Compare commits

..

132 Commits

Author SHA1 Message Date
5f7a1acfe3 Merge pull request #36 from simon987/wip-doc
Wip doc
2020-03-05 18:43:56 -05:00
513a21cca2 Undo debug stuff 2020-03-05 18:42:51 -05:00
04dbfb23ab Cleanup warnings 2020-03-05 16:53:30 -05:00
1abddabeec Rewrite doc.c module, fix bad error handling, fix pdf.c memory leaks 2020-03-05 16:12:34 -05:00
9ace5774af Update dependencies 2020-03-05 16:10:45 -05:00
eab6101cf7 make --fast faster 2020-03-05 12:26:43 -05:00
d7cbd5d2b6 wip doc rewrite 2020-03-05 09:13:37 -05:00
641edf2715 Prettier warning messages in main.c 2020-03-04 17:57:49 -05:00
7efb4957bf inline text/util functions 2020-03-04 17:50:31 -05:00
9ae77fdedb Fix css glitch 2020-03-03 16:51:01 -05:00
98c40901ed Disallow incremental scan when version does not match (#33) 2020-03-03 16:36:07 -05:00
363375d5da version bump 2020-03-03 16:25:41 -05:00
149de95d88 (breaking) Upgrade path filter bar 2020-03-03 16:24:24 -05:00
e5bb4856d2 (breaking) Set item depth in ingest pipeline 2020-03-02 17:39:25 -05:00
d78994d427 Ignore --incremental option when the directory does not exist (#31) 2020-03-01 21:16:50 -05:00
f2d68d54df Update README.md 2020-03-01 13:55:08 -05:00
e03625838b Settings menu (#30) and UI tweaks 2020-02-29 19:26:09 -05:00
86840b46f4 Version bump 2020-02-27 09:47:06 -05:00
e57f9916eb Rewrite documentation 2020-02-27 09:45:14 -05:00
565ba6ee76 Fix for #29 2020-02-27 09:44:19 -05:00
d83fc2c373 Fix docker build for 1.2.15 2020-02-27 09:42:18 -05:00
d4da28249e --fast option #27 2020-02-22 18:37:08 -05:00
483a454c8d --exclude argument #26 2020-02-22 16:55:35 -05:00
018ac86640 fix build... 2020-02-22 13:20:41 -05:00
398f1aead4 Support for cbr documents 2020-02-22 13:11:19 -05:00
d19a75926b Fix invalid read in terminate_string() 2020-02-22 13:10:40 -05:00
1ac8b40e3d Code style 2020-02-22 09:02:59 -05:00
a8505cb8c1 Fix for #28 2020-02-20 16:42:13 -05:00
ae8652d86e UI tweaks, search syntax (#25) 2020-02-16 15:24:29 -05:00
849beb09d8 hotfix 2020-02-15 19:33:18 -05:00
e1aaaee617 UI tweak 2020-02-15 09:30:14 -05:00
c02b940945 (I forgot to commit this) 2020-02-14 20:58:10 -05:00
2934ddb07f Add image viewer (#2) 2020-02-14 18:28:55 -05:00
7f6f3c02fa OCR tweaks 2020-02-11 21:13:47 -05:00
7f98d5a682 Fix buffer overflow (whoops) 2020-02-09 18:11:29 -05:00
7eb9c5d7d5 Fix web/index issue with NULL mime types 2020-02-09 17:23:49 -05:00
184439aa38 increase minimum image size for OCR 2020-02-09 14:06:59 -05:00
1ce8b298a1 Display EXIF tags on document info panel, remove march=native on openjp 2020-02-09 13:21:19 -05:00
75f99025d9 add exif dateTime, allow some special characters in text meta 2020-02-09 08:47:13 -05:00
ebe852bd5a Fix rewrite-url arg 2020-02-09 08:23:17 -05:00
402b103c49 Fix total count for ES 7.5 2020-02-08 09:25:00 -05:00
e9b6e1cdc2 Turn off auto optimisation in libtesseract build 2020-02-08 08:32:04 -05:00
ed1ce8ab5e Handle XML errors #18 2020-02-07 10:08:01 -05:00
d1fa4febc4 Improve scroll feature, UI fix 2020-02-07 10:08:01 -05:00
048c55df7b Update README.md 2020-02-06 19:56:29 -05:00
f77bc6a025 Update README.md 2020-02-06 19:55:32 -05:00
efdde2734e version bump 2020-02-06 19:28:05 -05:00
66658fa8f7 Remove trailing/leading white space in text meta fields 2020-02-06 19:27:30 -05:00
df41c251e4 (Breaking!) Add some exif tags 2020-02-06 19:21:50 -05:00
3282ab56ba Version bump 2020-02-02 09:26:54 -05:00
8300838d30 Suppress XML parsing errors (#18) 2020-02-02 09:26:03 -05:00
c9870a6d3d Remove -march=native for release build... 2020-02-02 09:03:06 -05:00
a143cc4fcf bundle openssl... 2020-02-02 08:39:20 -05:00
9ef1f3781d fix attempt for #11 2020-02-01 20:04:26 -05:00
bbee8aa721 tesseract ocr path fix 2020-02-01 20:03:59 -05:00
d22f83c797 curl fix 2020-02-01 15:22:43 -05:00
50615486a4 curl fix attempt 2020-02-01 14:42:42 -05:00
ca79e4f797 add /status endpoint 2020-01-28 10:18:37 -05:00
6a9fd08a80 Merge pull request #21 from simon987/wip-20
Fixes #20
2020-01-27 09:16:00 -05:00
cab890dc9b #20 wip 2020-01-27 09:09:42 -05:00
b3c4faf2df Update README.md 2020-01-26 12:37:13 -05:00
353937171a Update README.md 2020-01-20 15:54:53 -05:00
c80002bea4 Bundle libcurl attempt 2 2020-01-18 11:53:12 -05:00
56adee9d81 Bundle libcurl, libopc bugfix #18 2020-01-18 10:25:02 -05:00
d6493d6d5f Bundle libpng 2020-01-16 16:21:38 -05:00
0967e9676d remove static build in CI... 2020-01-16 15:45:18 -05:00
487e998ea0 Display error message on /d/ error 2020-01-16 15:04:50 -05:00
919f45c79c Document info modal #19 2020-01-16 14:37:19 -05:00
d42129cfcb CI fix attempt 2020-01-15 20:11:45 -05:00
754983e34a Minor cleanup 2020-01-15 18:16:06 -05:00
7c8a3e2f9d Support for external json indices 2020-01-14 15:44:31 -05:00
3bb24b4453 Use bundled libtiff 2020-01-14 12:21:26 -05:00
9a56b959d3 Fix build problems... 2020-01-14 10:55:02 -05:00
5e3a2dbcc2 Update README 2020-01-14 10:47:00 -05:00
573f94f24e OCR support, remove static build 2020-01-14 10:26:40 -05:00
f5db78a69f Ignore special ascii chars, strip binary in docker build 2020-01-12 10:59:17 -05:00
5a2820d339 UI tweak auto-select based on query args 2020-01-11 17:48:51 -05:00
b7f13f425c Fix memory leaks (whoops) 2020-01-11 17:34:34 -05:00
d1a2f9b1d5 Strip binary (CI) 2020-01-07 14:32:39 -05:00
71f17986db build settings 2020-01-06 21:34:41 -05:00
acdd2fb3c1 Use bundled ffmpeg libraries 2020-01-06 16:25:34 -05:00
0cda6c00e1 CI attempt 2020-01-03 20:21:07 -05:00
14d0e5a1e1 possible fix for #18 2019-12-28 14:32:42 -05:00
0d06d39281 Path in list view #16 2019-12-28 14:32:05 -05:00
80708ca636 Merge pull request #17 from dpieski/patch-1
maybe a typo in cli.c
2019-12-23 18:33:28 -05:00
Andrew
43b7b40dc4 maybe a typo in cli.c
possibly corrected a typo
2019-12-23 13:18:18 -06:00
d051f541e2 Show client error on ES connection failure, fixes #13 2019-12-21 20:52:53 -05:00
0eefbac7b4 Update libopc. should fix #14 2019-12-21 19:43:33 -05:00
663f8e21c1 Better logging, fixes #15 2019-12-21 12:32:08 -05:00
80fbcb2a01 empty docx bugfix 2019-12-19 17:26:11 -05:00
8451109ecd OOXML files support 2019-12-19 16:53:18 -05:00
d6fe61cfdc Clarify help string for es url #12 2019-12-19 16:52:22 -05:00
254094130f Fix submodules 2019-12-13 12:35:39 -05:00
eaaa75c04c Fix submodules 2019-12-13 11:24:17 -05:00
bb87f4270f Update docker script 2019-12-13 11:16:17 -05:00
be23201210 Archive file support 2019-12-13 10:53:51 -05:00
9778acda77 uifix 2019-12-12 19:19:53 -05:00
8d187926d9 Bugfix with incremental comparison 2019-12-12 15:41:31 -05:00
88c37e3523 Update README.md 2019-12-04 20:56:52 -05:00
d816dae8b3 UI fix, disable thumbnail option, batch index size option 2019-12-01 10:57:29 -05:00
4346c3e063 Also use static libraries in sist2 build 2019-11-30 20:02:26 -05:00
1a1032a8a7 Cleaner shutdown 2019-11-30 19:59:11 -05:00
4ab2ba1a02 #8 Skip PDF scan when content-size is 0 2019-11-21 16:06:31 -05:00
d089601dc5 Add sfv & m3u 2019-11-20 12:31:31 -05:00
11df6cc88f Add nfo to ext list 2019-11-20 11:41:50 -05:00
373ac01e4e Fix for #3 and maximum scan depth 2019-11-19 11:23:30 -05:00
893ff145c5 List mode tweak 2019-11-17 16:28:47 -05:00
6111ded77f Merge pull request #6 from simon987/wip
List mode #5
2019-11-17 16:15:36 -05:00
34cc26b2fd List mode #5 wip 2019-11-17 15:03:24 -05:00
204034d859 Add basic auth. Fixes #4 2019-11-17 10:00:17 -05:00
16ccc6c0d3 Show error message on elasticsearch connection fail 2019-11-17 09:55:16 -05:00
94c617fdc3 Bug fix 2019-11-12 22:11:50 -05:00
ebfd7e03ce User scripts, bug fixes, docker image 2019-11-12 20:58:43 -05:00
6931d320a2 bugfix with invalid/corrupted index path 2019-11-11 20:49:38 -05:00
fc22e52eae Image placeholder 2019-11-09 23:26:49 -05:00
ba81748a74 Update build 2019-11-09 17:15:20 -05:00
e72fa1587b EXIF metadata for images 2019-11-09 15:18:44 -05:00
ea4fb7fa0d Bug fixes 2019-11-09 12:00:07 -05:00
b0a868bb73 remove 'must match' 2019-11-08 21:46:54 -05:00
d761a3b595 update readme 2019-11-08 19:42:36 -05:00
2d7a8a2fdc fuzzy toggle 2019-11-08 16:15:10 -05:00
152d2ddf8a bug fix in deserialize 2019-11-08 09:03:44 -05:00
bc5f22b759 update readme 2019-11-05 18:59:00 -05:00
534b397876 update readme, UI tweak: don't show broken images 2019-11-03 10:39:02 -05:00
7962a994e2 utf8 update + bug fixes 2019-11-03 07:50:31 -05:00
f8f1a27180 video metadata 2019-10-31 11:54:13 -04:00
784c3c9435 Font rendering fixes 2019-10-31 10:15:01 -04:00
f8b081a3f4 UI tweaks, path autocomplete 2019-10-31 08:26:19 -04:00
5661573b06 Dark theme, pdf meta, de-serialize bugfix 2019-10-30 22:20:22 -04:00
130fb78787 Fix some memory leaks 2019-10-27 15:40:48 -04:00
2943ca9365 UI tweak 2019-10-27 14:10:24 -04:00
7234c22d2f epub fix 2019-10-27 14:00:52 -04:00
95 changed files with 5806 additions and 1697 deletions

3
.gitignore vendored
View File

@@ -11,7 +11,8 @@ Makefile
LOG LOG
sist2* sist2*
index.sist2/ index.sist2/
bundle.css bundle*.css
bundle.js bundle.js
*.a *.a
vgcore.* vgcore.*
build/

45
.gitmodules vendored
View File

@@ -4,15 +4,42 @@
[submodule "cJSON"] [submodule "cJSON"]
path = cJSON path = cJSON
url = https://github.com/DaveGamble/cJSON url = https://github.com/DaveGamble/cJSON
[submodule "lib/mupdf"]
path = lib/mupdf
url = git://git.ghostscript.com/mupdf.git
[submodule "lib/onion"]
path = lib/onion
url = https://github.com/davidmoreno/onion
[submodule "lib/ffmpeg"]
path = lib/ffmpeg
url = https://git.ffmpeg.org/ffmpeg.git
[submodule "lmdb"] [submodule "lmdb"]
path = lmdb path = lmdb
url = https://github.com/LMDB/lmdb url = https://github.com/LMDB/lmdb
[submodule "utf8.h"]
path = utf8.h
url = https://github.com/sheredom/utf8.h
[submodule "lib/bzip2-1.0.6"]
path = lib/bzip2-1.0.6
url = https://github.com/enthought/bzip2-1.0.6
[submodule "lib/libmagic"]
path = lib/libmagic
url = https://github.com/threatstack/libmagic
[submodule "lib/harfbuzz"]
path = lib/harfbuzz
url = https://github.com/harfbuzz/harfbuzz
[submodule "lib/openjpeg"]
path = lib/openjpeg
url = https://github.com/uclouvain/openjpeg
[submodule "lib/ffmpeg"]
path = lib/ffmpeg
url = https://git.ffmpeg.org/ffmpeg.git
[submodule "lib/onion"]
path = lib/onion
url = https://github.com/davidmoreno/onion
[submodule "lib/mupdf"]
path = lib/mupdf
url = git://git.ghostscript.com/mupdf.git
[submodule "lib/tesseract"]
path = lib/tesseract
url = https://github.com/tesseract-ocr/tesseract
[submodule "lib/leptonica"]
path = lib/leptonica
url = https://github.com/danbloomberg/leptonica
[submodule "lib/libtiff"]
path = lib/libtiff
url = https://gitlab.com/libtiff/libtiff
[submodule "lib/libpng"]
path = lib/libpng
url = https://github.com/glennrp/libpng

69
.teamcity/settings.kts vendored Normal file
View File

@@ -0,0 +1,69 @@
import jetbrains.buildServer.configs.kotlin.v2019_2.*
import jetbrains.buildServer.configs.kotlin.v2019_2.buildSteps.ExecBuildStep
import jetbrains.buildServer.configs.kotlin.v2019_2.buildSteps.exec
import jetbrains.buildServer.configs.kotlin.v2019_2.triggers.vcs
import jetbrains.buildServer.configs.kotlin.v2019_2.vcs.GitVcsRoot
/*
The settings script is an entry point for defining a TeamCity
project hierarchy. The script should contain a single call to the
project() function with a Project instance or an init function as
an argument.
VcsRoots, BuildTypes, Templates, and subprojects can be
registered inside the project using the vcsRoot(), buildType(),
template(), and subProject() methods respectively.
To debug settings scripts in command-line, run the
mvnDebug org.jetbrains.teamcity:teamcity-configs-maven-plugin:generate
command and attach your debugger to the port 8000.
To debug in IntelliJ Idea, open the 'Maven Projects' tool window (View
-> Tool Windows -> Maven Projects), find the generate task node
(Plugins -> teamcity-configs -> teamcity-configs:generate), the
'Debug' option is available in the context menu for the task.
*/
version = "2019.2"
project {
vcsRoot(HttpsGithubComSimon987sist2refsHeadsMaster)
buildType(Build)
}
object Build : BuildType({
name = "Build"
artifactRules = """
sist2
sist2_scan
""".trimIndent()
vcs {
root(HttpsGithubComSimon987sist2refsHeadsMaster)
}
steps {
exec {
name = "Build"
path = "./ci/build.sh"
dockerImage = "simon987/general_ci"
dockerImagePlatform = ExecBuildStep.ImagePlatform.Linux
dockerPull = true
}
}
triggers {
vcs {
}
}
})
object HttpsGithubComSimon987sist2refsHeadsMaster : GitVcsRoot({
name = "https://github.com/simon987/sist2#refs/heads/master"
url = "https://github.com/simon987/sist2"
})

