
|
||||
if (strlen(abs) > 1) {
|
||||
abs = realloc(abs, strlen(abs) + 2);
|
||||
strcat(abs, "/");
|
||||
}
|
||||
|
||||
wordfree(&w);
|
||||
return abs;
|
||||
|
||||
File diff suppressed because one or more lines are too long
@@ -244,11 +244,18 @@ body {
|
||||
}
|
||||
|
||||
mark {
|
||||
background: #fff217;
|
||||
background: rgba(251, 191, 41, 0.25);
|
||||
border-radius: 0;
|
||||
padding: 1px 0;
|
||||
color: inherit;
|
||||
}
|
||||
|
||||
.content-div mark {
|
||||
background: rgba(251, 191, 41, 0.40);
|
||||
color: white;
|
||||
}
|
||||
|
||||
|
||||
.content-div {
|
||||
font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
|
||||
font-size: 13px;
|
||||
@@ -438,3 +445,7 @@ option {
|
||||
display: none;
|
||||
}
|
||||
}
|
||||
|
||||
.input-group > .custom-select:not(:first-child), .input-group > .form-control:not(:first-child) {
|
||||
border-right: none;
|
||||
}
|
||||
|
||||
@@ -184,6 +184,7 @@ mark {
|
||||
background: #fff217;
|
||||
border-radius: 0;
|
||||
padding: 1px 0;
|
||||
color: inherit;
|
||||
}
|
||||
|
||||
.content-div {
|
||||
@@ -305,3 +306,7 @@ mark {
|
||||
display: none;
|
||||
}
|
||||
}
|
||||
|
||||
.input-group > .custom-select:not(:first-child), .input-group > .form-control:not(:first-child) {
|
||||
border-right: none;
|
||||
}
|
||||
|
||||
@@ -546,20 +546,24 @@ function makeStatsCard(searchResult) {
|
||||
resultMode.appendChild(gridMode);
|
||||
resultMode.appendChild(listMode);
|
||||
|
||||
if (mode === "grid") {
|
||||
if (CONF.options.display === "grid") {
|
||||
gridMode.classList.add("active")
|
||||
} else {
|
||||
listMode.classList.add("active")
|
||||
}
|
||||
|
||||
gridMode.addEventListener("click", () => {
|
||||
mode = "grid";
|
||||
localStorage.setItem("mode", mode);
|
||||
console.log("what");
|
||||
console.log(CONF.options);
|
||||
CONF.options.display = "grid";
|
||||
console.log(CONF.options);
|
||||
CONF.save();
|
||||
console.log(CONF.options);
|
||||
searchDebounced();
|
||||
});
|
||||
listMode.addEventListener("click", () => {
|
||||
mode = "list";
|
||||
localStorage.setItem("mode", mode);
|
||||
CONF.options.display = "list";
|
||||
CONF.save();
|
||||
searchDebounced();
|
||||
});
|
||||
|
||||
@@ -584,7 +588,7 @@ function makeStatsCard(searchResult) {
|
||||
function makeResultContainer() {
|
||||
let resultContainer = document.createElement("div");
|
||||
|
||||
if (mode === "grid") {
|
||||
if (CONF.options.display === "grid") {
|
||||
resultContainer.setAttribute("class", "card-columns");
|
||||
} else {
|
||||
resultContainer.setAttribute("class", "list-group");
|
||||
|
||||
@@ -13,13 +13,39 @@ let coolingDown = false;
|
||||
let searchBusy = true;
|
||||
let selectedIndices = [];
|
||||
|
||||
let mode;
|
||||
if (localStorage.getItem("mode") === null) {
|
||||
mode = "grid";
|
||||
} else {
|
||||
mode = localStorage.getItem("mode")
|
||||
const CONF = new Settings();
|
||||
|
||||
const _defaults = {
|
||||
display: "grid",
|
||||
fuzzy: true,
|
||||
highlight: true
|
||||
};
|
||||
|
||||
function Settings() {
|
||||
this.options = {};
|
||||
|
||||
this._onUpdate = function() {
|
||||
$("#fuzzyToggle").prop("checked", this.options.fuzzy);
|
||||
}
|
||||
|
||||
this.load = function() {
|
||||
const raw = window.localStorage.getItem("options");
|
||||
if (raw === null) {
|
||||
this.options = _defaults;
|
||||
} else {
|
||||
this.options = JSON.parse(raw);
|
||||
}
|
||||
|
||||
this._onUpdate();
|
||||
}
|
||||
|
||||
this.save = function() {
|
||||
window.localStorage.setItem("options", JSON.stringify(this.options));
|
||||
this._onUpdate();
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
function showEsError() {
|
||||
$.toast({
|
||||
heading: "Elasticsearch connection error",
|
||||
@@ -54,6 +80,7 @@ window.onload = () => {
|
||||
}
|
||||
window.location.reload();
|
||||
})
|
||||
CONF.load();
|
||||
};
|
||||
|
||||
function toggleFuzzy() {
|
||||
@@ -250,7 +277,7 @@ new autoComplete({
|
||||
function insertHits(resultContainer, hits) {
|
||||
for (let i = 0; i < hits.length; i++) {
|
||||
|
||||
if (mode === "grid") {
|
||||
if (CONF.options.display === "grid") {
|
||||
resultContainer.appendChild(createDocCard(hits[i]));
|
||||
} else {
|
||||
resultContainer.appendChild(createDocLine(hits[i]));
|
||||
@@ -364,17 +391,6 @@ function search(after = null) {