View File

@@ -1,88 +1,59 @@
cmake_minimum_required(VERSION 3.7) cmake_minimum_required(VERSION 3.7)
set(CMAKE_C_STANDARD 11) set(CMAKE_C_STANDARD 11)
option(WITH_SIST2 "Build main executable" ON)
option(WITH_SIST2_SCAN "Build scan executable" ON)
project(sist2 C) project(sist2 C)
list(APPEND CMAKE_MODULE_PATH "${CMAKE_CURRENT_LIST_DIR}/CMakeModules") list(APPEND CMAKE_MODULE_PATH "${CMAKE_CURRENT_LIST_DIR}/CMakeModules")
if (WITH_SIST2) option(SIST_DEBUG "Build a debug executable" on)
add_executable(
sist2
src/main.c
src/sist.h
src/io/walk.h src/io/walk.c
src/parsing/media.h src/parsing/media.c
src/parsing/pdf.h src/parsing/pdf.c
src/io/store.h src/io/store.c
src/tpool.h src/tpool.c
src/parsing/parse.h src/parsing/parse.c
src/io/serialize.h src/io/serialize.c
src/parsing/mime.h src/parsing/mime.c src/parsing/mime_generated.c
src/parsing/text.h src/parsing/text.c
src/index/web.c src/index/web.h
src/web/serve.c src/web/serve.h
src/index/elastic.c src/index/elastic.h
src/util.c src/util.h
src/ctx.h src/types.h src/parsing/font.c src/parsing/font.h
# argparse add_executable(
argparse/argparse.h argparse/argparse.c sist2
src/main.c
src/sist.h
src/io/walk.h src/io/walk.c
src/parsing/media.h src/parsing/media.c
src/parsing/pdf.h src/parsing/pdf.c
src/io/store.h src/io/store.c
src/tpool.h src/tpool.c
src/parsing/parse.h src/parsing/parse.c
src/io/serialize.h src/io/serialize.c
src/parsing/mime.h src/parsing/mime.c src/parsing/mime_generated.c
src/parsing/text.h src/parsing/text.c
src/index/web.c src/index/web.h
src/web/serve.c src/web/serve.h
src/web/auth_basic.h src/web/auth_basic.c
src/index/elastic.c src/index/elastic.h
src/util.c src/util.h
src/ctx.h src/types.h src/parsing/font.c src/parsing/font.h
src/parsing/arc.c src/parsing/arc.h
src/parsing/doc.c src/parsing/doc.h
src/log.c src/log.h
src/parsing/cbr.h src/parsing/cbr.c
# cJSON # argparse
cJSON/cJSON.h cJSON/cJSON.c argparse/argparse.h argparse/argparse.c
# LMDB # cJSON
lmdb/libraries/liblmdb/lmdb.h lmdb/libraries/liblmdb/mdb.c cJSON/cJSON.h cJSON/cJSON.c
lmdb/libraries/liblmdb/midl.h lmdb/libraries/liblmdb/midl.c
src/cli.c src/cli.h
)
endif ()
if (WITH_SIST2_SCAN) # LMDB
add_executable( lmdb/libraries/liblmdb/lmdb.h lmdb/libraries/liblmdb/mdb.c
sist2_scan lmdb/libraries/liblmdb/midl.h lmdb/libraries/liblmdb/midl.c
src/main.c src/cli.c src/cli.h
src/sist.h
src/io/walk.h src/io/walk.c
src/parsing/media.h src/parsing/media.c
src/parsing/pdf.h src/parsing/pdf.c
src/io/store.h src/io/store.c
src/tpool.h src/tpool.c
src/parsing/parse.h src/parsing/parse.c
src/io/serialize.h src/io/serialize.c
src/parsing/mime.h src/parsing/mime.c src/parsing/mime_generated.c
src/parsing/text.h src/parsing/text.c
src/util.c src/util.h
src/ctx.h src/types.h src/parsing/font.c src/parsing/font.h
# argparse # utf8.h
argparse/argparse.h argparse/argparse.c utf8.h/utf8.h
)
# cJSON
cJSON/cJSON.h cJSON/cJSON.c
# LMDB
lmdb/libraries/liblmdb/lmdb.h lmdb/libraries/liblmdb/mdb.c
lmdb/libraries/liblmdb/midl.h lmdb/libraries/liblmdb/midl.c
src/cli.c src/cli.h
)
endif ()
find_package(PkgConfig REQUIRED) find_package(PkgConfig REQUIRED)
set(ENV{PKG_CONFIG_PATH} "$ENV{PKG_CONFIG_PATH}:/usr/local/lib/pkgconfig/") set(ENV{PKG_CONFIG_PATH} "$ENV{PKG_CONFIG_PATH}:/usr/local/lib/pkgconfig/")
find_package(LibMagic REQUIRED)
find_package(FFmpeg REQUIRED)
find_package(OpenSSL REQUIRED)
find_package(Freetype REQUIRED) find_package(Freetype REQUIRED)
pkg_check_modules(GLIB REQUIRED glib-2.0) pkg_check_modules(GLIB REQUIRED glib-2.0)
pkg_check_modules(GOBJECT REQUIRED gobject-2.0) pkg_check_modules(GOBJECT REQUIRED gobject-2.0)
pkg_check_modules(UUID REQUIRED uuid) pkg_check_modules(UUID REQUIRED uuid)
add_definitions(${LIBMAGIC_CFLAGS_OTHER})
add_definitions(${UUID_CFLAGS_OTHER}) add_definitions(${UUID_CFLAGS_OTHER})
add_definitions(${GLIB_CFLAGS_OTHER}) add_definitions(${GLIB_CFLAGS_OTHER})
add_definitions(${GOBJECT_CFLAGS_OTHER}) add_definitions(${GOBJECT_CFLAGS_OTHER})
@@ -92,139 +63,113 @@ list(REMOVE_ITEM GLIB_LIBRARIES pcre)
list(REMOVE_ITEM GOBJECT_LIBRARIES pcre) list(REMOVE_ITEM GOBJECT_LIBRARIES pcre)
list(REMOVE_ITEM UUID_LIBRARIES pcre) list(REMOVE_ITEM UUID_LIBRARIES pcre)
if (WITH_SIST2) target_include_directories(
target_include_directories( sist2 PUBLIC
sist2 PUBLIC ${GOBJECT_INCLUDE_DIRS}
${LIBMAGIC_INCLUDE_DIRS} ${GLIB_INCLUDE_DIRS}
${GOBJECT_INCLUDE_DIRS} ${PROJECT_SOURCE_DIR}/lib/ffmpeg/
${OPENSSL_INCLUDE_DIR} ${FREETYPE_INCLUDE_DIRS}
${FFMPEG_INCLUDE_DIRS} ${UUID_INCLUDE_DIRS}
${GLIB_INCLUDE_DIRS} ${PROJECT_SOURCE_DIR}/
${FREETYPE_INCLUDE_DIRS} ${PROJECT_SOURCE_DIR}/lmdb/libraries/liblmdb/
${UUID_INCLUDE_DIRS} ${PROJECT_SOURCE_DIR}/lib/onion/src/
${PROJECT_SOURCE_DIR}/ ${PROJECT_SOURCE_DIR}/lib/mupdf/include/
${PROJECT_SOURCE_DIR}/lmdb/libraries/liblmdb/ ${PROJECT_SOURCE_DIR}/include/
${PROJECT_SOURCE_DIR}/lib/onion/src/ /usr/include/libxml2/
${PROJECT_SOURCE_DIR}/lib/mupdf/include/ ${PROJECT_SOURCE_DIR}/lib/tesseract/include/
) )
target_link_directories( target_link_directories(
sist2 PUBLIC sist2 PUBLIC
${UUID_LIBRARY_DIRS} ${UUID_LIBRARY_DIRS}
${FFMPEG_LIBRARY_DIRS} )
)
target_compile_options(
sist2
PRIVATE
-fPIC
)
target_compile_options(sist2 if (SIST_DEBUG)
PRIVATE target_compile_options(
-O3
# -march=native
-fno-stack-protector
-fomit-frame-pointer
)
TARGET_LINK_LIBRARIES(
sist2 sist2
${GLIB_LIBRARIES}
${GOBJECT_LIBRARIES}
${UUID_LIBRARIES}
# ffmpeg
${PROJECT_SOURCE_DIR}/lib/libavcodec.a
${PROJECT_SOURCE_DIR}/lib/libavformat.a
${PROJECT_SOURCE_DIR}/lib/libavutil.a
${PROJECT_SOURCE_DIR}/lib/libswscale.a
${PROJECT_SOURCE_DIR}/lib/libswresample.a
# ${FFMPEG_LIBRARIES}
# swscale
# mupdf
${PROJECT_SOURCE_DIR}/lib/libmupdf.a
${PROJECT_SOURCE_DIR}/lib/libmupdf-third.a
# onion
${PROJECT_SOURCE_DIR}/lib/libonion_static.a
pthread
curl
m
bz2
magic
)
endif ()
if (WITH_SIST2_SCAN)
set_target_properties(
sist2_scan
PROPERTIES COMPILE_DEFINITIONS SIST_SCAN_ONLY
)
set_target_properties(
sist2_scan
PROPERTIES
COMPILE_DEFINITIONS SIST_SCAN_ONLY
LINK_FLAGS -static
)
target_include_directories(
sist2_scan PUBLIC
${LIBMAGIC_INCLUDE_DIRS}
${GOBJECT_INCLUDE_DIRS}
${OPENSSL_INCLUDE_DIR}
${FFMPEG_INCLUDE_DIRS}
${GLIB_INCLUDE_DIRS}
${UUID_INCLUDE_DIRS}
${FREETYPE_INCLUDE_DIRS}
${PROJECT_SOURCE_DIR}/
${PROJECT_SOURCE_DIR}/lmdb/libraries/liblmdb/
${PROJECT_SOURCE_DIR}/lib/onion/src/
${PROJECT_SOURCE_DIR}/lib/mupdf/include/
)
target_link_directories(
sist2_scan PUBLIC
${UUID_LIBRARY_DIRS}
${FFMPEG_LIBRARY_DIRS}
)
target_compile_options(sist2_scan
PRIVATE PRIVATE
-O3 -g
# -march=native -fstack-protector
-fno-omit-frame-pointer
-fsanitize=address
)
target_link_options(
sist2
PRIVATE
-fsanitize=address
)
set_target_properties(
sist2
PROPERTIES
OUTPUT_NAME sist2_debug
)
else ()
target_compile_options(
sist2
PRIVATE
-Ofast
-fno-stack-protector -fno-stack-protector
-fomit-frame-pointer -fomit-frame-pointer
)
TARGET_LINK_LIBRARIES(
sist2_scan
${GLIB_LIBRARIES}
${GOBJECT_LIBRARIES}
${UUID_LIBRARIES}
# ffmpeg
${PROJECT_SOURCE_DIR}/lib/libavcodec.a
${PROJECT_SOURCE_DIR}/lib/libavformat.a
${PROJECT_SOURCE_DIR}/lib/libavutil.a
${PROJECT_SOURCE_DIR}/lib/libswscale.a
${PROJECT_SOURCE_DIR}/lib/libswresample.a
# mupdf
${PROJECT_SOURCE_DIR}/lib/libmupdf.a
${PROJECT_SOURCE_DIR}/lib/libmupdf-third.a
${PROJECT_SOURCE_DIR}/lib/libbz2.a
${PROJECT_SOURCE_DIR}/lib/libmagic.a
pthread
m
) )
endif () endif ()
TARGET_LINK_LIBRARIES(
sist2
${GLIB_LIBRARIES}
${GOBJECT_LIBRARIES}
${UUID_LIBRARIES}
# ffmpeg
${PROJECT_SOURCE_DIR}/lib/libavcodec.a
${PROJECT_SOURCE_DIR}/lib/libavformat.a
${PROJECT_SOURCE_DIR}/lib/libavutil.a
${PROJECT_SOURCE_DIR}/lib/libswscale.a
${PROJECT_SOURCE_DIR}/lib/libswresample.a
# mupdf
${PROJECT_SOURCE_DIR}/lib/libmupdf.a
${PROJECT_SOURCE_DIR}/lib/libmupdf-third.a
# onion
${PROJECT_SOURCE_DIR}/lib/libonion_static.a
pthread
m
bz2
# ${PROJECT_SOURCE_DIR}/lib/libmagic.a
magic
${PROJECT_SOURCE_DIR}/lib/libharfbuzz.a
${PROJECT_SOURCE_DIR}/lib/libopenjp2.a
freetype
archive
xml2
${PROJECT_SOURCE_DIR}/lib/libtesseract.a
${PROJECT_SOURCE_DIR}/lib/liblept.a
${PROJECT_SOURCE_DIR}/lib/libtiff.a
${PROJECT_SOURCE_DIR}/lib/libpng16.a
stdc++
# curl
${PROJECT_SOURCE_DIR}/lib/libcurl.a
${PROJECT_SOURCE_DIR}/lib/libcrypto.a
${PROJECT_SOURCE_DIR}/lib/libssl.a
dl
pcre
)
add_custom_target( add_custom_target(
before_sist2 before_sist2
COMMAND ${CMAKE_CURRENT_SOURCE_DIR}/scripts/before_build.sh COMMAND ${CMAKE_CURRENT_SOURCE_DIR}/scripts/before_build.sh
) )
IF (WITH_SIST2) add_dependencies(sist2 before_sist2)
add_dependencies(sist2 before_sist2)
else ()
add_dependencies(sist2_scan before_sist2)
endif ()

22
Docker/Dockerfile Normal file
View File

@@ -0,0 +1,22 @@
FROM ubuntu:19.10
MAINTAINER simon987 <me@simon987.net>
RUN apt update
RUN apt install -y libglib2.0-0 libcurl4 libmagic1 libharfbuzz-bin libopenjp2-7 libarchive13 liblzma5 libzstd1 liblz4-1 \
curl libtiff5 libpng16-16 libpcre3
RUN mkdir -p /usr/share/tessdata && \
cd /usr/share/tessdata/ && \
curl -o /usr/share/tessdata/hin.traineddata https://raw.githubusercontent.com/tesseract-ocr/tessdata/master/hin.traineddata &&\
curl -o /usr/share/tessdata/jpn.traineddata https://raw.githubusercontent.com/tesseract-ocr/tessdata/master/jpn.traineddata &&\
curl -o /usr/share/tessdata/eng.traineddata https://raw.githubusercontent.com/tesseract-ocr/tessdata/master/eng.traineddata &&\
curl -o /usr/share/tessdata/fra.traineddata https://raw.githubusercontent.com/tesseract-ocr/tessdata/master/fra.traineddata &&\
curl -o /usr/share/tessdata/rus.traineddata https://raw.githubusercontent.com/tesseract-ocr/tessdata/master/rus.traineddata &&\
curl -o /usr/share/tessdata/spa.traineddata https://raw.githubusercontent.com/tesseract-ocr/tessdata/master/spa.traineddata && ls -lh
ADD sist2 /root/sist2
ENV LANG C.UTF-8
ENV LC_ALL C.UTF-8
ENTRYPOINT ["/root/sist2"]

15
Docker/build.sh Executable file
View File

@@ -0,0 +1,15 @@
rm ./sist2
cp ../sist2 .
strip sist2
version=$(./sist2 --version)
echo "Version ${version}"
docker build . -t simon987/sist2:${version} -t simon987/sist2:latest \
-t docker.pkg.github.com/simon987/sist2/sist2:latest -t docker.pkg.github.com/simon987/sist2/sist2:${version}
docker push simon987/sist2:${version}
docker push simon987/sist2:latest
docker push docker.pkg.github.com/simon987/sist2/sist2:latest
docker push docker.pkg.github.com/simon987/sist2/sist2:${version}
docker run --rm -it simon987/sist2 -v

124
README.md
View File

@@ -1,5 +1,6 @@
![GitHub](https://img.shields.io/github/license/simon987/sist2.svg) ![GitHub](https://img.shields.io/github/license/simon987/sist2.svg)
[![CodeFactor](https://www.codefactor.io/repository/github/simon987/sist2/badge?s=05daa325188aac4eae32c786f3d9cf4e0593f822)](https://www.codefactor.io/repository/github/simon987/sist2) [![CodeFactor](https://www.codefactor.io/repository/github/simon987/sist2/badge?s=05daa325188aac4eae32c786f3d9cf4e0593f822)](https://www.codefactor.io/repository/github/simon987/sist2)
[![Development snapshots](https://ci.simon987.net/app/rest/builds/buildType(Sist2_Build)/statusIcon)](https://files.simon987.net/artifacts/Sist2/Build/)
# sist2 # sist2
@@ -7,64 +8,106 @@ sist2 (Simple incremental search tool)
*Warning: sist2 is in early development* *Warning: sist2 is in early development*
![sist2.png](sist2.png)
## Features ## Features
* Fast, low memory usage * Fast, low memory usage, multi-threaded
* Mobile-friendly Web interface
* Portable (all its features are packaged in a single executable) * Portable (all its features are packaged in a single executable)
* Extracts text from common file types\* * Extracts text from common file types \*
* Generates thumbnails\* * Generates thumbnails \*
* Incremental scanning * Incremental scanning
* Automatic tagging from file attributes via [user scripts](scripting/README.md)
* Recursive scan inside archive files \*\*
* OCR support with tesseract \*\*\*
\* See [format support](#format-support) \* See [format support](#format-support)
\*\* See [Archive files](#archive-files)
\*\*\* See [OCR](#ocr)
## Getting Started ## Getting Started
1. Have an [Elasticsearch](https://www.elastic.co/downloads/elasticsearch) instance running 1. Have an Elasticsearch (>= 6.X.X) instance running
1. Download the [latest sist2 release](https://github.com/simon987/sist2/releases) 1. Download [from official website](https://www.elastic.co/downloads/elasticsearch)
1. *(or)* Run using docker:
```bash
docker run -d --name es1 --net sist2_net -p 9200:9200 \
-e "discovery.type=single-node" elasticsearch:7.5.2
```
1. *(or)* Run using docker-compose:
```yaml
elasticsearch:
image: docker.elastic.co/elasticsearch/elasticsearch:7.5.2
environment:
- discovery.type=single-node
- "ES_JAVA_OPTS=-Xms1G -Xmx2G"
```
1. Download sist2 executable
1. Download the [latest sist2 release](https://github.com/simon987/sist2/releases) *
1. *(or)* Download a [development snapshot](https://files.simon987.net/artifacts/Sist2/Build/) *(Not recommended!)*
1. *(or)* `docker pull simon987/sist2:latest`
*Windows users*: `sist2` runs under [WSL](https://en.wikipedia.org/wiki/Windows_Subsystem_for_Linux) 1. See [Usage guide](USAGE.md)
*Mac users*: See [#1](https://github.com/simon987/sist2/issues/1) \* *Windows users*: **sist2** runs under [WSL](https://en.wikipedia.org/wiki/Windows_Subsystem_for_Linux)
## Example usage ## Example usage
![demo](demo.gif) See [Usage guide](USAGE.md) for more details
See help page `sist2 --help` for more details. 1. Scan a directory: `sist2 scan ~/Documents -o ./docs_idx`
1. Push index to Elasticsearch: `sist2 index ./docs_idx`
1. Start web interface: `sist2 web ./docs_idx`
**Scan a directory**
```bash
sist2 scan ~/Documents -o ./orig_idx/
sist2 scan --threads 4 --content-size 16384 /mnt/Pictures
sist2 scan --incremental ./orig_idx/ -o ./updated_idx/ ~/Documents
```
**Push index to Elasticsearch or file**
```bash
sist2 index --force-reset ./my_idx
sist2 index --print ./my_idx > raw_documents.ndjson
```
**Start web interface**
```bash
sist2 web --bind 0.0.0.0 --port 4321 ./my_idx1 ./my_idx2 ./my_idx3
```
## Format support ## Format support
File type | Library | Content | Thumbnail | Metadata File type | Library | Content | Thumbnail | Metadata
:---|:---|:---|:---|:--- :---|:---|:---|:---|:---
pdf,xps,cbz,cbr,fb2,epub | MuPDF | yes | yes, `png` | *planned* | pdf,xps,cbz,cbr,fb2,epub | MuPDF | text+ocr | yes, `png` | title |
`audio/*` | libav | - | yes, `jpeg` | ID3 tags | `audio/*` | ffmpeg | - | yes, `jpeg` | ID3 tags |
`video/*` | libav | - | yes, `jpeg` | *planned* | `video/*` | ffmpeg | - | yes, `jpeg` | title, comment, artist |
`image/*` | libav | - | yes, `jpeg` | *planned* | `image/*` | ffmpeg | - | yes, `jpeg` | [Common EXIF tags](https://github.com/simon987/sist2/blob/efdde2734eca9b14a54f84568863b7ffd59bdba3/src/parsing/media.c#L190) |
ttf,ttc,cff,woff,fnt,otf | Freetype2 | - | yes, `bmp` | Name & style | ttf,ttc,cff,woff,fnt,otf | Freetype2 | - | yes, `bmp` | Name & style |
`text/plain` | *(none)* | yes | no | - | `text/plain` | *(none)* | yes | no | - |
docx, xlsx, pptx | | *planned* | no | *planned* | tar, zip, rar, 7z, ar ... | Libarchive | yes\* | - | no |
docx, xlsx, pptx | libOPC | yes | no | no |
\* *See [Archive files](#archive-files)*
### Archive files
**sist2** will scan files stored into archive files (zip, tar, 7z...) as if
they were directly in the file system. Recursive (archives inside archives)
scan is also supported.
**Limitations**:
* Parsing media files with formats that require
*seek* (e.g. `.gif`, `.mp4` w/ fragmented metadata etc.) is not supported.
* Archive files are scanned sequentially, by a single thread. On systems where
**sist2** is not I/O bound, scans might be faster when larger archives are split
into smaller parts.
To check if a media file can be parsed without *seek*, execute `cat file.mp4 | ffprobe -`
### OCR
You can enable OCR support for pdf,xps,cbz,cbr,fb2,epub file types with the
`--ocr <lang>` option. Download the language data files with your
package manager (`apt install tesseract-ocr-eng`) or directly [from Github](https://github.com/tesseract-ocr/tesseract/wiki/Data-Files).
The `simon987/sist2` image comes with common languages
(hin, jpn, eng, fra, rus, spa) pre-installed.
Examples
```bash
sist2 scan --ocr jpn ~/Books/Manga/
sist2 scan --ocr eng ~/Books/Textbooks/
```
## Build from source ## Build from source
@@ -76,20 +119,17 @@ binaries.
*(Debian)* *(Debian)*
```bash ```bash
apt install git cmake pkg-config libglib2.0-dev\ apt install git cmake pkg-config libglib2.0-dev \
libssl-dev uuid-dev libavformat-dev libswscale-dev \ libssl-dev uuid-dev python3 libmagic-dev libfreetype6-dev \
python3 libmagic-dev libfreetype6-dev libcurl-dev \ libcurl4-openssl-dev libbz2-dev yasm libharfbuzz-dev ragel \
libbz2-dev yasm libarchive-dev libtiff5 libpng16-16 libpango1.0-dev \
libxml2-dev libopenjp2-7-dev libleptonica-dev
``` ```
*(FreeBSD)*
```bash
pkg install cmake gcc yasm gmake bash ffmpeg e2fsprogs-uuid
```
__
2. Build 2. Build
```bash ```bash
git clone --recurse-submodules https://github.com/simon987/sist2 git clone --recurse-submodules https://github.com/simon987/sist2
./scripts/get_static_libs.sh ./scripts/get_static_libs.sh
cmake . cmake .
make make
``` ```

275
USAGE.md Normal file
View File

@@ -0,0 +1,275 @@
# Usage
*More examples (specifically with docker/compose) are in progress*
* [scan](#scan)
* [options](#scan-options)
* [examples](#scan-examples)
* [index format](#index-format)
* [index](#index)
* [options](#index-options)
* [examples](#index-examples)
* [web](#web)
* [options](#web-options)
* [examples](#web-examples)
* [rewrite_url](#rewrite_url)
* [link to specific indices](#link-to-specific-indices)
```
Usage: sist2 scan [OPTION]... PATH
or: sist2 index [OPTION]... INDEX
or: sist2 web [OPTION]... INDEX...
Lightning-fast file system indexer and search tool.
-h, --help show this help message and exit
-v, --version Show version and exit
--verbose Turn on logging
--very-verbose Turn on debug messages
Scan options
-t, --threads=<int> Number of threads. DEFAULT=1
-q, --quality=<flt> Thumbnail quality, on a scale of 1.0 to 31.0, 1.0 being the best. DEFAULT=5
--size=<int> Thumbnail size, in pixels. Use negative value to disable. DEFAULT=500
--content-size=<int> Number of bytes to be extracted from text documents. Use negative value to disable. DEFAULT=32768
--incremental=<str> Reuse an existing index and only scan modified files.
-o, --output=<str> Output directory. DEFAULT=index.sist2/
--rewrite-url=<str> Serve files from this url instead of from disk.
--name=<str> Index display name. DEFAULT: (name of the directory)
--depth=<int> Scan up to DEPTH subdirectories deep. Use 0 to only scan files in PATH. DEFAULT: -1
--archive=<str> Archive file mode (skip|list|shallow|recurse). skip: Don't parse, list: only get file names as text, shallow: Don't parse archives inside archives. DEFAULT: recurse
--ocr=<str> Tesseract language (use tesseract --list-langs to see which are installed on your machine)
-e, --exclude=<str> Files that match this regex will not be scanned
--fast Only index file names & mime type
Index options
--es-url=<str> Elasticsearch url with port. DEFAULT=http://localhost:9200
-p, --print Just print JSON documents to stdout.
--script-file=<str> Path to user script.
--batch-size=<int> Index batch size. DEFAULT: 100
-f, --force-reset Reset Elasticsearch mappings and settings. (You must use this option the first time you use the index command)
Web options
--es-url=<str> Elasticsearch url. DEFAULT=http://localhost:9200
--bind=<str> Listen on this address. DEFAULT=localhost
--port=<str> Listen on this port. DEFAULT=4090
--auth=<str> Basic auth in user:password format
Made by simon987 <me@simon987.net>. Released under GPL-3.0
```
## Scan
### Scan options
* `-t, --threads`
Number of threads for file parsing. **Do not set a number higher than `$(nproc)`!**.
* `-q, --quality`
Thumbnail quality, on a scale of 1.0 to 31.0, 1.0 being the best. *Does not affect PDF thumbnails quality*
* `--size`
Thumbnail size in pixels.
* `--content-size`
Number of bytes of text to be extracted from the content of files (plain text and PDFs).
Repeated whitespace and special characters do not count toward this limit.
* `--incremental`
Specify an existing index. Information about files in this index that were not modified (based on *mtime* attribute)
will be copied to the new index and will not be parsed again.
* `-o, --output` Output directory.
* `--rewrite-url` Set the `rewrite_url` option for the web module (See [rewrite_url](#rewrite_url))
* `--name` Set the `name` option for the web module
* `--depth` Maximum scan dept. Set to 0 only scan files directly in the root directory, set to -1 for infinite depth
* `--archive` Archive file mode.
* skip: Don't parse
* list: Only get file names as text
* shallow: Don't parse archives inside archives.
* recurse: Scan archives recursively (default)
* `--ocr` See [OCR](README.md#OCR)
* `-e, --exclude` Regex pattern to exclude files. A file is excluded if the pattern matches any
part of the full absolute path.
Examples:
* `-e ".*\.ttf"`: Ignore ttf files
* `-e ".*\.(ttf|rar)"`: Ignore ttf and rar files
* `-e "^/mnt/backups/"`: Ignore all files in the `/mnt/backups/` directory
* `-e "^/mnt/Data[12]/"`: Ignore all files in the `/mnt/Data1/` and `/mnt/Data2/` directory
* `-e "(^/usr/)|(^/var/)|(^/media/DRIVE-A/tmp/)|(^/media/DRIVE-B/Trash/)"` Exclude the
`/usr`, `/var`, `/media/DRIVE-A/tmp`, `/media/DRIVE-B/Trash` directories
* `--fast` Only index file names and mime type
### Scan examples
Simple scan
```bash
sist2 scan ~/Documents
sist2 scan \
--threads 4 --content-size 16000000 --quality 1.0 --archive shallow \
--name "My Documents" --rewrite-url "http://nas.domain.local/My Documents/" \
~/Documents -o ./documents.idx/
```
Incremental scan
```
sist2 scan --incremental ./orig_idx/ -o ./updated_idx/ ~/Documents
```
### Index format
A typical `binary` type index structure looks like this:
```
documents.idx/
├── descriptor.json
├── _index_139965416830720
├── _index_139965425223424
├── _index_139965433616128
├── _index_139965442008832
└── thumbs
├── data.mdb
└── lock.mdb
```
The `_index_*` files contain the raw binary index data and are not meant to be
read by other applications. The format is generally compatible across different
sist2 versions.
The `thumbs/` folder is a [LMDB](https://en.wikipedia.org/wiki/Lightning_Memory-Mapped_Database)
database containing the thumbnails.
The `descriptor.json` file contains general information about the index. The
following fields are safe to modify manually: `root`, `name`, [rewrite_url](#rewrite_url) and `timestamp`.
*Advanced usage*
Instead of using the `scan` module, you can also import an index generated
by a third party application. The 'external' index must have the following format:
```
my_index/
├── descriptor.json
├── _index_0
└── thumbs
├── data.mdb
└── lock.mdb
```
*descriptor.json*:
```json
{
"uuid": "<valid UUID4>",
"version": "_external_v1",
"root": "(optional)",
"name": "<name>",
"rewrite_url": "(optional)",
"type": "json",
"timestamp": 1578971024
}
```
*_index_0*: NDJSON format (One json object per line)
```json
{
"_id": "unique uuid for the file",
"index": "index uuid4 (same one as descriptor.json!)",
"mime": "application/x-cbz",
"size": 14341204,
"mtime": 1578882996,
"extension": "cbz",
"name": "my_book",
"path": "path/to/books",
"content": "text contents of the book",
"title": "Title of the book",
"tag": ["genre.fiction", "author.someguy", "etc..."],
"_keyword": [
{"k": "ISBN", "v": "ABCD34789231"}
],
"_text": [
{"k": "other", "v": "This will be indexed as text"}
]
}
```
You can find the full list of supported fields [here](src/io/serialize.c#L90)
The `_keyword.*` items will be indexed and searchable as **keyword** fields (only full matches allowed).
The `_text.*` items will be indexed and searchable as **text** fields (fuzzy searching allowed)
*thumbs/*:
LMDB key-value store. Keys are **binary** 128-bit UUID4s (`_id` field)
and values are raw image bytes.
Importing an external `binary` type index is technically possible but
it is currently unsupported and has no guaranties of back/forward compatibility.
## Index
### Index options
* `--es-url`
Elasticsearch url and port. If you are using docker, make sure that both containers are on the
same network.
* `-p, --print`
Print index in JSON format to stdout.
* `--script-file`
Path to user script. See [Scripting](scripting/README.md).
* `--batch-size=<int>`
Index batch size. Indexing is generally faster with larger batches, but payloads that
are too large will fail and additional overhead for retrying with smaller sizes may slow
down the process.
* `-f, --force-reset`
Reset Elasticsearch mappings and settings.
**(You must use this option the first time you use the index command)**.
### Index examples
**Push to elasticsearch**
```bash
sist2 index --force-reset --batch-size 1000 --es-url http://localhost:9200 ./my_index/
sist2 index ./my_index/
```
**Save index in JSON format**
```bash
sist2 index --print ./my_index/ > my_index.ndjson
```
**Inspect contents of an index**
```bash
sist2 index --print ./my_index/ | jq | less
```
## Web
### Web options
* `--es-url=<str>` Elasticsearch url.
* `--bind=<str>` Listen on this address.
* `--port=<str>` Listen on this port.
* `--auth=<str>` Basic auth in user:password format
### Web examples
**Single index**
```bash
sist2 web --auth admin:hunter2 --bind 0.0.0.0 --port 8888 my_index
```
**Multiple indices**
```bash
# Indices will be displayed in this order in the web interface
sist2 web index1 index2 index3 index4
```
### rewrite_url
When the `rewrite_url` field is not empty, the web module ignores the `root`
field and will return a HTTP redirect to `<rewrite_url><path>/<name><extension>`
instead of serving the file from disk.
Both the `root` and `rewrite_url` fields are safe to manually modify from the
`descriptor.json` file.
### Link to specific indices
To link to specific indices, you can add a list of comma-separated index name to
the URL: `?i=<name>,<name>`. By default, indices with `"(nsfw)"` in their name are
not displayed.

2
cJSON

Submodule cJSON updated: 2de7d04aaf...e8077d0150

7
ci/build.sh Normal file
View File

@@ -0,0 +1,7 @@
#!/usr/bin/env bash
./scripts/get_static_libs.sh
cmake .
make
strip sist2

BIN
demo.gif

Binary file not shown.

Before

Width:  |  Height:  |  Size: 18 MiB

1
lib/bzip2-1.0.6 Submodule

Submodule lib/bzip2-1.0.6 added at 288acf97a1

1
lib/harfbuzz Submodule

Submodule lib/harfbuzz added at b7617f6b3c

1
lib/leptonica Submodule

Submodule lib/leptonica added at 320b4bbb02

1
lib/libmagic Submodule

Submodule lib/libmagic added at 1249b5cd02

1
lib/libpng Submodule

Submodule lib/libpng added at 301f7a1429

1
lib/libtiff Submodule

Submodule lib/libtiff added at a6d3c1d64b

1
lib/openjpeg Submodule

Submodule lib/openjpeg added at 563ecfb55c

1
lib/tesseract Submodule

Submodule lib/tesseract added at 90405ad0e3

View File

@@ -91,7 +91,7 @@ application/x-esrehber, es
application/x-excel, xla|xld|xlk|xlt|xlv application/x-excel, xla|xld|xlk|xlt|xlv
application/x-executable, exe application/x-executable, exe
application/x-font-sfn, application/x-font-sfn,
application/x-font-ttf, ttf application/x-font-ttf, ttf|ttc
application/x-freelance, pre application/x-freelance, pre
application/x-git, application/x-git,
application/x-gsp, gsp application/x-gsp, gsp
@@ -252,8 +252,9 @@ text/html, acgi|htm|html|htmls|htx|shtml
text/javascript, js text/javascript, js
text/mcf, mcf text/mcf, mcf
text/pascal, pas text/pascal, pas
text/plain, com|cmd|conf|def|g|idc|list|lst|mar|sdml|text|txt|md|groovy|license|properties|desktop|ini|rst|cmake|ipynb|readme|less|lo|go|yml|d|cs|hpp|srt text/plain, com|cmd|conf|def|g|idc|list|lst|mar|sdml|text|txt|md|groovy|license|properties|desktop|ini|rst|cmake|ipynb|readme|less|lo|go|yml|d|cs|hpp|srt|nfo|sfv|m3u|csv|eml
text/richtext, rt|rtf|rtx text/richtext, rt|rtf|rtx
text/rtf,
text/scriplet, wsc text/scriplet, wsc
text/x-awk, awk text/x-awk, awk
!video/x-jng, jng !video/x-jng, jng
@@ -263,7 +264,7 @@ image/x-xwindowdump, xwd
!image/vnd.adobe.photoshop, psd !image/vnd.adobe.photoshop, psd
text/tab-separated-values, tsv text/tab-separated-values, tsv
text/troff, man|me|ms|roff|t|tr text/troff, man|me|ms|roff|t|tr
text/uri-list, uni|unis|uri|uris text/uri-list, uji|unis|uri|uris
text/vnd.abc, abc text/vnd.abc, abc
text/vnd.fmi.flexstor, flx text/vnd.fmi.flexstor, flx
text/vnd.wap.wmlscript, wmls text/vnd.wap.wmlscript, wmls
@@ -319,7 +320,7 @@ video/x-dv, dif|dv
video/x-fli, fli video/x-fli, fli
video/x-isvideo, isu video/x-isvideo, isu
video/x-motion-jpeg, mjpg video/x-motion-jpeg, mjpg
video/x-ms-asf, asf|asx video/x-ms-asf, asf|asx|wmv
video/x-qtc, qtc video/x-qtc, qtc
video/x-sgi-movie, movie|mv video/x-sgi-movie, movie|mv
application/x-7z-compressed, 7z application/x-7z-compressed, 7z
@@ -359,3 +360,59 @@ image/x-tga,
application/x-wine-extension-ini, application/x-wine-extension-ini,
application/x-cbz, cbz application/x-cbz, cbz
application/x-cbr, cbr application/x-cbr, cbr
application/x-ms-compress-szdd, fon
application/x-atari-7800-rom, a78
application/x-nes-rom, nes
application/x-font-pfm, pfm
application/x-gettext-translation,
image/wmf,
application/pgp-keys,
image/x-3ds, 3ds
application/x-lz4, lz4
application/vnd.openxmlformats-officedocument.presentationml.presentation, pptx
application/vnd.oasis.opendocument.presentation, odp
application/x-msaccess, accdb
application/vnd.oasis.opendocument.spreadsheet, ods
audio/x-aiff, aiff|aif
text/x-ms-regedit, reg
application/x-gamecube-rom,
application/x-nintendo-ds-rom,
text/x-objective-c,
application/x-font-gdos,
application/x-apple-diskimage,
application/x-zstd, zst
video/x-m4v, m4v
message/news,
application/vnd.symbian.install,
application/x-lzh-compressed,
application/x-dosdriver,
application/vnd.tcpdump.pcap, pcap
x-epoc/x-sisx-app,
application/x-avira-qua,
video/MP2T,
application/x-snappy-framed,
application/x-lz4+json, jsonlz4
application/x-dmp, dmp
application/zlib, z
application/x-pgp-keyring,
application/x-gdbm,
application/x-font-pf2, pf2
application/x-zip,
application/x-coredump,
application/x-java-jmod, jmod
application/x-terminfo,
application/x-terminfo2,
application/x-arc,
application/vnd.lotus-1-2-3,
image/x-win-bitmap,
application/x-maxis-dbpf,
text/PGP,
audio/x-hx-aac-adts,
application/x-chrome-extension,
image/heic, heic
image/x-gem,
application/x-lzma, lzma
application/warc, warc
application/x-lz4, lz4
application/x-lzip, lz
application/x-lzop, lzo
1 application/arj arj
91 application/x-excel xla|xld|xlk|xlt|xlv
92 application/x-executable exe
93 application/x-font-sfn
94 application/x-font-ttf ttf ttf|ttc
95 application/x-freelance pre
96 application/x-git
97 application/x-gsp gsp
252 text/javascript js
253 text/mcf mcf
254 text/pascal pas
255 text/plain com|cmd|conf|def|g|idc|list|lst|mar|sdml|text|txt|md|groovy|license|properties|desktop|ini|rst|cmake|ipynb|readme|less|lo|go|yml|d|cs|hpp|srt com|cmd|conf|def|g|idc|list|lst|mar|sdml|text|txt|md|groovy|license|properties|desktop|ini|rst|cmake|ipynb|readme|less|lo|go|yml|d|cs|hpp|srt|nfo|sfv|m3u|csv|eml
256 text/richtext rt|rtf|rtx
257 text/rtf
258 text/scriplet wsc
259 text/x-awk awk
260 !video/x-jng jng
264 !image/vnd.adobe.photoshop psd
265 text/tab-separated-values tsv
266 text/troff man|me|ms|roff|t|tr
267 text/uri-list uni|unis|uri|uris uji|unis|uri|uris
268 text/vnd.abc abc
269 text/vnd.fmi.flexstor flx
270 text/vnd.wap.wmlscript wmls
320 video/x-fli fli
321 video/x-isvideo isu
322 video/x-motion-jpeg mjpg
323 video/x-ms-asf asf|asx asf|asx|wmv
324 video/x-qtc qtc
325 video/x-sgi-movie movie|mv
326 application/x-7z-compressed 7z
360 application/x-wine-extension-ini
361 application/x-cbz cbz
362 application/x-cbr cbr
363 application/x-ms-compress-szdd fon
364 application/x-atari-7800-rom a78
365 application/x-nes-rom nes
366 application/x-font-pfm pfm
367 application/x-gettext-translation
368 image/wmf
369 application/pgp-keys
370 image/x-3ds 3ds
371 application/x-lz4 lz4
372 application/vnd.openxmlformats-officedocument.presentationml.presentation pptx
373 application/vnd.oasis.opendocument.presentation odp
374 application/x-msaccess accdb
375 application/vnd.oasis.opendocument.spreadsheet ods
376 audio/x-aiff aiff|aif
377 text/x-ms-regedit reg
378 application/x-gamecube-rom
379 application/x-nintendo-ds-rom
380 text/x-objective-c
381 application/x-font-gdos
382 application/x-apple-diskimage
383 application/x-zstd zst
384 video/x-m4v m4v
385 message/news
386 application/vnd.symbian.install
387 application/x-lzh-compressed
388 application/x-dosdriver
389 application/vnd.tcpdump.pcap pcap
390 x-epoc/x-sisx-app
391 application/x-avira-qua
392 video/MP2T
393 application/x-snappy-framed
394 application/x-lz4+json jsonlz4
395 application/x-dmp dmp
396 application/zlib z
397 application/x-pgp-keyring
398 application/x-gdbm
399 application/x-font-pf2 pf2
400 application/x-zip
401 application/x-coredump
402 application/x-java-jmod jmod
403 application/x-terminfo
404 application/x-terminfo2
405 application/x-arc
406 application/vnd.lotus-1-2-3
407 image/x-win-bitmap
408 application/x-maxis-dbpf
409 text/PGP
410 audio/x-hx-aac-adts
411 application/x-chrome-extension
412 image/heic heic
413 image/x-gem
414 application/x-lzma lzma
415 application/warc warc
416 application/x-lz4 lz4
417 application/x-lzip lz
418 application/x-lzop lzo

View File

@@ -1,31 +1,40 @@
{ {
"properties": { "properties": {
"_tie": {
"type": "keyword",
"doc_values": true
},
"_depth": {
"type": "integer"
},
"path": { "path": {
"type": "text", "type": "text",
"analyzer": "path_analyzer", "analyzer": "path_analyzer",
"copy_to": "suggest-path" "fielddata": true,
}, "index_prefixes": {}
"suggest-path": {
"type": "completion",
"analyzer": "keyword"
}, },
"mime": { "mime": {
"type": "keyword" "type": "keyword"
}, },
"videoc": { "videoc": {
"type": "keyword" "type": "keyword",
"index": false
}, },
"audioc": { "audioc": {
"type": "keyword" "type": "keyword",
"index": false
}, },
"duration": { "duration": {
"type": "float" "type": "float",
"index": false
}, },
"width": { "width": {
"type": "integer" "type": "integer",
"index": false
}, },
"height": { "height": {
"type": "integer" "type": "integer",
"index": false
}, },
"mtime": { "mtime": {
"type": "integer" "type": "integer"
@@ -70,6 +79,23 @@
"analyzer": "my_nGram", "analyzer": "my_nGram",
"type": "text" "type": "text"
}, },
"_keyword.*": {
"type": "keyword"
},
"_text.*": {
"analyzer": "content_analyzer",
"type": "text",
"fields": {
"nGram": {
"type": "text",
"analyzer": "my_nGram"
}
}
},
"_url": {
"type": "keyword",
"index": false
},
"content": { "content": {
"analyzer": "content_analyzer", "analyzer": "content_analyzer",
"type": "text", "type": "text",
@@ -80,6 +106,33 @@
"analyzer": "my_nGram" "analyzer": "my_nGram"
} }
} }
},
"tag": {
"type": "keyword"
},
"exif_make": {
"type": "text"
},
"exif_model": {
"type": "text"
},
"exif:software": {
"type": "text"
},
"exif_exposure_time": {
"type": "keyword"
},
"exif_fnumber": {
"type": "keyword"
},
"exif_iso_speed_ratings": {
"type": "keyword"
},
"exif_focal_length": {
"type": "keyword"
},
"exif_user_comment": {
"type": "text"
} }
} }
} }

10
schema/pipeline.json Normal file
View File

@@ -0,0 +1,10 @@
{
"description": "Copy _id to _tie, save path depth",
"processors": [
{
"script": {
"source": "ctx._tie = ctx._id; ctx._depth = ctx.path.length() == 0 ? 0 : 1 + ctx.path.length() - ctx.path.replace(\"/\", \"\").length();"
}
}
]
}

View File

@@ -21,6 +21,12 @@
"lowercase" "lowercase"
] ]
}, },
"case_insensitive_kw_analyzer": {
"tokenizer": "keyword",
"filter": [
"lowercase"
]
},
"my_nGram": { "my_nGram": {
"tokenizer": "my_nGram_tokenizer", "tokenizer": "my_nGram_tokenizer",
"filter": [ "filter": [

152
scripting/README.md Normal file
View File

@@ -0,0 +1,152 @@
## User scripts
*This document is under construction, more in-depth guide coming soon*
During the `index` step, you can use the `--script-file <script>` option to
modify documents or add user tags. This option is mainly used to
implement automatic tagging based on file attributes.
The scripting language used
([Painless Scripting Language](https://www.elastic.co/guide/en/elasticsearch/painless/7.4/index.html))
is very similar to Java, but you should be able to create user scripts
without programming experience at all if you're somewhat familiar with
regex.
This is the base structure of the documents we're working with:
```json
{
"_id": "e171405c-fdb5-4feb-bb32-82637bc32084",
"_index": "sist2",
"_type": "_doc",
"_source": {
"index": "206b3050-e821-421a-891d-12fcf6c2db0d",
"mime": "application/json",
"size": 1799,
"mtime": 1545443685,
"extension": "md",
"name": "README",
"path": "sist2/scripting",
"content": "..."
}
}
```
**Example script**
This script checks if the `genre` attribute exists, if it does
it adds the `genre.<genre>` tag.
```Java
ArrayList tags = ctx._source.tag = new ArrayList();
if (ctx._source?.genre != null) {
tags.add("genre." + ctx._source.genre.toLowerCase())
}
```
You can use `.` to create a hierarchical tag tree:
![scripting/genre_example](genre_example.png)
To use regular expressions, you need to add this line in `/etc/elasticsearch/elasticsearch.yml`
```yaml
script.painless.regex.enabled: true
```
Or, if you're using docker add `-e "script.painless.regex.enabled=true"`
**Tag color**
You can specify the color for an individual tag by appending an
hexadecimal color code (`#RRGGBBAA`) to the tag name.
### Examples
If `(20XX)` is in the file name, add the `year.<year>` tag:
```Java
ArrayList tags = ctx._source.tag = new ArrayList();
Matcher m = /[\(\.+](20[0-9]{2})[\)\.+]/.matcher(ctx._source.name);
if (m.find()) {
tags.add("year." + m.group(1))
}
```
Use default *Calibre* folder structure to infer author.
```Java
ArrayList tags = ctx._source.tag = new ArrayList();
// We expect the book path to look like this:
// /path/to/Calibre Library/Author/Title/Title - Author.pdf
if (ctx._source.name.contains("-") && ctx._source.extension == "pdf") {
String[] names = ctx._source.name.splitOnToken('-');
tags.add("author." + names[1].strip());
}
```
If the file matches a specific pattern `AAAA-000 fName1 lName1, <fName2 lName2>...`, add the `actress.<actress>` and
`studio.<studio>` tag:
```Java
ArrayList tags = ctx._source.tag = new ArrayList();
Matcher m = /([A-Z]{4})-[0-9]{3} (.*)/.matcher(ctx._source.name);
if (m.find()) {
tags.add("studio." + m.group(1));
// Take the matched group (.*), and add a tag for
// each name, separated by comma
for (String name : m.group(2).splitOnToken(',')) {
tags.add("actress." + name);
}
}
```
Set the name of the last folder (`/path/to/<studio>/file.mp4`) to `studio.<studio>` tag
```Java
ArrayList tags = ctx._source.tag = new ArrayList();
if (ctx._source.path != "") {
String[] names = ctx._source.path.splitOnToken('/');
tags.add("studio." + names[names.length-1]);
}
```
Set the name of the last folder (`/path/to/<studio>/file.mp4`) to `studio.<studio>` tag
```Java
ArrayList tags = ctx._source.tag = new ArrayList();
if (ctx._source.path != "") {
String[] names = ctx._source.path.splitOnToken('/');
tags.add("studio." + names[names.length-1]);
}
```
Parse `EXIF:F Number` tag
```Java
if (ctx._source?.exif_fnumber != null) {
String[] values = ctx._source.exif_fnumber.splitOnToken(' ');
String aperture = String.valueOf(Float.parseFloat(values[0]) / Float.parseFloat(values[1]));
if (aperture == "NaN") {
aperture = "0,0";
}
tags.add("Aperture.f/" + aperture.replace(".", ","));
}
```
Display year and months from `EXIF:DateTime` tag
```Java
if (ctx._source?.exif_datetime != null) {
SimpleDateFormat parser = new SimpleDateFormat("yyyy:MM:dd HH:mm:ss");
Date date = parser.parse(ctx._source.exif_datetime);
SimpleDateFormat yp = new SimpleDateFormat("yyyy");
SimpleDateFormat mp = new SimpleDateFormat("MMMMMMMMM");
String year = yp.format(date);
String month = mp.format(date);
tags.add("Month." + month);
tags.add("Year." + year);
}
```

BIN
scripting/genre_example.png Normal file

Binary file not shown.