|
||||
{"_score": {"order": "desc"}},
|
||||
{"_tie": {"order": "asc"}}
|
||||
],
|
||||
highlight: {
|
||||
pre_tags: ["<mark>"],
|
||||
post_tags: ["</mark>"],
|
||||
fields: {
|
||||
content: {},
|
||||
// "content.nGram": {},
|
||||
name: {},
|
||||
"name.nGram": {},
|
||||
font_name: {},
|
||||
}
|
||||
},
|
||||
aggs:
|
||||
{
|
||||
total_size: {"sum": {"field": "size"}},
|
||||
@@ -387,6 +403,20 @@ function search(after = null) {
|
||||
q.search_after = [after["_score"], after["_id"]];
|
||||
}
|
||||
|
||||
if (CONF.options.highlight) {
|
||||
q.highlight = {
|
||||
pre_tags: ["<mark>"],
|
||||
post_tags: ["</mark>"],
|
||||
fields: {
|
||||
content: {},
|
||||
// "content.nGram": {},
|
||||
name: {},
|
||||
"name.nGram": {},
|
||||
font_name: {},
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
$.jsonPost("es", q).then(searchResult => {
|
||||
let hits = searchResult["hits"]["hits"];
|
||||
if (hits) {
|
||||
@@ -480,7 +510,6 @@ window.onkeyup = function(e) {
|
||||
bar.scrollIntoView();
|
||||
bar.focus();
|
||||
}
|
||||
console.log(e)
|
||||
};
|
||||
|
||||
//Suggest
|
||||
@@ -501,3 +530,30 @@ function getPathChoices() {
|
||||
})
|
||||
}
|
||||
|
||||
function updateSettings() {
|
||||
CONF.options.display = $("#settingDisplay").val();
|
||||
CONF.options.fuzzy = $("#settingFuzzy").prop("checked");
|
||||
CONF.options.highlight = $("#settingHighlight").prop("checked");
|
||||
CONF.save();
|
||||
|
||||
searchDebounced();
|
||||
|
||||
$.toast({
|
||||
heading: "Settings updated",
|
||||
text: "Settings saved to browser storage",
|
||||
stack: 3,
|
||||
bgColor: "#00a4bc",
|
||||
textColor: "#fff",
|
||||
position: 'bottom-right',
|
||||
hideAfter: 3000,
|
||||
loaderBg: "#08c7e8",
|
||||
});
|
||||
}
|
||||
|
||||
function loadSettings() {
|
||||
CONF.load();
|
||||
|
||||
$("#settingDisplay").val(CONF.options.display);
|
||||
$("#settingFuzzy").prop("checked", CONF.options.fuzzy);
|
||||
$("#settingHighlight").prop("checked", CONF.options.highlight);
|
||||
}
|
||||
|
||||
@@ -11,9 +11,10 @@
|
||||
|
||||
<nav class="navbar navbar-expand-lg">
|
||||
<a class="navbar-brand" href="/">sist2</a>
|
||||
<span class="badge badge-pill version">v1.2.15</span>
|
||||
<span class="badge badge-pill version">v1.2.17</span>
|
||||
<span class="tagline">Lightning-fast file system indexer and search tool </span>
|
||||
<a style="margin-left: auto" id="theme" class="btn" title="Toggle theme" href="/">Theme</a>
|
||||
<button style="margin-left: auto" class="btn" type="button" data-toggle="modal" data-target="#settings" onclick="loadSettings()">Settings</button>
|
||||
<a id="theme" class="btn" title="Toggle theme" href="/">Theme</a>
|
||||
</nav>
|
||||
|
||||
<div class="container">
|
||||
@@ -151,6 +152,39 @@
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="modal" id="settings" tabindex="-1" role="dialog" aria-labelledby="modal-title" aria-hidden="true">
|
||||
<div class="modal-dialog modal-dialog-centered" role="document">
|
||||
<div class="modal-content">
|
||||
<div class="modal-header">
|
||||
<h5 class="modal-title">Settings</h5>
|
||||
<button type="button" class="close" data-dismiss="modal" aria-label="Close">
|
||||
<span aria-hidden="true">×</span>
|
||||
</button>
|
||||
</div>
|
||||
<div class="modal-body">
|
||||
<div class="custom-control custom-checkbox">
|
||||
<input type="checkbox" class="custom-control-input" id="settingHighlight">
|
||||
<label class="custom-control-label" for="settingHighlight">Enable highlighting</label>
|
||||
</div>
|
||||
|
||||
<div class="custom-control custom-checkbox">
|
||||
<input type="checkbox" class="custom-control-input" id="settingFuzzy">
|
||||
<label class="custom-control-label" for="settingFuzzy">Set fuzzy search by default</label>
|
||||
</div>
|
||||
|
||||
<label for="settingDisplay">Display</label>
|
||||
<select id="settingDisplay" class="form-control form-control-sm">
|
||||
<option value="grid">Grid</option>
|
||||
<option value="list">List</option>
|
||||
</select>
|
||||
|
||||
<br>
|
||||
<button style="float: right" class="btn btn-primary" onclick="updateSettings()">Update settings</button>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div id="searchResults"></div>
|
||||
</div>
|
||||
|
||||
|
||||
Reference in New Issue
Block a user