After

Width:  |  Height:  |  Size: 26 KiB

View File

@@ -6,9 +6,11 @@ rm web/js/bundle.js 2> /dev/null
cat `ls web/js/*.min.js` > web/js/bundle.js cat `ls web/js/*.min.js` > web/js/bundle.js
cat web/js/{util,dom,search}.js >> web/js/bundle.js cat web/js/{util,dom,search}.js >> web/js/bundle.js
rm web/css/bundle.css 2> /dev/null rm web/css/bundle*.css 2> /dev/null
cat web/css/*.min.css > web/css/bundle.css cat web/css/*.min.css > web/css/bundle.css
cat web/css/main.css >> web/css/bundle.css cat web/css/light.css >> web/css/bundle.css
cat web/css/*.min.css > web/css/bundle_dark.css
cat web/css/dark.css >> web/css/bundle_dark.css
python3 scripts/mime.py > src/parsing/mime_generated.c python3 scripts/mime.py > src/parsing/mime_generated.c
python3 scripts/serve_static.py > src/web/static_generated.c python3 scripts/serve_static.py > src/web/static_generated.c

View File

@@ -1,21 +1,40 @@
#!/usr/bin/env bash #!/usr/bin/env bash
THREADS=$(nproc)
cd lib cd lib
cd mupdf cd mupdf
HAVE_X11=no HAVE_GLUT=no make -j 4 CFLAGS=-fPIC make USE_SYSTEM_HARFBUZZ=yes USE_SYSTEM_OPENJPEG=yes HAVE_X11=no HAVE_GLUT=no -j $THREADS
cd .. cd ..
mv mupdf/build/release/libmupdf.a . mv mupdf/build/release/libmupdf.a .
mv mupdf/build/release/libmupdf-third.a . mv mupdf/build/release/libmupdf-third.a .
# openjp2
cd openjpeg
cmake . -DCMAKE_BUILD_TYPE=Release -DCMAKE_C_FLAGS="-O3 -DNDEBUG -fPIC"
make -j $THREADS
cd ..
mv openjpeg/bin/libopenjp2.a .
# harfbuzz
cd harfbuzz
./autogen.sh
CFLAGS=-fPIC ./configure --disable-shared --enable-static
make -j $THREADS
cd ..
mv harfbuzz/src/.libs/libharfbuzz.a .
# ffmpeg # ffmpeg
cd ffmpeg cd ffmpeg
./configure --disable-shared --enable-static --disable-ffmpeg --disable-ffplay \ ./configure --disable-shared --enable-static --disable-ffmpeg --disable-ffplay \
--disable-ffprobe --disable-doc\ --disable-ffprobe --disable-doc\
--disable-manpages --disable-postproc --disable-avfilter \ --disable-manpages --disable-postproc --disable-avfilter \
--disable-alsa --disable-lzma --disable-xlib --disable-debug\ --disable-alsa --disable-lzma --disable-xlib --disable-debug\
--disable-vdpau --disable-vaapi --disable-sdl2 --disable-network --disable-vdpau --disable-vaapi --disable-sdl2 --disable-network\
make -j 4 --extra-cflags=-fPIC
make -j $THREADS
cd .. cd ..
mv ffmpeg/libavcodec/libavcodec.a . mv ffmpeg/libavcodec/libavcodec.a .
@@ -32,26 +51,78 @@ cmake -DONION_USE_SSL=false -DONION_USE_PAM=false -DONION_USE_PNG=false -DONION_
-DONION_USE_JPEG=false -DONION_USE_XML2=false -DONION_USE_SYSTEMD=false -DONION_USE_SQLITE3=false \ -DONION_USE_JPEG=false -DONION_USE_XML2=false -DONION_USE_SYSTEMD=false -DONION_USE_SQLITE3=false \
-DONION_USE_REDIS=false -DONION_USE_GC=false -DONION_USE_TESTS=false -DONION_EXAMPLES=false \ -DONION_USE_REDIS=false -DONION_USE_GC=false -DONION_USE_TESTS=false -DONION_EXAMPLES=false \
-DONION_USE_BINDINGS_CPP=false .. -DONION_USE_BINDINGS_CPP=false ..
make -j 4 make -j $THREADS
cd ../.. cd ../..
mv onion/build/src/onion/libonion_static.a . mv onion/build/src/onion/libonion_static.a .
#bzip2 #bzip2
git clone https://github.com/enthought/bzip2-1.0.6
cd bzip2-1.0.6 cd bzip2-1.0.6
make -j 4 make -j $THREADS
cd .. cd ..
mv bzip2-1.0.6/libbz2.a . mv bzip2-1.0.6/libbz2.a .
# magic # magic
git clone https://github.com/threatstack/libmagic
cd libmagic cd libmagic
./autogen.sh ./autogen.sh
./configure --enable-static --disable-shared ./configure --enable-static --disable-shared
make -j 4 make -j $THREADS
cd .. cd ..
mv libmagic/src/.libs/libmagic.a . mv libmagic/src/.libs/libmagic.a .
# tesseract
cd tesseract
mkdir build
cd build
cmake -DSTATIC=on -DBUILD_TRAINING_TOOLS=off -DBUILD_TESTS=off -DCMAKE_BUILD_TYPE=Release \
-DCMAKE_CXX_FLAGS="-fPIC" -DAUTO_OPTIMIZE=off ..
make -j $THREADS
cd ../..
mv tesseract/build/libtesseract.a .
# leptonica
cd leptonica
./autogen.sh
CFLAGS="-fPIC" ./configure --without-zlib --without-jpeg --without-giflib \
--without-giflib --without-libwebp --without-libwebpmux --without-libopenjpeg \
--enable-static --disable-shared
make -j $THREADS
cd .. cd ..
mv leptonica/src/.libs/liblept.a .
# tiff
cd libtiff
./autogen.sh
CFLAGS="-fPIC" CXXFLAGS="-fPIC" CXX_FLAGS="-fPIC" ./configure --enable-static --disable-shared --disable-lzw --disable-jpeg --disable-webp \
--disable-lzma --disable-zstd --disable-jbig
make -j $THREADS
cd ..
mv libtiff/libtiff/.libs/libtiff.a .
# png
cd libpng
CFLAGS="-fPIC" ./configure --enable-static --disable-shared
make -j $THREADS
cd ..
mv libpng/.libs/libpng16.a .
# openssl...
git clone --depth 1 -b OpenSSL_1_1_0-stable https://github.com/openssl/openssl
cd openssl
./config --prefix=$(pwd)/../ssl
make depend
make -j $THREADS
make install
cd ..
mv ./openssl/libcrypto.a ./openssl/libssl.a .
# curl
wget -nc https://curl.haxx.se/download/curl-7.68.0.tar.gz
tar -xzf curl-7.68.0.tar.gz
cd curl-7.68.0
./configure --disable-ldap --disable-ldaps --without-librtmp --disable-rtsp --disable-crypto-auth \
--disable-smtp --without-libidn2 --without-nghttp2 --without-brotli --enable-static --disable-shared \
--without-libpsl --with-ssl=$(pwd)/../ssl
make -j $THREADS
cd ..
mv curl-7.68.0/lib/.libs/libcurl.a .

View File

@@ -1,44 +0,0 @@
#!/usr/bin/env bash
cd lib
# mupdf
cd mupdf
HAVE_X11=no HAVE_GLUT=no gmake -j 4
cd ..
mv mupdf/build/release/libmupdf.a .
mv mupdf/build/release/libmupdf-third.a .
# ffmpeg
cd ffmpeg
./configure --disable-shared --enable-static --disable-ffmpeg --disable-ffplay \
--disable-ffprobe --disable-doc\
--disable-manpages --disable-postproc --disable-avfilter \
--disable-alsa --disable-lzma --disable-xlib --disable-debug\
--disable-vdpau --disable-vaapi --disable-sdl2 --disable-network
gmake -j 4
cd ..
mv ffmpeg/libavcodec/libavcodec.a .
mv ffmpeg/libavformat/libavformat.a .
mv ffmpeg/libavutil/libavutil.a .
mv ffmpeg/libswresample/libswresample.a .
mv ffmpeg/libswscale/libswscale.a .
#bzip2
git clone https://github.com/enthought/bzip2-1.0.6
cd bzip2-1.0.6
make -j 4
cd ..
mv bzip2-1.0.6/libbz2.a .
# magic
git clone https://github.com/threatstack/libmagic
cd libmagic
./autogen.sh
./configure --enable-static --disable-shared
make -j 4
cd ..
mv libmagic/src/.libs/libmagic.a .
cd ..

View File

@@ -1,6 +1,9 @@
import json
files = [ files = [
"schema/mappings.json", "schema/mappings.json",
"schema/settings.json", "schema/settings.json",
"schema/pipeline.json",
] ]
@@ -9,6 +12,6 @@ def clean(filepath):
for file in files: for file in files:
with open(file, "rb") as f: with open(file, "r") as f:
data = f.read() data = json.dumps(json.load(f), separators=(",", ":")).encode()
print("char %s[%d] = {%s};" % (clean(file), len(data), ",".join(str(int(b)) for b in data))) print("char %s[%d] = {%s};" % (clean(file), len(data), ",".join(str(int(b)) for b in data)))

View File

@@ -12,17 +12,20 @@ major_mime = {
"audio": 7, "audio": 7,
"image": 8, "image": 8,
"text": 9, "text": 9,
"application": 10 "application": 10,
"x-epoc": 11,
} }
pdf = ( pdf = (
"application/pdf", "application/pdf",
"application/x-cbz", "application/x-cbz",
"application/epub+zip",
"application/vnd.ms-xpsdocument", "application/vnd.ms-xpsdocument",
) )
font = ( font = (
"application/vnd.ms-opentype", "application/vnd.ms-opentype",
"application/x-ms-compress-szdd"
"application/x-font-sfn", "application/x-font-sfn",
"application/x-font-ttf", "application/x-font-ttf",
"font/otf", "font/otf",
@@ -31,6 +34,34 @@ font = (
"font/woff2" "font/woff2"
) )
# Archive "formats"
archive = (
"application/x-tar",
"application/zip",
"application/x-rar",
"application/x-arc",
"application/x-warc",
"application/x-7z-compressed",
)
# Archive "filters"
arc_filter = (
"application/gzip",
"application/x-bzip2",
"application/x-xz",
"application/x-zstd",
"application/x-lzma",
"application/x-lz4",
"application/x-lzip",
"application/x-lzop",
)
doc = (
"application/vnd.openxmlformats-officedocument.wordprocessingml.document",
"application/vnd.openxmlformats-officedocument.spreadsheetml.sheet",
"application/vnd.openxmlformats-officedocument.presentationml.presentation"
)
cnt = 1 cnt = 1
@@ -45,6 +76,12 @@ def mime_id(mime):
mime_id += " | 0x40000000" mime_id += " | 0x40000000"
elif mime in font: elif mime in font:
mime_id += " | 0x20000000" mime_id += " | 0x20000000"
elif mime in archive:
mime_id += " | 0x10000000"
elif mime in arc_filter:
mime_id += " | 0x08000000"
elif mime in doc:
mime_id += " | 0x04000000"
elif mime == "application/x-empty": elif mime == "application/x-empty":
return "1" return "1"
return mime_id return mime_id

View File

@@ -1,8 +1,9 @@
files = [ files = [
"web/css/bundle.css", "web/css/bundle.css",
"web/css/bundle_dark.css",
"web/js/bundle.js", "web/js/bundle.js",
"web/img/bg-bars.png",
"web/img/sprite-skin-flat.png", "web/img/sprite-skin-flat.png",
"web/img/sprite-skin-flat-dark.png",
"web/search.html", "web/search.html",
] ]

BIN
sist2.png Normal file

Binary file not shown.

After

Width:  |  Height:  |  Size: 889 KiB

198
src/cli.c
View File

@@ -1,22 +1,57 @@
#include "cli.h" #include "cli.h"
#include "ctx.h"
#define DEFAULT_OUTPUT "index.sist2/" #define DEFAULT_OUTPUT "index.sist2/"
#define DEFAULT_CONTENT_SIZE 4096 #define DEFAULT_CONTENT_SIZE 32768
#define DEFAULT_QUALITY 15 #define DEFAULT_QUALITY 5
#define DEFAULT_SIZE 200 #define DEFAULT_SIZE 500
#define DEFAULT_REWRITE_URL "" #define DEFAULT_REWRITE_URL ""
#define DEFAULT_ES_URL "http://localhost:9200" #define DEFAULT_ES_URL "http://localhost:9200"
#define DEFAULT_BATCH_SIZE 100
#define DEFAULT_BIND_ADDR "localhost" #define DEFAULT_BIND_ADDR "localhost"
#define DEFAULT_PORT "4090" #define DEFAULT_PORT "4090"
const char* TESS_DATAPATHS[] = {
"/usr/share/tessdata/",
"/usr/share/tesseract-ocr/tessdata/",
"./",
NULL
};
scan_args_t *scan_args_create() { scan_args_t *scan_args_create() {
scan_args_t *args = calloc(sizeof(scan_args_t), 1); scan_args_t *args = calloc(sizeof(scan_args_t), 1);
args->depth = -1;
return args; return args;
} }
void scan_args_destroy(scan_args_t *args) {
if (args->name != NULL) {
free(args->name);
}
if (args->path != NULL) {
free(args->path);
}
if (args->output != NULL) {
free(args->output);
}
free(args);
}
void index_args_destroy(index_args_t *args) {
//todo
free(args);
}
void web_args_destroy(web_args_t *args) {
//todo
free(args);
}
int scan_args_validate(scan_args_t *args, int argc, const char **argv) { int scan_args_validate(scan_args_t *args, int argc, const char **argv) {
if (argc < 2) { if (argc < 2) {
fprintf(stderr, "Required positional argument: PATH.\n"); fprintf(stderr, "Required positional argument: PATH.\n");
@@ -25,7 +60,7 @@ int scan_args_validate(scan_args_t *args, int argc, const char **argv) {
char *abs_path = abspath(argv[1]); char *abs_path = abspath(argv[1]);
if (abs_path == NULL) { if (abs_path == NULL) {
fprintf(stderr, "File not found: %s", argv[1]); fprintf(stderr, "File not found: %s\n", argv[1]);
return 1; return 1;
} else { } else {
args->path = abs_path; args->path = abs_path;
@@ -34,8 +69,8 @@ int scan_args_validate(scan_args_t *args, int argc, const char **argv) {
if (args->incremental != NULL) { if (args->incremental != NULL) {
abs_path = abspath(args->incremental); abs_path = abspath(args->incremental);
if (abs_path == NULL) { if (abs_path == NULL) {
fprintf(stderr, "File not found: %s", args->incremental); sist_log("main.c", SIST_WARNING, "Could not open original index! Disabled incremental scan feature.");
return 1; args->incremental = NULL;
} }
} }
@@ -48,16 +83,13 @@ int scan_args_validate(scan_args_t *args, int argc, const char **argv) {
if (args->size == 0) { if (args->size == 0) {
args->size = DEFAULT_SIZE; args->size = DEFAULT_SIZE;
} else if (args->size <= 0) { } else if (args->size > 0 && args->size < 32) {
fprintf(stderr, "Invalid size: %d\n", args->size); printf("Invalid size: %d\n", args->content_size);
return 1; return 1;
} }
if (args->content_size == 0) { if (args->content_size == 0) {
args->content_size = DEFAULT_CONTENT_SIZE; args->content_size = DEFAULT_CONTENT_SIZE;
} else if (args->content_size <= 0) {
fprintf(stderr, "Invalid content-size: %d\n", args->content_size);
return 1;
} }
if (args->threads == 0) { if (args->threads == 0) {
@@ -80,6 +112,12 @@ int scan_args_validate(scan_args_t *args, int argc, const char **argv) {
return 1; return 1;
} }
if (args->depth < 0) {
args->depth = G_MAXINT32;
} else {
args->depth += 1;
}
if (args->name == NULL) { if (args->name == NULL) {
args->name = g_path_get_basename(args->output); args->name = g_path_get_basename(args->output);
} }
@@ -87,12 +125,84 @@ int scan_args_validate(scan_args_t *args, int argc, const char **argv) {
if (args->rewrite_url == NULL) { if (args->rewrite_url == NULL) {
args->rewrite_url = DEFAULT_REWRITE_URL; args->rewrite_url = DEFAULT_REWRITE_URL;
} }
if (args->archive == NULL || strcmp(args->archive, "recurse") == 0) {
args->archive_mode = ARC_MODE_RECURSE;
} else if (strcmp(args->archive, "list") == 0) {
args->archive_mode = ARC_MODE_LIST;
} else if (strcmp(args->archive, "shallow") == 0) {
args->archive_mode = ARC_MODE_SHALLOW;
} else if (strcmp(args->archive, "skip") == 0) {
args->archive_mode = ARC_MODE_SKIP;
} else {
fprintf(stderr, "Archive mode must be one of (skip, list, shallow, recurse), got '%s'", args->archive);
return 1;
}
if (args->tesseract_lang != NULL) {
TessBaseAPI *api = TessBaseAPICreate();
char filename[128];
sprintf(filename, "%s.traineddata", args->tesseract_lang);
const char * path = find_file_in_paths(TESS_DATAPATHS, filename);
if (path == NULL) {
LOG_FATAL("cli.c", "Could not find tesseract language file!");
}
ret = TessBaseAPIInit3(api, path, args->tesseract_lang);
if (ret != 0) {
fprintf(stderr, "Could not initialize tesseract with lang '%s'\n", args->tesseract_lang);
return 1;
}
TessBaseAPIEnd(api);
TessBaseAPIDelete(api);
args->tesseract_path = path;
}
if (args->exclude_regex != NULL) {
const char *error;
int error_offset;
pcre *re = pcre_compile(args->exclude_regex, 0, &error, &error_offset, 0);
if (error != NULL) {
LOG_FATALF("cli.c", "pcre_compile returned error: %s (offset:%d)", error, error_offset)
}
pcre_extra *re_extra = pcre_study(re, 0, &error);
if (error != NULL) {
LOG_FATALF("cli.c", "pcre_study returned error: %s", error)
}
ScanCtx.exclude = re;
ScanCtx.exclude_extra = re_extra;
} else {
ScanCtx.exclude = NULL;
}
LOG_DEBUGF("cli.c", "arg quality=%f", args->quality)
LOG_DEBUGF("cli.c", "arg size=%d", args->size)
LOG_DEBUGF("cli.c", "arg content_size=%d", args->content_size)
LOG_DEBUGF("cli.c", "arg threads=%d", args->threads)
LOG_DEBUGF("cli.c", "arg incremental=%s", args->incremental)
LOG_DEBUGF("cli.c", "arg output=%s", args->output)
LOG_DEBUGF("cli.c", "arg rewrite_url=%s", args->rewrite_url)
LOG_DEBUGF("cli.c", "arg name=%s", args->name)
LOG_DEBUGF("cli.c", "arg depth=%d", args->depth)
LOG_DEBUGF("cli.c", "arg path=%s", args->path)
LOG_DEBUGF("cli.c", "arg archive=%s", args->archive)
LOG_DEBUGF("cli.c", "arg tesseract_lang=%s", args->tesseract_lang)
LOG_DEBUGF("cli.c", "arg tesseract_path=%s", args->tesseract_path)
LOG_DEBUGF("cli.c", "arg exclude=%s", args->exclude_regex)
LOG_DEBUGF("cli.c", "arg fast=%d", args->fast)
return 0; return 0;
} }
#ifndef SIST_SCAN_ONLY
int index_args_validate(index_args_t *args, int argc, const char **argv) { int index_args_validate(index_args_t *args, int argc, const char **argv) {
LogCtx.verbose = 1;
if (argc < 2) { if (argc < 2) {
fprintf(stderr, "Required positional argument: PATH.\n"); fprintf(stderr, "Required positional argument: PATH.\n");
return 1; return 1;
@@ -100,20 +210,62 @@ int index_args_validate(index_args_t *args, int argc, const char **argv) {
char *index_path = abspath(argv[1]); char *index_path = abspath(argv[1]);
if (index_path == NULL) { if (index_path == NULL) {
fprintf(stderr, "File not found: %s", argv[1]); fprintf(stderr, "File not found: %s\n", argv[1]);
return 1; return 1;
} else { } else {
args->index_path = argv[1]; args->index_path = argv[1];
free(index_path);
} }
if (args->es_url == NULL) { if (args->es_url == NULL) {
args->es_url = DEFAULT_ES_URL; args->es_url = DEFAULT_ES_URL;
} }
if (args->script_path != NULL) {
struct stat info;
int res = stat(args->script_path, &info);
if (res == -1) {
fprintf(stderr, "Error opening script file '%s': %s\n", args->script_path, strerror(errno));
return 1;
}
int fd = open(args->script_path, O_RDONLY);
if (fd == -1) {
fprintf(stderr, "Error opening script file '%s': %s\n", args->script_path, strerror(errno));
return 1;
}
args->script = malloc(info.st_size + 1);
res = read(fd, args->script, info.st_size);
if (res < 0) {
fprintf(stderr, "Error reading script file '%s': %s\n", args->script_path, strerror(errno));
return 1;
}
*(args->script + info.st_size) = '\0';
close(fd);
}
if (args->batch_size == 0) {
args->batch_size = DEFAULT_BATCH_SIZE;
}
LOG_DEBUGF("cli.c", "arg es_url=%s", args->es_url)
LOG_DEBUGF("cli.c", "arg index_path=%s", args->index_path)
LOG_DEBUGF("cli.c", "arg script_path=%s", args->script_path)
LOG_DEBUGF("cli.c", "arg script=%s", args->script)
LOG_DEBUGF("cli.c", "arg print=%d", args->print)
LOG_DEBUGF("cli.c", "arg batch_size=%d", args->batch_size)
LOG_DEBUGF("cli.c", "arg force_reset=%d", args->force_reset)
return 0; return 0;
} }
int web_args_validate(web_args_t *args, int argc, const char **argv) { int web_args_validate(web_args_t *args, int argc, const char **argv) {
LogCtx.verbose = 1;
if (argc < 2) { if (argc < 2) {
fprintf(stderr, "Required positional argument: PATH.\n"); fprintf(stderr, "Required positional argument: PATH.\n");
return 1; return 1;
@@ -131,16 +283,33 @@ int web_args_validate(web_args_t *args, int argc, const char **argv) {
args->port = DEFAULT_PORT; args->port = DEFAULT_PORT;
} }
if (args->credentials != NULL) {
args->b64credentials = onion_base64_encode(args->credentials, (int) strlen(args->credentials));
//Remove trailing newline
*(args->b64credentials + strlen(args->b64credentials) - 1) = '\0';
}
args->index_count = argc - 1; args->index_count = argc - 1;
args->indices = argv + 1; args->indices = argv + 1;
for (int i = 0; i < args->index_count; i++) { for (int i = 0; i < args->index_count; i++) {
char *abs_path = abspath(args->indices[i]); char *abs_path = abspath(args->indices[i]);
if (abs_path == NULL) { if (abs_path == NULL) {
fprintf(stderr, "File not found: %s", abs_path); fprintf(stderr, "File not found: %s\n", args->indices[i]);
return 1; return 1;
} }
} }
LOG_DEBUGF("cli.c", "arg es_url=%s", args->es_url)
LOG_DEBUGF("cli.c", "arg bind=%s", args->bind)
LOG_DEBUGF("cli.c", "arg port=%s", args->port)
LOG_DEBUGF("cli.c", "arg credentials=%s", args->credentials)
LOG_DEBUGF("cli.c", "arg b64credentials=%s", args->b64credentials)
LOG_DEBUGF("cli.c", "arg index_count=%d", args->index_count)
for (int i = 0; i < args->index_count; i++) {
LOG_DEBUGF("cli.c", "arg indices[%d]=%s", i, args->indices[i])
}
return 0; return 0;
} }
@@ -153,5 +322,4 @@ web_args_t *web_args_create() {
web_args_t *args = calloc(sizeof(web_args_t), 1); web_args_t *args = calloc(sizeof(web_args_t), 1);
return args; return args;
} }
#endif

View File

@@ -12,17 +12,29 @@ typedef struct scan_args {
char *output; char *output;
char *rewrite_url; char *rewrite_url;
char *name; char *name;
int depth;
char *path; char *path;
char *archive;
archive_mode_t archive_mode;
char *tesseract_lang;
const char *tesseract_path;
char *exclude_regex;
int fast;
} scan_args_t; } scan_args_t;
scan_args_t *scan_args_create(); scan_args_t *scan_args_create();
void scan_args_destroy(scan_args_t *args);
int scan_args_validate(scan_args_t *args, int argc, const char **argv); int scan_args_validate(scan_args_t *args, int argc, const char **argv);
#ifndef SIST_SCAN_ONLY
typedef struct index_args { typedef struct index_args {
char *es_url; char *es_url;
const char *index_path; const char *index_path;
const char *script_path;
char *script;
int print; int print;
int batch_size;
int force_reset; int force_reset;
} index_args_t; } index_args_t;
@@ -30,15 +42,22 @@ typedef struct web_args {
char *es_url; char *es_url;
char *bind; char *bind;
char *port; char *port;
char *credentials;
char *b64credentials;
int index_count; int index_count;
const char **indices; const char **indices;
} web_args_t; } web_args_t;
index_args_t *index_args_create(); index_args_t *index_args_create();
void index_args_destroy(index_args_t *args);
web_args_t *web_args_create(); web_args_t *web_args_create();
void web_args_destroy(web_args_t *args);
int index_args_validate(index_args_t *args, int argc, const char **argv); int index_args_validate(index_args_t *args, int argc, const char **argv);
int web_args_validate(web_args_t *args, int argc, const char **argv); int web_args_validate(web_args_t *args, int argc, const char **argv);
#endif
#endif #endif

View File

@@ -15,6 +15,10 @@ struct {
int threads; int threads;
int content_size; int content_size;
float tn_qscale; float tn_qscale;
int depth;
archive_mode_t archive_mode;
int verbose;
int very_verbose;
size_t stat_tn_size; size_t stat_tn_size;
size_t stat_index_size; size_t stat_index_size;
@@ -23,20 +27,30 @@ struct {
GHashTable *copy_table; GHashTable *copy_table;
pthread_mutex_t mupdf_mu; pthread_mutex_t mupdf_mu;
char * tesseract_lang;
const char * tesseract_path;
pcre *exclude;
pcre_extra *exclude_extra;
int fast;
} ScanCtx; } ScanCtx;
struct {
int verbose;
int very_verbose;
int no_color;
} LogCtx;
#ifndef SIST_SCAN_ONLY
struct { struct {
char *es_url; char *es_url;
int batch_size;
} IndexCtx; } IndexCtx;
struct { struct {
char *es_url; char *es_url;
int index_count; int index_count;
char *b64credentials;
struct index_t indices[16]; struct index_t indices[16];
} WebCtx; } WebCtx;
#endif
#endif #endif

View File

@@ -1,16 +1,8 @@
#include "elastic.h" #include "elastic.h"
#include "src/ctx.h" #include "src/ctx.h"
#include <stdlib.h>
#include "web.h"
#include <stdio.h>
#include <string.h>
#include <cJSON/cJSON.h>
#include <src/ctx.h>
#include "static_generated.c" #include "static_generated.c"
#define BULK_INDEX_SIZE 100
typedef struct es_indexer { typedef struct es_indexer {
int queued; int queued;
@@ -22,6 +14,8 @@ typedef struct es_indexer {
static es_indexer_t *Indexer; static es_indexer_t *Indexer;
void delete_queue(int max);
void print_json(cJSON *document, const char uuid_str[UUID_STR_LEN]) { void print_json(cJSON *document, const char uuid_str[UUID_STR_LEN]) {
cJSON *line = cJSON_CreateObject(); cJSON *line = cJSON_CreateObject();
@@ -29,13 +23,14 @@ void print_json(cJSON *document, const char uuid_str[UUID_STR_LEN]) {
cJSON_AddStringToObject(line, "_id", uuid_str); cJSON_AddStringToObject(line, "_id", uuid_str);
cJSON_AddStringToObject(line, "_index", "sist2"); cJSON_AddStringToObject(line, "_index", "sist2");
cJSON_AddStringToObject(line, "_type", "_doc"); cJSON_AddStringToObject(line, "_type", "_doc");
cJSON_AddItemToObject(line, "_source", document); cJSON_AddItemReferenceToObject(line, "_source", document);
char *json = cJSON_PrintUnformatted(line); char *json = cJSON_PrintUnformatted(line);
printf("%s\n", json); printf("%s\n", json);
cJSON_free(line); cJSON_free(json);
cJSON_Delete(line);
} }
void index_json(cJSON *document, const char uuid_str[UUID_STR_LEN]) { void index_json(cJSON *document, const char uuid_str[UUID_STR_LEN]) {
@@ -54,24 +49,52 @@ void index_json(cJSON *document, const char uuid_str[UUID_STR_LEN]) {
elastic_index_line(bulk_line); elastic_index_line(bulk_line);
} }
void elastic_flush() { void execute_update_script(const char *script, const char index_id[UUID_STR_LEN]) {
if (Indexer == NULL) { cJSON *body = cJSON_CreateObject();
Indexer = create_indexer(IndexCtx.es_url); cJSON *script_obj = cJSON_AddObjectToObject(body, "script");
cJSON_AddStringToObject(script_obj, "lang", "painless");
cJSON_AddStringToObject(script_obj, "source", script);
cJSON *query = cJSON_AddObjectToObject(body, "query");
cJSON *term_obj = cJSON_AddObjectToObject(query, "term");
cJSON_AddStringToObject(term_obj, "index", index_id);
char *str = cJSON_Print(body);
char bulk_url[4096];
snprintf(bulk_url, 4096, "%s/sist2/_update_by_query?pretty", Indexer->es_url);
response_t *r = web_post(bulk_url, str, "Content-Type: application/json");
LOG_INFOF("elastic.c", "Executed user script <%d>", r->status_code);
cJSON *resp = cJSON_Parse(r->body);
cJSON_free(str);
cJSON_Delete(body);
free_response(r);
cJSON *error = cJSON_GetObjectItem(resp, "error");
if (error != NULL) {
char *error_str = cJSON_Print(error);
LOG_ERRORF("elastic.c", "User script error: \n%s", error_str);
cJSON_free(error_str);
} }
es_bulk_line_t *line = Indexer->line_head; cJSON_Delete(resp);
}
int count = 0; void *create_bulk_buffer(int max, int *count, size_t *buf_len) {
es_bulk_line_t *line = Indexer->line_head;
*count = 0;
size_t buf_size = 0; size_t buf_size = 0;
size_t buf_cur = 0; size_t buf_cur = 0;
char *buf = malloc(1); char *buf = malloc(1);
while (line != NULL) { while (line != NULL && *count < max) {
char action_str[512]; char action_str[512];
snprintf(action_str, 512, snprintf(action_str, 512,
"{\"index\":{\"_id\":\"%s\", \"_type\":\"_doc\", \"_index\":\"sist2\"}}\n", line->uuid_str); "{\"index\":{\"_id\":\"%s\", \"_type\":\"_doc\", \"_index\":\"sist2\"}}\n", line->uuid_str);
size_t action_str_len = strlen(action_str); size_t action_str_len = strlen(action_str);
size_t line_len = strlen(line->line); size_t line_len = strlen(line->line);
@@ -83,31 +106,103 @@ void elastic_flush() {
memcpy(buf + buf_cur, line->line, line_len); memcpy(buf + buf_cur, line->line, line_len);
buf_cur += line_len; buf_cur += line_len;
es_bulk_line_t *tmp = line;
line = line->next; line = line->next;
free(tmp); (*count)++;
count++;
} }
buf = realloc(buf, buf_size + 1); buf = realloc(buf, buf_size + 1);
*(buf+buf_cur) = '\0'; *(buf + buf_cur) = '\0';
Indexer->line_head = NULL; *buf_len = buf_cur;
Indexer->line_tail = NULL; return buf;
Indexer->queued = 0; }
char bulk_url[4096];
snprintf(bulk_url, 4096, "%s/sist2/_bulk", Indexer->es_url);
response_t *r = web_post(bulk_url, buf, "Content-Type: application/x-ndjson");
printf("Indexed %3d documents (%zukB) <%d>\n", count, buf_cur / 1024, r->status_code);
void *print_errors(response_t *r) {
cJSON *ret_json = cJSON_Parse(r->body); cJSON *ret_json = cJSON_Parse(r->body);
if (cJSON_GetObjectItem(ret_json, "errors")->valueint != 0) { if (cJSON_GetObjectItem(ret_json, "errors")->valueint != 0) {
fprintf(stderr, "%s\n", r->body); cJSON *err;
cJSON_ArrayForEach(err, cJSON_GetObjectItem(ret_json, "items")) {
if (cJSON_GetObjectItem(cJSON_GetObjectItem(err, "index"), "status")->valueint != 201) {
char *str = cJSON_Print(err);
LOG_ERRORF("elastic.c", "%s\n", str);
cJSON_free(str);
}
}
}
cJSON_Delete(ret_json);
}
void _elastic_flush(int max) {
size_t buf_len;
int count;
void *buf = create_bulk_buffer(max, &count, &buf_len);
char bulk_url[4096];
snprintf(bulk_url, 4096, "%s/sist2/_bulk?pipeline=tie", Indexer->es_url);
response_t *r = web_post(bulk_url, buf, "Content-Type: application/x-ndjson");
if (r->status_code == 0) {
LOG_FATALF("elastic.c", "Could not connect to %s, make sure that elasticsearch is running!\n", IndexCtx.es_url)
} }
cJSON_Delete(ret_json); if (r->status_code == 413) {
if (max <= 1) {
LOG_ERRORF("elastic.c", "Single document too large, giving up: {%s}", Indexer->line_head->uuid_str)
free_response(r);
free(buf);
delete_queue(1);
if (Indexer->queued != 0) {
elastic_flush();
}
return;
}
LOG_WARNINGF("elastic.c", "Payload too large, retrying (%d documents)", count);
free_response(r);
free(buf);
_elastic_flush(max / 2);
return;
} else if (r->status_code != 200) {
print_errors(r);
delete_queue(Indexer->queued);
} else {
print_errors(r);
LOG_INFOF("elastic.c", "Indexed %d documents (%zukB) <%d>", count, buf_len / 1024, r->status_code);
delete_queue(max);
if (Indexer->queued != 0) {
elastic_flush();
}
}
free_response(r); free_response(r);
free(buf);
}
void delete_queue(int max) {
for (int i = 0; i < max; i++) {
es_bulk_line_t *tmp = Indexer->line_head;
Indexer->line_head = tmp->next;
if (Indexer->line_head == NULL) {
Indexer->line_tail = NULL;
} else {
free(tmp);
}
Indexer->queued -= 1;
}
}
void elastic_flush() {
if (Indexer == NULL) {
Indexer = create_indexer(IndexCtx.es_url);
}
_elastic_flush(Indexer->queued);
} }
void elastic_index_line(es_bulk_line_t *line) { void elastic_index_line(es_bulk_line_t *line) {
@@ -126,15 +221,14 @@ void elastic_index_line(es_bulk_line_t *line) {
Indexer->queued += 1; Indexer->queued += 1;
if (Indexer->queued >= BULK_INDEX_SIZE) { if (Indexer->queued >= IndexCtx.batch_size) {
elastic_flush(); elastic_flush();
} }
} }
es_indexer_t *create_indexer(const char *url) { es_indexer_t *create_indexer(const char *url) {
size_t url_len = strlen(url); char *es_url = malloc(strlen(url) + 1);
char *es_url = malloc(url_len);
strcpy(es_url, url); strcpy(es_url, url);
es_indexer_t *indexer = malloc(sizeof(es_indexer_t)); es_indexer_t *indexer = malloc(sizeof(es_indexer_t));
@@ -147,18 +241,27 @@ es_indexer_t *create_indexer(const char *url) {
return indexer; return indexer;
} }
void destroy_indexer() { void destroy_indexer(char *script, char index_id[UUID_STR_LEN]) {
char url[4096]; char url[4096];
snprintf(url, sizeof(url), "%s/sist2/_refresh", IndexCtx.es_url); snprintf(url, sizeof(url), "%s/sist2/_refresh", IndexCtx.es_url);
response_t *r = web_post(url, "", NULL); response_t *r = web_post(url, "", NULL);
printf("Refresh index <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Refresh index <%d>", r->status_code);
free_response(r);
if (script != NULL) {
execute_update_script(script, index_id);
}
snprintf(url, sizeof(url), "%s/sist2/_refresh", IndexCtx.es_url);
r = web_post(url, "", NULL);
LOG_INFOF("elastic.c", "Refresh index <%d>", r->status_code);
free_response(r); free_response(r);
snprintf(url, sizeof(url), "%s/sist2/_forcemerge", IndexCtx.es_url); snprintf(url, sizeof(url), "%s/sist2/_forcemerge", IndexCtx.es_url);
r = web_post(url, "", NULL); r = web_post(url, "", NULL);
printf("Merge index <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Merge index <%d>", r->status_code);
free_response(r); free_response(r);
if (Indexer != NULL) { if (Indexer != NULL) {
@@ -178,32 +281,37 @@ void elastic_init(int force_reset) {
if (!index_exists || force_reset) { if (!index_exists || force_reset) {
r = web_delete(url); r = web_delete(url);
printf("Delete index <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Delete index <%d>", r->status_code);
free_response(r); free_response(r);
snprintf(url, 4096, "%s/sist2", IndexCtx.es_url); snprintf(url, 4096, "%s/sist2", IndexCtx.es_url);
r = web_put(url, "", NULL); r = web_put(url, "", NULL);
printf("Create index <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Create index <%d>", r->status_code);
free_response(r); free_response(r);
snprintf(url, 4096, "%s/sist2/_close", IndexCtx.es_url); snprintf(url, 4096, "%s/sist2/_close", IndexCtx.es_url);
r = web_post(url, "", NULL); r = web_post(url, "", NULL);
printf("Close index <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Close index <%d>", r->status_code);
free_response(r);
snprintf(url, 4096, "%s/_ingest/pipeline/tie", IndexCtx.es_url);
r = web_put(url, pipeline_json, "Content-Type: application/json");
LOG_INFOF("elastic.c", "Create pipeline <%d>", r->status_code);
free_response(r); free_response(r);
snprintf(url, 4096, "%s/sist2/_settings", IndexCtx.es_url); snprintf(url, 4096, "%s/sist2/_settings", IndexCtx.es_url);
r = web_put(url, settings_json, "Content-Type: application/json"); r = web_put(url, settings_json, "Content-Type: application/json");
printf("Update settings <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Update settings <%d>", r->status_code);
free_response(r); free_response(r);
snprintf(url, 4096, "%s/sist2/_mappings/_doc?include_type_name=true", IndexCtx.es_url); snprintf(url, 4096, "%s/sist2/_mappings/_doc?include_type_name=true", IndexCtx.es_url);
r = web_put(url, mappings_json, "Content-Type: application/json"); r = web_put(url, mappings_json, "Content-Type: application/json");
printf("Update mappings <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Update mappings <%d>", r->status_code);
free_response(r); free_response(r);
snprintf(url, 4096, "%s/sist2/_open", IndexCtx.es_url); snprintf(url, 4096, "%s/sist2/_open", IndexCtx.es_url);
r = web_post(url, "", NULL); r = web_post(url, "", NULL);
printf("Open index <%d>\n", r->status_code); LOG_INFOF("elastic.c", "Open index <%d>", r->status_code);
free_response(r); free_response(r);
} }
} }
@@ -213,8 +321,35 @@ cJSON *elastic_get_document(const char *uuid_str) {
snprintf(url, 4096, "%s/sist2/_doc/%s", WebCtx.es_url, uuid_str); snprintf(url, 4096, "%s/sist2/_doc/%s", WebCtx.es_url, uuid_str);
response_t *r = web_get(url); response_t *r = web_get(url);
cJSON *json = NULL;
if (r->status_code == 200) { if (r->status_code == 200) {
return cJSON_Parse(r->body); json = cJSON_Parse(r->body);
} }
return NULL; free_response(r);
return json;
}
char *elastic_get_status() {
char url[4096];
snprintf(url, 4096,
"%s/_cluster/state/metadata/sist2?filter_path=metadata.indices.*.state", WebCtx.es_url);
response_t *r = web_get(url);
cJSON *json = NULL;
char *status = malloc(128 * sizeof(char));
status[0] = '\0';
if (r->status_code == 200) {
json = cJSON_Parse(r->body);
const cJSON *metadata = cJSON_GetObjectItem(json, "metadata");
if (metadata != NULL) {
const cJSON *indices = cJSON_GetObjectItem(metadata, "indices");
const cJSON *sist2 = cJSON_GetObjectItem(indices, "sist2");
const cJSON *state = cJSON_GetObjectItem(sist2, "state");
strcpy(status, state->valuestring);
}
}
free_response(r);
cJSON_Delete(json);
return status;
} }

View File

@@ -24,10 +24,12 @@ void index_json(cJSON *document, const char uuid_str[UUID_STR_LEN]);
es_indexer_t *create_indexer(const char* es_url); es_indexer_t *create_indexer(const char* es_url);
void destroy_indexer(); void destroy_indexer(char *script, char index_id[UUID_STR_LEN]);
void elastic_init(int force_reset); void elastic_init(int force_reset);
cJSON *elastic_get_document(const char *uuid_str); cJSON *elastic_get_document(const char *uuid_str);
char *elastic_get_status();
#endif #endif

File diff suppressed because one or more lines are too long

View File

@@ -49,18 +49,19 @@ response_t *web_post(const char *url, const char *data, const char *header) {
curl_easy_setopt(curl, CURLOPT_POST, 1); curl_easy_setopt(curl, CURLOPT_POST, 1);
curl_easy_setopt(curl, CURLOPT_USERAGENT, "sist2"); curl_easy_setopt(curl, CURLOPT_USERAGENT, "sist2");
struct curl_slist *headers = NULL;
if (header != NULL) { if (header != NULL) {
struct curl_slist *headers = NULL;
headers = curl_slist_append(headers, header); headers = curl_slist_append(headers, header);
curl_easy_setopt(curl, CURLOPT_HTTPHEADER, headers); curl_easy_setopt(curl, CURLOPT_HTTPHEADER, headers);
} }
curl_easy_setopt(curl, CURLOPT_POSTFIELDS, data); curl_easy_setopt(curl, CURLOPT_POSTFIELDS, data);
int r1 = curl_easy_perform(curl); curl_easy_perform(curl);
curl_easy_getinfo(curl, CURLINFO_RESPONSE_CODE, &resp->status_code); curl_easy_getinfo(curl, CURLINFO_RESPONSE_CODE, &resp->status_code);
curl_easy_cleanup(curl); curl_easy_cleanup(curl);
curl_slist_free_all(headers);
resp->body = buffer.buf; resp->body = buffer.buf;
resp->size = buffer.cur; resp->size = buffer.cur;

View File

@@ -1,7 +1,7 @@
#include "src/ctx.h" #include "src/ctx.h"
#include "serialize.h" #include "serialize.h"
static __thread int IndexFd = -1; static __thread int index_fd = -1;
typedef struct { typedef struct {
unsigned char uuid[16]; unsigned char uuid[16];
@@ -34,12 +34,13 @@ void write_index_descriptor(char *path, index_descriptor_t *desc) {
cJSON_AddStringToObject(json, "version", desc->version); cJSON_AddStringToObject(json, "version", desc->version);
cJSON_AddStringToObject(json, "root", desc->root); cJSON_AddStringToObject(json, "root", desc->root);
cJSON_AddStringToObject(json, "name", desc->name); cJSON_AddStringToObject(json, "name", desc->name);
cJSON_AddStringToObject(json, "type", desc->type);
cJSON_AddStringToObject(json, "rewrite_url", desc->rewrite_url); cJSON_AddStringToObject(json, "rewrite_url", desc->rewrite_url);
cJSON_AddNumberToObject(json, "timestamp", (double) desc->timestamp); cJSON_AddNumberToObject(json, "timestamp", (double) desc->timestamp);
int fd = open(path, O_CREAT | O_WRONLY, S_IRUSR | S_IWUSR); int fd = open(path, O_CREAT | O_WRONLY, S_IRUSR | S_IWUSR);
if (fd == -1) { if (fd < 0) {
perror(path); LOG_FATALF("serialize.c", "Could not write index descriptor: %s", strerror(errno));
} }
char *str = cJSON_Print(json); char *str = cJSON_Print(json);
write(fd, str, strlen(str)); write(fd, str, strlen(str));
@@ -54,6 +55,11 @@ index_descriptor_t read_index_descriptor(char *path) {
struct stat info; struct stat info;
stat(path, &info); stat(path, &info);
int fd = open(path, O_RDONLY); int fd = open(path, O_RDONLY);
if (fd == -1) {
LOG_FATALF("serialize.c", "Invalid/corrupt index (Could not find descriptor): %s: %s\n", path ,strerror(errno))
}
char *buf = malloc(info.st_size + 1); char *buf = malloc(info.st_size + 1);
read(fd, buf, info.st_size); read(fd, buf, info.st_size);
*(buf + info.st_size) = '\0'; *(buf + info.st_size) = '\0';
@@ -66,9 +72,14 @@ index_descriptor_t read_index_descriptor(char *path) {
strcpy(descriptor.root, cJSON_GetObjectItem(json, "root")->valuestring); strcpy(descriptor.root, cJSON_GetObjectItem(json, "root")->valuestring);
strcpy(descriptor.name, cJSON_GetObjectItem(json, "name")->valuestring); strcpy(descriptor.name, cJSON_GetObjectItem(json, "name")->valuestring);
strcpy(descriptor.rewrite_url, cJSON_GetObjectItem(json, "rewrite_url")->valuestring); strcpy(descriptor.rewrite_url, cJSON_GetObjectItem(json, "rewrite_url")->valuestring);
descriptor.root_len = (short)strlen(descriptor.root); descriptor.root_len = (short) strlen(descriptor.root);
strcpy(descriptor.version, cJSON_GetObjectItem(json, "version")->valuestring); strcpy(descriptor.version, cJSON_GetObjectItem(json, "version")->valuestring);
strcpy(descriptor.uuid, cJSON_GetObjectItem(json, "uuid")->valuestring); strcpy(descriptor.uuid, cJSON_GetObjectItem(json, "uuid")->valuestring);
if (cJSON_GetObjectItem(json, "type") == NULL) {
strcpy(descriptor.type, INDEX_TYPE_BIN);
} else {
strcpy(descriptor.type, cJSON_GetObjectItem(json, "type")->valuestring);
}
cJSON_Delete(json); cJSON_Delete(json);
free(buf); free(buf);
@@ -105,6 +116,26 @@ char *get_meta_key_text(enum metakey meta_key) {
return "title"; return "title";
case MetaFontName: case MetaFontName:
return "font_name"; return "font_name";
case MetaParent:
return "parent";
case MetaExifMake:
return "exif_make";
case MetaExifSoftware:
return "exif_software";
case MetaExifExposureTime:
return "exif_exposure_time";
case MetaExifFNumber:
return "exif_fnumber";
case MetaExifFocalLength:
return "exif_focal_length";
case MetaExifUserComment:
return "exif_user_comment";
case MetaExifIsoSpeedRatings:
return "exif_iso_speed_ratings";
case MetaExifModel:
return "exif_model";
case MetaExifDateTime:
return "exif_datetime";
default: default:
return NULL; return NULL;
} }
@@ -113,13 +144,13 @@ char *get_meta_key_text(enum metakey meta_key) {
void write_document(document_t *doc) { void write_document(document_t *doc) {
if (IndexFd == -1) { if (index_fd == -1) {
char dstfile[PATH_MAX]; char dstfile[PATH_MAX];
pthread_t self = pthread_self(); pthread_t self = pthread_self();
snprintf(dstfile, PATH_MAX, "%s_index_%lu", ScanCtx.index.path, self); snprintf(dstfile, PATH_MAX, "%s_index_%lu", ScanCtx.index.path, self);
IndexFd = open(dstfile, O_CREAT | O_WRONLY | O_APPEND, S_IRUSR | S_IWUSR); index_fd = open(dstfile, O_CREAT | O_WRONLY | O_APPEND, S_IRUSR | S_IWUSR);
if (IndexFd == -1) { if (index_fd == -1) {
perror("open"); perror("open");
} }
} }
@@ -152,17 +183,20 @@ void write_document(document_t *doc) {
} }
dyn_buffer_write_char(&buf, '\n'); dyn_buffer_write_char(&buf, '\n');
write(IndexFd, buf.buf, buf.cur); int res = write(index_fd, buf.buf, buf.cur);
if (res == -1) {
LOG_FATALF("serialize.c", "Could not write document: %s", strerror(errno))
}
ScanCtx.stat_index_size += buf.cur; ScanCtx.stat_index_size += buf.cur;
dyn_buffer_destroy(&buf); dyn_buffer_destroy(&buf);
} }
void serializer_cleanup() { void thread_cleanup() {
close(IndexFd); close(index_fd);
} }
void read_index(const char *path, const char index_id[UUID_STR_LEN], index_func func) {
void read_index_bin(const char *path, const char *index_id, index_func func) {
line_t line; line_t line;
dyn_buffer_t buf = dyn_buffer_create(); dyn_buffer_t buf = dyn_buffer_create();
@@ -180,8 +214,13 @@ void read_index(const char *path, const char index_id[UUID_STR_LEN], index_func
char uuid_str[UUID_STR_LEN]; char uuid_str[UUID_STR_LEN];
uuid_unparse(line.uuid, uuid_str); uuid_unparse(line.uuid, uuid_str);
cJSON_AddStringToObject(document, "mime", mime_get_mime_text(line.mime)); const char* mime_text = mime_get_mime_text(line.mime);
cJSON_AddNumberToObject(document, "size", (double)line.size); if (mime_text == NULL) {
cJSON_AddNullToObject(document, "mime");
} else {
cJSON_AddStringToObject(document, "mime", mime_get_mime_text(line.mime));
}
cJSON_AddNumberToObject(document, "size", (double) line.size);
cJSON_AddNumberToObject(document, "mtime", line.mtime); cJSON_AddNumberToObject(document, "mtime", line.mtime);
int c; int c;
@@ -197,21 +236,30 @@ void read_index(const char *path, const char index_id[UUID_STR_LEN], index_func
*(buf.buf + line.ext) = '\0'; *(buf.buf + line.ext) = '\0';
} }
cJSON_AddStringToObject(document, "name", buf.buf + line.base); cJSON_AddStringToObject(document, "name", buf.buf + line.base);
*(buf.buf + line.base - 1) = '\0'; if (line.base > 0) {
cJSON_AddStringToObject(document, "path", buf.buf); *(buf.buf + line.base - 1) = '\0';
cJSON_AddStringToObject(document, "path", buf.buf);
} else {
cJSON_AddStringToObject(document, "path", "");
}
enum metakey key = getc(file); enum metakey key = getc(file);
while (key != '\n') { while (key != '\n') {
switch (key) { switch (key) {
case MetaWidth: case MetaWidth:
case MetaHeight: case MetaHeight: {
case MetaMediaDuration:
case MetaMediaBitrate: {
int value; int value;
fread(&value, sizeof(int), 1, file); fread(&value, sizeof(int), 1, file);
cJSON_AddNumberToObject(document, get_meta_key_text(key), value); cJSON_AddNumberToObject(document, get_meta_key_text(key), value);
break; break;
} }
case MetaMediaDuration:
case MetaMediaBitrate: {
long value;
fread(&value, sizeof(long), 1, file);
cJSON_AddNumberToObject(document, get_meta_key_text(key), (double) value);
break;
}
case MetaMediaAudioCodec: case MetaMediaAudioCodec:
case MetaMediaVideoCodec: { case MetaMediaVideoCodec: {
int value; int value;
@@ -229,10 +277,20 @@ void read_index(const char *path, const char index_id[UUID_STR_LEN], index_func
case MetaAlbumArtist: case MetaAlbumArtist:
case MetaGenre: case MetaGenre:
case MetaFontName: case MetaFontName:
case MetaParent:
case MetaExifMake:
case MetaExifSoftware:
case MetaExifExposureTime:
case MetaExifFNumber:
case MetaExifFocalLength:
case MetaExifUserComment:
case MetaExifIsoSpeedRatings:
case MetaExifDateTime:
case MetaExifModel:
case MetaTitle: { case MetaTitle: {
buf.cur = 0; buf.cur = 0;
while ((c = getc(file)) != 0) { while ((c = getc(file)) != 0) {
if (!(SHOULD_IGNORE_CHAR(c)) || c == ' ') { if (SHOULD_KEEP_CHAR(c) || c == ' ') {
dyn_buffer_write_char(&buf, (char) c); dyn_buffer_write_char(&buf, (char) c);
} }
} }
@@ -240,17 +298,103 @@ void read_index(const char *path, const char index_id[UUID_STR_LEN], index_func
cJSON_AddStringToObject(document, get_meta_key_text(key), buf.buf); cJSON_AddStringToObject(document, get_meta_key_text(key), buf.buf);
break; break;
} }
default:
LOG_FATALF("serialize.c", "Invalid meta key (corrupt index): %x", key)
} }
key = getc(file); key = getc(file);
} }
func(document, uuid_str); func(document, uuid_str);
cJSON_free(document); cJSON_Delete(document);
}
dyn_buffer_destroy(&buf);
fclose(file);
}
const char *json_type_copy_fields[] = {
"mime", "name", "path", "extension", "index", "size", "mtime", "parent",
// Meta
"title", "content", "width", "height", "duration", "audioc", "videoc",
"bitrate", "artist", "album", "album_artist", "genre", "title", "font_name",
// Special
"tag", "_url"
};
const char *json_type_array_fields[] = {
"_keyword", "_text"
};
void read_index_json(const char *path, UNUSED(const char *index_id), index_func func) {
FILE *file = fopen(path, "r");
while (1) {
char *line = NULL;
size_t len;
size_t read = getline(&line, &len, file);
if (read < 0) {
if (line) {
free(line);
}
break;
}
cJSON *input = cJSON_Parse(line);
if (input == NULL) {
LOG_FATALF("serialize.c", "Could not parse JSON line: \n%s", line)
}
if (line) {
free(line);
}
cJSON *document = cJSON_CreateObject();
const char *uuid_str = cJSON_GetObjectItem(input, "_id")->valuestring;
for (int i = 0; i < (sizeof(json_type_copy_fields) / sizeof(json_type_copy_fields[0])); i++) {
cJSON *value = cJSON_GetObjectItem(input, json_type_copy_fields[i]);
if (value != NULL) {
cJSON_AddItemReferenceToObject(document, json_type_copy_fields[i], value);
}
}
for (int i = 0; i < (sizeof(json_type_array_fields) / sizeof(json_type_array_fields[0])); i++) {
cJSON *arr = cJSON_GetObjectItem(input, json_type_array_fields[i]);
if (arr != NULL) {
cJSON *obj;
cJSON_ArrayForEach(obj, arr) {
char key[1024];
cJSON *k = cJSON_GetObjectItem(obj, "k");
cJSON *v = cJSON_GetObjectItem(obj, "v");
if (k == NULL || v == NULL || !cJSON_IsString(k) || !cJSON_IsString(v)) {
char *str = cJSON_Print(obj);
LOG_FATALF("serialize.c", "Invalid %s member: must contain .k and .v string fields: \n%s",
json_type_array_fields[i], str)
}
snprintf(key, sizeof(key), "%s.%s", json_type_array_fields[i], k->valuestring);
cJSON_AddStringToObject(document, key, v->valuestring);
}
}
}
func(document, uuid_str);
cJSON_Delete(document);
cJSON_Delete(input);
} }
fclose(file); fclose(file);
} }
void read_index(const char *path, const char index_id[UUID_STR_LEN], const char *type, index_func func) {
if (strcmp(type, INDEX_TYPE_BIN) == 0) {
read_index_bin(path, index_id, func);
} else if (strcmp(type, INDEX_TYPE_JSON) == 0) {
read_index_json(path, index_id, func);
}
}
void incremental_read(GHashTable *table, const char *filepath) { void incremental_read(GHashTable *table, const char *filepath) {
FILE *file = fopen(filepath, "rb"); FILE *file = fopen(filepath, "rb");
line_t line; line_t line;
@@ -291,6 +435,7 @@ void incremental_copy(store_t *store, store_t *dst_store, const char *filepath,
size_t buf_len; size_t buf_len;
char *buf = store_read(store, (char *) line.uuid, 16, &buf_len); char *buf = store_read(store, (char *) line.uuid, 16, &buf_len);
store_write(dst_store, (char *) line.uuid, 16, buf, buf_len); store_write(dst_store, (char *) line.uuid, 16, buf, buf_len);
free(buf);
char c; char c;
while ((c = (char) getc(file))) { while ((c = (char) getc(file))) {

View File

@@ -11,14 +11,14 @@ void incremental_copy(store_t *store, store_t *dst_store, const char *filepath,
void write_document(document_t *doc); void write_document(document_t *doc);
void read_index(const char *path, const char[UUID_STR_LEN], index_func); void read_index(const char *path, const char[UUID_STR_LEN], const char *type, index_func);
void incremental_read(GHashTable *table, const char *filepath); void incremental_read(GHashTable *table, const char *filepath);
/** /**
* Must be called after write_document * Must be called after write_document
*/ */
void serializer_cleanup(); void thread_cleanup();
void write_index_descriptor(char *path, index_descriptor_t *desc); void write_index_descriptor(char *path, index_descriptor_t *desc);

View File

@@ -9,14 +9,13 @@ store_t *store_create(char *path) {
mdb_env_create(&store->env); mdb_env_create(&store->env);
int open_ret = mdb_env_open(store->env, int open_ret = mdb_env_open(store->env,
path, path,
MDB_WRITEMAP | MDB_MAPASYNC, MDB_WRITEMAP | MDB_MAPASYNC,
S_IRUSR | S_IWUSR S_IRUSR | S_IWUSR
); );
if (open_ret != 0) { if (open_ret != 0) {
fprintf(stderr, "Error while opening store: %s", mdb_strerror(open_ret)); LOG_FATALF("store.c", "Error while opening store: %s (%s)\n", mdb_strerror(open_ret), path)
exit(1);
} }
store->size = (size_t) 1024 * 1024 * 5; store->size = (size_t) 1024 * 1024 * 5;
@@ -42,6 +41,12 @@ void store_destroy(store_t *store) {
void store_write(store_t *store, char *key, size_t key_len, char *buf, size_t buf_len) { void store_write(store_t *store, char *key, size_t key_len, char *buf, size_t buf_len) {
if (LogCtx.very_verbose) {
char uuid_str[UUID_STR_LEN];
uuid_unparse((unsigned char *) key, uuid_str);
LOG_DEBUGF("store.c", "Store write {%s} %lu bytes", uuid_str, buf_len)
}
MDB_val mdb_key; MDB_val mdb_key;
mdb_key.mv_data = key; mdb_key.mv_data = key;
mdb_key.mv_size = key_len; mdb_key.mv_size = key_len;
@@ -64,17 +69,19 @@ void store_write(store_t *store, char *key, size_t key_len, char *buf, size_t bu
// Cannot resize when there is a opened transaction. // Cannot resize when there is a opened transaction.
// Resize take effect on the next commit. // Resize take effect on the next commit.
pthread_rwlock_wrlock(&store->lock); pthread_rwlock_wrlock(&store->lock);
store->size += 1024 * 1024 * 5; store->size += 1024 * 1024 * 50;
mdb_env_set_mapsize(store->env, store->size); mdb_env_set_mapsize(store->env, store->size);
mdb_txn_begin(store->env, NULL, 0, &txn); mdb_txn_begin(store->env, NULL, 0, &txn);
put_ret = mdb_put(txn, store->dbi, &mdb_key, &mdb_value, 0); put_ret = mdb_put(txn, store->dbi, &mdb_key, &mdb_value, 0);
LOG_INFOF("store.c", "Updated mdb mapsize to %lu bytes", store->size)
} }
mdb_txn_commit(txn); mdb_txn_commit(txn);
pthread_rwlock_unlock(&store->lock); pthread_rwlock_unlock(&store->lock);
if (put_ret != 0) { if (put_ret != 0) {
printf("%s\n", mdb_strerror(put_ret)); LOG_ERROR("store.c", mdb_strerror(put_ret))
} }
} }

View File

@@ -1,28 +1,46 @@
#include "walk.h" #include "walk.h"
#include "src/ctx.h" #include "src/ctx.h"
parse_job_t *create_parse_job(const char *filepath, const struct stat *info, int base) { __always_inline
parse_job_t *create_fs_parse_job(const char *filepath, const struct stat *info, int base) {
int len = (int) strlen(filepath); int len = (int) strlen(filepath);
parse_job_t *job = malloc(sizeof(parse_job_t) + len); parse_job_t *job = malloc(sizeof(parse_job_t) + len);
memcpy(&(job->filepath), filepath, len + 1); strcpy(job->filepath, filepath);
job->base = base; job->base = base;
char *p = strrchr(filepath + base, '.'); char *p = strrchr(filepath + base, '.');
if (p != NULL) { if (p != NULL) {
job->ext = (int)(p - filepath + 1); job->ext = (int) (p - filepath + 1);
} else { } else {
job->ext = len; job->ext = len;
} }
memcpy(&(job->info), info, sizeof(struct stat)); job->info = *info;
memset(job->parent, 0, 16);
job->vfile.filepath = job->filepath;
job->vfile.read = fs_read;
job->vfile.close = fs_close;
job->vfile.fd = -1;
job->vfile.is_fs_file = TRUE;
return job; return job;
} }
int sub_strings[30];
#define EXCLUDED(str) (pcre_exec(ScanCtx.exclude, ScanCtx.exclude_extra, filepath, strlen(filepath), 0, 0, sub_strings, sizeof(sub_strings)) >= 0)
int handle_entry(const char *filepath, const struct stat *info, int typeflag, struct FTW *ftw) { int handle_entry(const char *filepath, const struct stat *info, int typeflag, struct FTW *ftw) {
if (typeflag == FTW_F && S_ISREG(info->st_mode)) {
parse_job_t *job = create_parse_job(filepath, info, ftw->base); if (typeflag == FTW_F && S_ISREG(info->st_mode) && ftw->level <= ScanCtx.depth) {
if (ScanCtx.exclude != NULL && EXCLUDED(filepath)) {
LOG_DEBUGF("walk.c", "Excluded: %s", filepath)
return 0;
}
parse_job_t *job = create_fs_parse_job(filepath, info, ftw->base);
tpool_add_work(ScanCtx.pool, parse, job); tpool_add_work(ScanCtx.pool, parse, job);
} }

99
src/log.c Normal file
View File

@@ -0,0 +1,99 @@
#include "log.h"
const char *log_colors[] = {
"\033[34m", "\033[01;34m", "\033[0m",
"\033[01;33m", "\033[31m", "\033[01;31m"
};
const char *log_levels[] = {
"DEBUG", "INFO", "WARNING", "ERROR", "FATAL"
};
void sist_logf(char *filepath, int level, char *format, ...) {
static int is_tty = -1;
if (is_tty == -1) {
is_tty = isatty(STDERR_FILENO);
}
char log_str[LOG_MAX_LENGTH];
unsigned long long pid = (unsigned long long) pthread_self();
char datetime[32];
time_t t;
struct tm result;
t = time(NULL);
localtime_r(&t, &result);
strftime(datetime, sizeof(datetime), "%Y-%m-%d %H:%M:%S", &result);
int log_len;
if (is_tty) {
log_len = snprintf(
log_str, sizeof(log_str),
"\033[%dm[%04X]%s [%s] [%s %s] ",
31 + ((unsigned int) (pid)) % 7, pid, log_colors[level],
datetime, log_levels[level], filepath
);
} else {
log_len = snprintf(
log_str, sizeof(log_str),
"[%04X] [%s] [%s %s] ",
pid, datetime, log_levels[level], filepath
);
}
va_list ap;
va_start(ap, format);
size_t maxsize = sizeof(log_str) - log_len;
log_len += vsnprintf(log_str + log_len, maxsize, format, ap);
va_end(ap);
if (is_tty) {
log_len += sprintf(log_str + log_len, "\033[0m\n");
} else {
*(log_str + log_len) = '\n';
log_len += 1;
}
write(STDERR_FILENO, log_str, log_len);
}
void sist_log(char *filepath, int level, char *str) {
static int is_tty = -1;
if (is_tty == -1) {
is_tty = isatty(STDERR_FILENO);
}
char log_str[LOG_MAX_LENGTH];
unsigned long long pid = (unsigned long long) pthread_self();
char datetime[32];
time_t t;
struct tm result;
t = time(NULL);
localtime_r(&t, &result);
strftime(datetime, sizeof(datetime), "%Y-%m-%d %H:%M:%S", &result);
int log_len;
if (is_tty) {
log_len = snprintf(
log_str, sizeof(log_str),
"\033[%dm[%04X]%s [%s] [%s %s] %s \033[0m\n",
31 + ((unsigned int) (pid)) % 7, pid, log_colors[level],
datetime, log_levels[level], filepath,
str
);
} else {
log_len = snprintf(
log_str, sizeof(log_str),
"[%04X] [%s] [%s %s] %s \n",
pid, datetime, log_levels[level], filepath,
str
);
}
write(STDERR_FILENO, log_str, log_len);
}

45
src/log.h Normal file
View File

@@ -0,0 +1,45 @@
#ifndef SIST2_LOG_H
#define SIST2_LOG_H
#define LOG_MAX_LENGTH 8192
#define SIST_DEBUG 0
#define SIST_INFO 1
#define SIST_WARNING 2
#define SIST_ERROR 3
#define SIST_FATAL 4
#define LOG_DEBUGF(filepath, fmt, ...) \
if (LogCtx.very_verbose) {sist_logf(filepath, SIST_DEBUG, fmt, __VA_ARGS__);}
#define LOG_DEBUG(filepath, str) \
if (LogCtx.very_verbose) {sist_log(filepath, SIST_DEBUG, str);}
#define LOG_INFOF(filepath, fmt, ...) \
if (LogCtx.verbose) {sist_logf(filepath, SIST_INFO, fmt, __VA_ARGS__);}
#define LOG_INFO(filepath, str) \
if (LogCtx.verbose) {sist_log(filepath, SIST_INFO, str);}
#define LOG_WARNINGF(filepath, fmt, ...) \
if (LogCtx.verbose) {sist_logf(filepath, SIST_WARNING, fmt, __VA_ARGS__);}
#define LOG_WARNING(filepath, str) \
if (LogCtx.verbose) {sist_log(filepath, SIST_WARNING, str);}
#define LOG_ERRORF(filepath, fmt, ...) \
if (LogCtx.verbose) {sist_logf(filepath, SIST_ERROR, fmt, __VA_ARGS__);}
#define LOG_ERROR(filepath, str) \
if (LogCtx.verbose) {sist_log(filepath, SIST_ERROR, str);}
#define LOG_FATALF(filepath, fmt, ...) \
sist_logf(filepath, SIST_FATAL, fmt, __VA_ARGS__);\
exit(-1);
#define LOG_FATAL(filepath, str) \
sist_log(filepath, SIST_FATAL, str);\
exit(-1);
#include "src/sist.h"
void sist_logf(char *filepath, int level, char *format, ...);
void sist_log(char *filepath, int level, char *str);
#endif

View File

@@ -1,16 +1,12 @@
#include "sist.h" #include "sist.h"
#include "ctx.h" #include "ctx.h"
#ifndef SIST_SCAN_ONLY
#define DESCRIPTION "Lightning-fast file system indexer and search tool." #define DESCRIPTION "Lightning-fast file system indexer and search tool."
#else
#define DESCRIPTION "Lightning-fast file system indexer and search tool. (SCAN ONLY)"
#endif
#define EPILOG "Made by simon987 <me@simon987.net>. Released under GPL-3.0" #define EPILOG "Made by simon987 <me@simon987.net>. Released under GPL-3.0"
static const char *const Version = "1.0.8"; static const char *const Version = "1.3.1";
static const char *const usage[] = { static const char *const usage[] = {
"sist2 scan [OPTION]... PATH", "sist2 scan [OPTION]... PATH",
"sist2 index [OPTION]... INDEX", "sist2 index [OPTION]... INDEX",
@@ -19,9 +15,7 @@ static const char *const usage[] = {
}; };
void global_init() { void global_init() {
#ifndef SIST_SCAN_ONLY
curl_global_init(CURL_GLOBAL_NOTHING); curl_global_init(CURL_GLOBAL_NOTHING);
#endif
av_log_set_level(AV_LOG_QUIET); av_log_set_level(AV_LOG_QUIET);
} }
@@ -34,17 +28,13 @@ void init_dir(const char *dirpath) {
uuid_unparse(uuid, ScanCtx.index.desc.uuid); uuid_unparse(uuid, ScanCtx.index.desc.uuid);
time(&ScanCtx.index.desc.timestamp); time(&ScanCtx.index.desc.timestamp);
strcpy(ScanCtx.index.desc.version, Version); strcpy(ScanCtx.index.desc.version, Version);
strcpy(ScanCtx.index.desc.type, INDEX_TYPE_BIN);
write_index_descriptor(path, &ScanCtx.index.desc); write_index_descriptor(path, &ScanCtx.index.desc);
} }
void scan_print_header() { void scan_print_header() {
printf("sist2 V%s\n", Version); LOG_INFOF("main.c", "sist2 v%s", Version)
printf("---------------------\n");
printf("threads\t\t%d\n", ScanCtx.threads);
printf("tn_qscale\t%.1f/31.0\n", ScanCtx.tn_qscale);
printf("tn_size\t\t%dpx\n", ScanCtx.tn_size);
printf("output\t\t%s\n", ScanCtx.index.path);
} }
void sist2_scan(scan_args_t *args) { void sist2_scan(scan_args_t *args) {
@@ -52,18 +42,25 @@ void sist2_scan(scan_args_t *args) {
ScanCtx.tn_qscale = args->quality; ScanCtx.tn_qscale = args->quality;
ScanCtx.tn_size = args->size; ScanCtx.tn_size = args->size;
ScanCtx.content_size = args->content_size; ScanCtx.content_size = args->content_size;
ScanCtx.pool = tpool_create(args->threads, serializer_cleanup);
ScanCtx.threads = args->threads; ScanCtx.threads = args->threads;
ScanCtx.depth = args->depth;
ScanCtx.archive_mode = args->archive_mode;
strncpy(ScanCtx.index.path, args->output, sizeof(ScanCtx.index.path)); strncpy(ScanCtx.index.path, args->output, sizeof(ScanCtx.index.path));
strncpy(ScanCtx.index.desc.name, args->name, sizeof(ScanCtx.index.desc.name)); strncpy(ScanCtx.index.desc.name, args->name, sizeof(ScanCtx.index.desc.name));
strcpy(ScanCtx.index.desc.root, args->path); strncpy(ScanCtx.index.desc.root, args->path, sizeof(ScanCtx.index.desc.root));
strncpy(ScanCtx.index.desc.rewrite_url, args->rewrite_url, sizeof(ScanCtx.index.desc.rewrite_url));
ScanCtx.index.desc.root_len = (short) strlen(ScanCtx.index.desc.root); ScanCtx.index.desc.root_len = (short) strlen(ScanCtx.index.desc.root);
ScanCtx.tesseract_lang = args->tesseract_lang;
ScanCtx.tesseract_path = args->tesseract_path;
ScanCtx.fast = args->fast;
init_dir(ScanCtx.index.path); init_dir(ScanCtx.index.path);
ScanCtx.mime_table = mime_get_mime_table(); ScanCtx.mime_table = mime_get_mime_table();
ScanCtx.ext_table = mime_get_ext_table(); ScanCtx.ext_table = mime_get_ext_table();
cbr_init();
char store_path[PATH_MAX]; char store_path[PATH_MAX];
snprintf(store_path, PATH_MAX, "%sthumbs", ScanCtx.index.path); snprintf(store_path, PATH_MAX, "%sthumbs", ScanCtx.index.path);
mkdir(store_path, S_IWUSR | S_IRUSR | S_IXUSR); mkdir(store_path, S_IWUSR | S_IRUSR | S_IXUSR);
@@ -77,9 +74,18 @@ void sist2_scan(scan_args_t *args) {
DIR *dir = opendir(args->incremental); DIR *dir = opendir(args->incremental);
if (dir == NULL) { if (dir == NULL) {
perror("opendir"); LOG_FATALF("main.c", "Could not open original index for incremental scan: %s", strerror(errno))
return;
} }
char descriptor_path[PATH_MAX];
snprintf(descriptor_path, PATH_MAX, "%s/descriptor.json", args->incremental);
index_descriptor_t original_desc = read_index_descriptor(descriptor_path);
if (strcmp(original_desc.version, Version) != 0) {
LOG_FATALF("main.c", "Version mismatch! Index is %s but executable is %s/%s", original_desc.version,
Version, INDEX_VERSION_EXTERNAL)
}
struct dirent *de; struct dirent *de;
while ((de = readdir(dir)) != NULL) { while ((de = readdir(dir)) != NULL) {
if (strncmp(de->d_name, "_index_", sizeof("_index_") - 1) == 0) { if (strncmp(de->d_name, "_index_", sizeof("_index_") - 1) == 0) {
@@ -90,9 +96,11 @@ void sist2_scan(scan_args_t *args) {
} }
closedir(dir); closedir(dir);
printf("Loaded %d items in to mtime table.", g_hash_table_size(ScanCtx.original_table)); LOG_INFOF("main.c", "Loaded %d items in to mtime table.", g_hash_table_size(ScanCtx.original_table))
} }
ScanCtx.pool = tpool_create(args->threads, thread_cleanup);
tpool_start(ScanCtx.pool);
walk_directory_tree(ScanCtx.index.desc.root); walk_directory_tree(ScanCtx.index.desc.root);
tpool_wait(ScanCtx.pool); tpool_wait(ScanCtx.pool);
tpool_destroy(ScanCtx.pool); tpool_destroy(ScanCtx.pool);
@@ -123,10 +131,10 @@ void sist2_scan(scan_args_t *args) {
store_destroy(ScanCtx.index.store); store_destroy(ScanCtx.index.store);
} }
#ifndef SIST_SCAN_ONLY
void sist2_index(index_args_t *args) { void sist2_index(index_args_t *args) {
IndexCtx.es_url = args->es_url; IndexCtx.es_url = args->es_url;
IndexCtx.batch_size = args->batch_size;
if (!args->print) { if (!args->print) {
elastic_init(args->force_reset); elastic_init(args->force_reset);
@@ -136,15 +144,17 @@ void sist2_index(index_args_t *args) {
snprintf(descriptor_path, PATH_MAX, "%s/descriptor.json", args->index_path); snprintf(descriptor_path, PATH_MAX, "%s/descriptor.json", args->index_path);
index_descriptor_t desc = read_index_descriptor(descriptor_path); index_descriptor_t desc = read_index_descriptor(descriptor_path);
if (strcmp(desc.version, Version) != 0) {
fprintf(stderr, "Version mismatch! Index is v%s but executable is v%s\n", desc.version, Version); LOG_DEBUGF("main.c", "descriptor version %s (%s)", desc.version, desc.type)
return;
if (strcmp(desc.version, Version) != 0 && strcmp(desc.version, INDEX_VERSION_EXTERNAL) != 0) {
LOG_FATALF("main.c", "Version mismatch! Index is %s but executable is %s/%s", desc.version, Version,
INDEX_VERSION_EXTERNAL)
} }
DIR *dir = opendir(args->index_path); DIR *dir = opendir(args->index_path);
if (dir == NULL) { if (dir == NULL) {
perror("opendir"); LOG_FATALF("main.c", "Could not open index %s: %s", args->index_path, strerror(errno))
return;
} }
index_func f; index_func f;
@@ -159,13 +169,14 @@ void sist2_index(index_args_t *args) {
if (strncmp(de->d_name, "_index_", sizeof("_index_") - 1) == 0) { if (strncmp(de->d_name, "_index_", sizeof("_index_") - 1) == 0) {
char file_path[PATH_MAX]; char file_path[PATH_MAX];
snprintf(file_path, PATH_MAX, "%s/%s", args->index_path, de->d_name); snprintf(file_path, PATH_MAX, "%s/%s", args->index_path, de->d_name);
read_index(file_path, desc.uuid, f); read_index(file_path, desc.uuid, desc.type, f);
} }
} }
closedir(dir);
if (!args->print) { if (!args->print) {
elastic_flush(); elastic_flush();
destroy_indexer(); destroy_indexer(args->script, desc.uuid);
} }
} }
@@ -173,6 +184,7 @@ void sist2_web(web_args_t *args) {
WebCtx.es_url = args->es_url; WebCtx.es_url = args->es_url;
WebCtx.index_count = args->index_count; WebCtx.index_count = args->index_count;
WebCtx.b64credentials = args->b64credentials;
for (int i = 0; i < args->index_count; i++) { for (int i = 0; i < args->index_count; i++) {
char *abs_path = abspath(args->indices[i]); char *abs_path = abspath(args->indices[i]);
@@ -194,7 +206,6 @@ void sist2_web(web_args_t *args) {
serve(args->bind, args->port); serve(args->bind, args->port);
} }
#endif
int main(int argc, const char *argv[]) { int main(int argc, const char *argv[]) {
@@ -202,41 +213,56 @@ int main(int argc, const char *argv[]) {
global_init(); global_init();
scan_args_t *scan_args = scan_args_create(); scan_args_t *scan_args = scan_args_create();
#ifndef SIST_SCAN_ONLY
index_args_t *index_args = index_args_create(); index_args_t *index_args = index_args_create();
web_args_t *web_args = web_args_create(); web_args_t *web_args = web_args_create();
#endif
char * common_es_url = NULL; int arg_version = 0;
char *common_es_url = NULL;
struct argparse_option options[] = { struct argparse_option options[] = {
OPT_HELP(), OPT_HELP(),
OPT_BOOLEAN('v', "version", &arg_version, "Show version and exit"),
OPT_BOOLEAN(0, "verbose", &LogCtx.verbose, "Turn on logging"),
OPT_BOOLEAN(0, "very-verbose", &LogCtx.very_verbose, "Turn on debug messages"),
OPT_GROUP("Scan options"), OPT_GROUP("Scan options"),
OPT_INTEGER('t', "threads", &scan_args->threads, "Number of threads. DEFAULT=1"), OPT_INTEGER('t', "threads", &scan_args->threads, "Number of threads. DEFAULT=1"),
OPT_FLOAT('q', "quality", &scan_args->quality, OPT_FLOAT('q', "quality", &scan_args->quality,
"Thumbnail quality, on a scale of 1.0 to 31.0, 1.0 being the best. DEFAULT=15"), "Thumbnail quality, on a scale of 1.0 to 31.0, 1.0 being the best. DEFAULT=5"),
OPT_INTEGER(0, "size", &scan_args->size, "Thumbnail size, in pixels. DEFAULT=200"), OPT_INTEGER(0, "size", &scan_args->size,
"Thumbnail size, in pixels. Use negative value to disable. DEFAULT=500"),
OPT_INTEGER(0, "content-size", &scan_args->content_size, OPT_INTEGER(0, "content-size", &scan_args->content_size,
"Number of bytes to be extracted from text documents. DEFAULT=4096"), "Number of bytes to be extracted from text documents. Use negative value to disable. DEFAULT=32768"),
OPT_STRING(0, "incremental", &scan_args->incremental, OPT_STRING(0, "incremental", &scan_args->incremental,
"Reuse an existing index and only scan modified files."), "Reuse an existing index and only scan modified files."),
OPT_STRING('o', "output", &scan_args->output, "Output directory. DEFAULT=index.sist2/"), OPT_STRING('o', "output", &scan_args->output, "Output directory. DEFAULT=index.sist2/"),
OPT_STRING(0, "rewrite-url", &scan_args->rewrite_url, "Serve files from this url instead of from disk."), OPT_STRING(0, "rewrite-url", &scan_args->rewrite_url, "Serve files from this url instead of from disk."),
OPT_STRING(0, "name", &scan_args->name, "Index display name. DEFAULT: (name of the directory)"), OPT_STRING(0, "name", &scan_args->name, "Index display name. DEFAULT: (name of the directory)"),
OPT_INTEGER(0, "depth", &scan_args->depth, "Scan up to DEPTH subdirectories deep. "
"Use 0 to only scan files in PATH. DEFAULT: -1"),
OPT_STRING(0, "archive", &scan_args->archive, "Archive file mode (skip|list|shallow|recurse). "
"skip: Don't parse, list: only get file names as text, "
"shallow: Don't parse archives inside archives. DEFAULT: recurse"),
OPT_STRING(0, "ocr", &scan_args->tesseract_lang, "Tesseract language (use tesseract --list-langs to see "
"which are installed on your machine)"),
OPT_STRING('e', "exclude", &scan_args->exclude_regex, "Files that match this regex will not be scanned"),
OPT_BOOLEAN(0, "fast", &scan_args->fast, "Only index file names & mime type"),
#ifndef SIST_SCAN_ONLY
OPT_GROUP("Index options"), OPT_GROUP("Index options"),
OPT_STRING(0, "es-url", &common_es_url, "Elasticsearch url. DEFAULT=http://localhost:9200"), OPT_STRING(0, "es-url", &common_es_url, "Elasticsearch url with port. DEFAULT=http://localhost:9200"),
OPT_BOOLEAN('p', "print", &index_args->print, "Just print JSON documents to stdout."), OPT_BOOLEAN('p', "print", &index_args->print, "Just print JSON documents to stdout."),
OPT_STRING(0, "script-file", &index_args->script_path, "Path to user script."),
OPT_INTEGER(0, "batch-size", &index_args->batch_size, "Index batch size. DEFAULT: 100"),
OPT_BOOLEAN('f', "force-reset", &index_args->force_reset, "Reset Elasticsearch mappings and settings. " OPT_BOOLEAN('f', "force-reset", &index_args->force_reset, "Reset Elasticsearch mappings and settings. "
"(You must use this option the first time you use the index command)"), "(You must use this option the first time you use the index command)"),
OPT_GROUP("Web options"), OPT_GROUP("Web options"),
OPT_STRING(0, "es-url", &common_es_url, "Elasticsearch url. DEFAULT=http://localhost:9200"), OPT_STRING(0, "es-url", &common_es_url, "Elasticsearch url. DEFAULT=http://localhost:9200"),
OPT_STRING(0, "bind", &web_args->bind, "Listen on this address. DEFAULT=localhost"), OPT_STRING(0, "bind", &web_args->bind, "Listen on this address. DEFAULT=localhost"),
OPT_STRING(0, "port", &web_args->port, "Listen on this port. DEFAULT=4090"), OPT_STRING(0, "port", &web_args->port, "Listen on this port. DEFAULT=4090"),
#endif OPT_STRING(0, "auth", &web_args->credentials, "Basic auth in user:password format"),
OPT_END(), OPT_END(),
}; };
@@ -246,30 +272,34 @@ int main(int argc, const char *argv[]) {
argparse_describe(&argparse, DESCRIPTION, EPILOG); argparse_describe(&argparse, DESCRIPTION, EPILOG);
argc = argparse_parse(&argparse, argc, argv); argc = argparse_parse(&argparse, argc, argv);
#ifndef SIST_SCAN_ONLY if (arg_version) {
printf(Version);
goto end;
}
if (LogCtx.very_verbose != 0) {
LogCtx.verbose = 1;
}
web_args->es_url = common_es_url; web_args->es_url = common_es_url;
index_args->es_url = common_es_url; index_args->es_url = common_es_url;
#endif
if (argc == 0) { if (argc == 0) {
argparse_usage(&argparse); argparse_usage(&argparse);
return 1; goto end;
} else if (strcmp(argv[0], "scan") == 0) { } else if (strcmp(argv[0], "scan") == 0) {
int err = scan_args_validate(scan_args, argc, argv); int err = scan_args_validate(scan_args, argc, argv);
if (err != 0) { if (err != 0) {
return err; goto end;
} }
sist2_scan(scan_args); sist2_scan(scan_args);
} } else if (strcmp(argv[0], "index") == 0) {
#ifndef SIST_SCAN_ONLY
else if (strcmp(argv[0], "index") == 0) {
int err = index_args_validate(index_args, argc, argv); int err = index_args_validate(index_args, argc, argv);
if (err != 0) { if (err != 0) {
return err; goto end;
} }
sist2_index(index_args); sist2_index(index_args);
@@ -277,17 +307,21 @@ int main(int argc, const char *argv[]) {
int err = web_args_validate(web_args, argc, argv); int err = web_args_validate(web_args, argc, argv);
if (err != 0) { if (err != 0) {
return err; goto end;
} }
sist2_web(web_args); sist2_web(web_args);
} } else {
#endif
else {
fprintf(stderr, "Invalid command: '%s'\n", argv[0]); fprintf(stderr, "Invalid command: '%s'\n", argv[0]);
argparse_usage(&argparse); argparse_usage(&argparse);
return 1; goto end;
} }
printf("\n"); printf("\n");
end:
scan_args_destroy(scan_args);
index_args_destroy(index_args);
web_args_destroy(web_args);
return 0; return 0;
} }

155
src/parsing/arc.c Normal file
View File

@@ -0,0 +1,155 @@
#include "arc.h"
#include "src/ctx.h"
int should_parse_filtered_file(const char *filepath, int ext) {
char tmp[PATH_MAX * 2];
if (ext == 0) {
return FALSE;
}
memcpy(tmp, filepath, ext - 1);
*(tmp + ext - 1) = '\0';
char *idx = strrchr(tmp, '.');
if (idx == NULL) {
return FALSE;
}
if (strcmp(idx, ".tar") == 0) {
return TRUE;
}
return FALSE;
}
int arc_read(struct vfile *f, void *buf, size_t size) {
return archive_read_data(f->arc, buf, size);
}
typedef struct arc_data {
vfile_t *f;
char buf[ARC_BUF_SIZE];
} arc_data_f;
int vfile_open_callback(struct archive *a, void *user_data) {
arc_data_f *data = user_data;
if (data->f->is_fs_file && data->f->fd == -1) {
data->f->fd = open(data->f->filepath, O_RDONLY);
}
return ARCHIVE_OK;
}
long vfile_read_callback(struct archive *a, void *user_data, const void **buf) {
arc_data_f *data = user_data;
*buf = data->buf;
return data->f->read(data->f, data->buf, ARC_BUF_SIZE);
}
int vfile_close_callback(struct archive *a, void *user_data) {
arc_data_f *data = user_data;
if (data->f->close != NULL) {
data->f->close(data->f);
}
return ARCHIVE_OK;
}
void parse_archive(vfile_t *f, document_t *doc) {
struct archive *a;
struct archive_entry *entry;
arc_data_f data;
data.f = f;
int ret = 0;
if (data.f->is_fs_file) {
a = archive_read_new();
archive_read_support_filter_all(a);
archive_read_support_format_all(a);
ret = archive_read_open_filename(a, doc->filepath, ARC_BUF_SIZE);
} else if (ScanCtx.archive_mode == ARC_MODE_RECURSE) {
a = archive_read_new();
archive_read_support_filter_all(a);
archive_read_support_format_all(a);
ret = archive_read_open(
a, &data,
vfile_open_callback,
vfile_read_callback,
vfile_close_callback
);
} else {
return;
}
if (ret != ARCHIVE_OK) {
LOG_ERRORF(doc->filepath, "(arc.c) [%d] %s", ret, archive_error_string(a))
archive_read_free(a);
return;
}
if (ScanCtx.archive_mode == ARC_MODE_LIST) {
dyn_buffer_t buf = dyn_buffer_create();
while (archive_read_next_header(a, &entry) == ARCHIVE_OK) {
if (S_ISREG(archive_entry_stat(entry)->st_mode)) {
char *path = (char *) archive_entry_pathname(entry);
dyn_buffer_append_string(&buf, path);
dyn_buffer_write_char(&buf, '\n');
}
}
dyn_buffer_write_char(&buf, '\0');
meta_line_t *meta_list = malloc(sizeof(meta_line_t) + buf.cur);
meta_list->key = MetaContent;
strcpy(meta_list->strval, buf.buf);
APPEND_META(doc, meta_list);
dyn_buffer_destroy(&buf);
} else {
parse_job_t *sub_job = malloc(sizeof(parse_job_t) + PATH_MAX * 2);
sub_job->vfile.close = NULL;
sub_job->vfile.read = arc_read;
sub_job->vfile.arc = a;
sub_job->vfile.filepath = sub_job->filepath;
sub_job->vfile.is_fs_file = FALSE;
memcpy(sub_job->parent, doc->uuid, sizeof(uuid_t));
while (archive_read_next_header(a, &entry) == ARCHIVE_OK) {
sub_job->info = *archive_entry_stat(entry);
if (S_ISREG(sub_job->info.st_mode)) {
sprintf(sub_job->filepath, "%s#/%s", f->filepath, archive_entry_pathname(entry));
sub_job->base = (int) (strrchr(sub_job->filepath, '/') - sub_job->filepath) + 1;
char *p = strrchr(sub_job->filepath, '.');
if (p != NULL) {
sub_job->ext = (int) (p - sub_job->filepath + 1);
} else {
sub_job->ext = (int) strlen(sub_job->filepath);
}
parse(sub_job);
}
}
free(sub_job);
}
archive_read_free(a);
}

13
src/parsing/arc.h Normal file
View File

@@ -0,0 +1,13 @@
#ifndef SIST2_ARC_H
#define SIST2_ARC_H
#include "src/sist.h"
#define ARC_BUF_SIZE 8192
int should_parse_filtered_file(const char *filepath, int ext);
void parse_archive(vfile_t *f, document_t *doc);
int arc_read(struct vfile * f, void *buf, size_t size);
#endif

52
src/parsing/cbr.c Normal file
View File

@@ -0,0 +1,52 @@
#include "cbr.h"
#include "src/ctx.h"
unsigned int cbr_mime;
unsigned int cbz_mime;
void cbr_init() {
cbr_mime = mime_get_mime_by_string(ScanCtx.mime_table, "application/x-cbr");
cbz_mime = mime_get_mime_by_string(ScanCtx.mime_table, "application/x-cbz");
}
int is_cbr(unsigned int mime) {
return mime == cbr_mime;
}
void parse_cbr(void *buf, size_t buf_len, document_t *doc) {
char *out_buf = malloc(buf_len * 2);
size_t out_buf_used = 0;
struct archive *rar_in = archive_read_new();
archive_read_support_filter_none(rar_in);
archive_read_support_format_rar(rar_in);
archive_read_open_memory(rar_in, buf, buf_len);
struct archive *zip_out = archive_write_new();
archive_write_set_format_zip(zip_out);
archive_write_open_memory(zip_out, out_buf, buf_len * 2, &out_buf_used);
struct archive_entry *entry;
while (archive_read_next_header(rar_in, &entry) == ARCHIVE_OK) {
archive_write_header(zip_out, entry);
char arc_buf[ARC_BUF_SIZE];
int len = archive_read_data(rar_in, arc_buf, ARC_BUF_SIZE);
while (len > 0) {
archive_write_data(zip_out, arc_buf, len);
len = archive_read_data(rar_in, arc_buf, ARC_BUF_SIZE);
}
}
archive_write_close(zip_out);
archive_write_free(zip_out);
archive_read_close(rar_in);
archive_read_free(rar_in);
doc->mime = cbz_mime;
parse_pdf(out_buf, out_buf_used, doc);
doc->mime = cbr_mime;
free(out_buf);
}

12
src/parsing/cbr.h Normal file
View File

@@ -0,0 +1,12 @@
#ifndef SIST2_CBR_H
#define SIST2_CBR_H
#include "src/sist.h"
void cbr_init();
int is_cbr(unsigned int mime);
void parse_cbr(void *buf, size_t buf_len, document_t *doc);
#endif

140
src/parsing/doc.c Normal file
View File

@@ -0,0 +1,140 @@
#include "doc.h"
#include "src/ctx.h"
#define STR_STARTS_WITH(x, y) (strncmp(y, x, sizeof(y) - 1) == 0)
__always_inline
static int should_read_part(const char *part) {
LOG_DEBUGF("doc.c", "Got part : %s", part)
if (part == NULL) {
return FALSE;
}
if ( // Word
STR_STARTS_WITH(part, "word/document.xml")
|| STR_STARTS_WITH(part, "word/footnotes.xml")
|| STR_STARTS_WITH(part, "word/endnotes.xml")
|| STR_STARTS_WITH(part, "word/footer")
|| STR_STARTS_WITH(part, "word/header")
// PowerPoint
|| STR_STARTS_WITH(part, "ppt/slides/slide")
|| STR_STARTS_WITH(part, "ppt/notesSlides/slide")
// Excel
|| STR_STARTS_WITH(part, "xl/worksheets/sheet")
|| STR_STARTS_WITH(part, "xl/sharedStrings.xml")
|| STR_STARTS_WITH(part, "xl/workbook.xml")
) {
return TRUE;
}
return FALSE;
}
int extract_text(xmlDoc *xml, xmlNode *node, text_buffer_t *buf) {
//TODO: Check which nodes are likely to have a 't' child, and ignore nodes that aren't
xmlErrorPtr err = xmlGetLastError();
if (err != NULL) {
if (err->level == XML_ERR_FATAL) {
LOG_ERRORF("doc.c", "Got fatal XML error while parsing document: %s", err->message)
return -1;
} else {
LOG_ERRORF("doc.c", "Got recoverable XML error while parsing document: %s", err->message)
}
}
for (xmlNode *child = node; child; child = child->next) {
if (*child->name == 't' && *(child->name + 1) == '\0') {
xmlChar *text = xmlNodeListGetString(xml, child->xmlChildrenNode, 1);
if (text) {
text_buffer_append_string0(buf, (char *) text);
text_buffer_append_char(buf, ' ');
xmlFree(text);
}
}
extract_text(xml, child->children, buf);
}
}
int xml_io_read(void *context, char *buffer, int len) {
struct archive *a = context;
return archive_read_data(a, buffer, len);
}
int xml_io_close(UNUSED(void *context)) {
//noop
return 0;
}
__always_inline
static int read_part(struct archive *a, text_buffer_t *buf, document_t *doc) {
xmlDoc *xml = xmlReadIO(xml_io_read, xml_io_close, a, "/", NULL, XML_PARSE_RECOVER | XML_PARSE_NOWARNING | XML_PARSE_NOERROR | XML_PARSE_NONET);
if (xml == NULL) {
LOG_ERROR(doc->filepath, "Could not parse XML")
return -1;
}
xmlNode *root = xmlDocGetRootElement(xml);
if (root == NULL) {
LOG_ERROR(doc->filepath, "Empty document")
xmlFreeDoc(xml);
return -1;
}
extract_text(xml, root, buf);
xmlFreeDoc(xml);
return 0;
}
void parse_doc(void *mem, size_t mem_len, document_t *doc) {
if (mem == NULL) {
return;
}
struct archive *a = archive_read_new();
archive_read_support_format_zip(a);
int ret = archive_read_open_memory(a, mem, mem_len);
if (ret != ARCHIVE_OK) {
LOG_ERRORF(doc->filepath, "Could not read archive: %s", archive_error_string(a))
archive_read_free(a);
return;
}
text_buffer_t buf = text_buffer_create(ScanCtx.content_size);
struct archive_entry *entry;
while (archive_read_next_header(a, &entry) == ARCHIVE_OK) {
if (S_ISREG(archive_entry_stat(entry)->st_mode)) {
const char *path = archive_entry_pathname(entry);
if (should_read_part(path)) {
ret = read_part(a, &buf, doc);
if (ret != 0) {
break;
}
}
}
}
if (buf.dyn_buffer.cur > 0) {
text_buffer_terminate_string(&buf);
meta_line_t *meta = malloc(sizeof(meta_line_t) + buf.dyn_buffer.cur);
meta->key = MetaContent;
strcpy(meta->strval, buf.dyn_buffer.buf);
APPEND_META(doc, meta)
}
archive_read_close(a);
archive_read_free(a);
text_buffer_destroy(&buf);
}

8
src/parsing/doc.h Normal file
View File

@@ -0,0 +1,8 @@
#ifndef SIST2_DOC_H
#define SIST2_DOC_H
#include "src/sist.h"
void parse_doc(void *buf, size_t buf_len, document_t *doc);
#endif

View File

@@ -1,11 +1,9 @@
#include "font.h" #include "font.h"
#include "ft2build.h"
#include "freetype/freetype.h"
#include "src/ctx.h" #include "src/ctx.h"
__thread FT_Library library = NULL; __thread FT_Library ft_lib = NULL;
typedef struct text_dimensions { typedef struct text_dimensions {
@@ -15,12 +13,12 @@ typedef struct text_dimensions {
} text_dimensions_t; } text_dimensions_t;
typedef struct glyph { typedef struct glyph {
unsigned int top; int top;
unsigned int height; int height;
unsigned int width; int width;
unsigned int descent; int descent;
unsigned int ascent; int ascent;
unsigned int advance_width; int advance_width;
unsigned char *pixmap; unsigned char *pixmap;
} glyph_t; } glyph_t;
@@ -39,10 +37,10 @@ glyph_t ft_glyph_to_glyph(FT_GlyphSlot slot) {
glyph.pixmap = slot->bitmap.buffer; glyph.pixmap = slot->bitmap.buffer;
glyph.width = slot->bitmap.width; glyph.width = (int) slot->bitmap.width;
glyph.height = slot->bitmap.rows; glyph.height = (int) slot->bitmap.rows;
glyph.top = slot->bitmap_top; glyph.top = slot->bitmap_top;
glyph.advance_width = slot->advance.x / 64; glyph.advance_width = (int) slot->advance.x / 64;
glyph.descent = MAX(0, glyph.height - glyph.top); glyph.descent = MAX(0, glyph.height - glyph.top);
glyph.ascent = MAX(0, MAX(glyph.top, glyph.height) - glyph.descent); glyph.ascent = MAX(0, MAX(glyph.top, glyph.height) - glyph.descent);
@@ -50,10 +48,6 @@ glyph_t ft_glyph_to_glyph(FT_GlyphSlot slot) {
return glyph; return glyph;
} }
__always_inline
glyph_t get_glyph(char character, FT_Face face) {
}
text_dimensions_t text_dimension(char *text, FT_Face face) { text_dimensions_t text_dimension(char *text, FT_Face face) {
text_dimensions_t dimensions; text_dimensions_t dimensions;
@@ -62,7 +56,7 @@ text_dimensions_t text_dimension(char *text, FT_Face face) {
int num_chars = (int) strlen(text); int num_chars = (int) strlen(text);
unsigned int max_ascent = 0; unsigned int max_ascent = 0;
unsigned int max_descent = 0; int max_descent = 0;
char pc = 0; char pc = 0;
for (int i = 0; i < num_chars; i++) { for (int i = 0; i < num_chars; i++) {
@@ -72,7 +66,7 @@ text_dimensions_t text_dimension(char *text, FT_Face face) {
glyph_t glyph = ft_glyph_to_glyph(face->glyph); glyph_t glyph = ft_glyph_to_glyph(face->glyph);
max_descent = MAX(max_descent, glyph.descent); max_descent = MAX(max_descent, glyph.descent);
max_ascent = MAX(max_ascent, glyph.ascent); max_ascent = MAX(max_ascent, MAX(glyph.height, glyph.ascent));
int kerning_x = kerning_offset(c, pc, face); int kerning_x = kerning_offset(c, pc, face);
dimensions.width += MAX(glyph.advance_width, glyph.width) + kerning_x; dimensions.width += MAX(glyph.advance_width, glyph.width) + kerning_x;
@@ -143,20 +137,28 @@ void bmp_format(dyn_buffer_t *buf, text_dimensions_t dimensions, const unsigned
} }
void parse_font(const char *buf, size_t buf_len, document_t *doc) { void parse_font(const char *buf, size_t buf_len, document_t *doc) {
if (library == NULL) { if (ft_lib == NULL) {
FT_Init_FreeType(&library); FT_Init_FreeType(&ft_lib);
}
if (buf == NULL) {
return;
} }
FT_Face face; FT_Face face;
FT_Error err = FT_New_Memory_Face(library, (unsigned char *) buf, buf_len, 0, &face); FT_Error err = FT_New_Memory_Face(ft_lib, (unsigned char *) buf, buf_len, 0, &face);
if (err != 0) { if (err != 0) {
LOG_ERRORF(doc->filepath, "(font.c) FT_New_Memory_Face() returned error code [%d] %s", err, ft_error_string(err));
return; return;
} }
char font_name[1024]; char font_name[1024];
if (face->style_name == NULL || *(face->style_name) == '?') { if (face->style_name == NULL || *(face->style_name) == '?') {
strcpy(font_name, face->family_name); if (face->family_name == NULL) {
strcpy(font_name, "(null)");
} else {
strcpy(font_name, face->family_name);
}
} else { } else {
snprintf(font_name, sizeof(font_name), "%s %s", face->family_name, face->style_name); snprintf(font_name, sizeof(font_name), "%s %s", face->family_name, face->style_name);
} }
@@ -166,11 +168,16 @@ void parse_font(const char *buf, size_t buf_len, document_t *doc) {
strcpy(meta_name->strval, font_name); strcpy(meta_name->strval, font_name);
APPEND_META(doc, meta_name) APPEND_META(doc, meta_name)
if (ScanCtx.tn_size <= 0) {
return;
}
int pixel = 64; int pixel = 64;
int num_chars = (int) strlen(font_name); int num_chars = (int) strlen(font_name);
err = FT_Set_Pixel_Sizes(face, 0, pixel); err = FT_Set_Pixel_Sizes(face, 0, pixel);
if (err != 0) { if (err != 0) {
LOG_WARNINGF(doc->filepath, "(font.c) FT_Set_Pixel_Sizes() returned error code [%d] %s", err, ft_error_string(err))
return; return;
} }
@@ -186,11 +193,19 @@ void parse_font(const char *buf, size_t buf_len, document_t *doc) {
err = FT_Load_Char(face, c, FT_LOAD_NO_HINTING | FT_LOAD_RENDER); err = FT_Load_Char(face, c, FT_LOAD_NO_HINTING | FT_LOAD_RENDER);
if (err != 0) { if (err != 0) {
continue; c = c >= 'a' && c <= 'z' ? c - 32 : c + 32;
err = FT_Load_Char(face, c, FT_LOAD_NO_HINTING | FT_LOAD_RENDER);
if (err != 0) {
LOG_WARNINGF(doc->filepath, "(font.c) FT_Load_Char() returned error code [%d] %s", err, ft_error_string(err));
continue;
}
} }
glyph_t glyph = ft_glyph_to_glyph(face->glyph); glyph_t glyph = ft_glyph_to_glyph(face->glyph);
pen.x += kerning_offset(c, pc, face); pen.x += kerning_offset(c, pc, face);
if (pen.x <= 0) {
pen.x = ABS(glyph.advance_width - glyph.width);
}
pen.y = dimensions.height - glyph.ascent - dimensions.baseline; pen.y = dimensions.height - glyph.ascent - dimensions.baseline;
draw_glyph(&glyph, pen.x, pen.y, dimensions, bitmap); draw_glyph(&glyph, pen.x, pen.y, dimensions, bitmap);

View File

@@ -1,7 +1,11 @@
#include "src/sist.h" #include "src/sist.h"
#include "src/ctx.h" #include "src/ctx.h"
AVCodecContext *alloc_jpeg_encoder(int dstW, int dstH, float qscale) { #define MIN_SIZE 32
#define AVIO_BUF_SIZE 8192
__always_inline
static AVCodecContext *alloc_jpeg_encoder(int dstW, int dstH, float qscale) {
AVCodec *jpeg_codec = avcodec_find_encoder(AV_CODEC_ID_MJPEG); AVCodec *jpeg_codec = avcodec_find_encoder(AV_CODEC_ID_MJPEG);
AVCodecContext *jpeg = avcodec_alloc_context3(jpeg_codec); AVCodecContext *jpeg = avcodec_alloc_context3(jpeg_codec);
@@ -22,8 +26,8 @@ AVCodecContext *alloc_jpeg_encoder(int dstW, int dstH, float qscale) {
return jpeg; return jpeg;
} }
__always_inline
AVFrame *scale_frame(const AVCodecContext *decoder, const AVFrame *frame, int size) { AVFrame *scale_frame(const AVCodecContext *decoder, const AVFrame *frame, int size) {
AVFrame *scaled_frame = av_frame_alloc();
int dstW; int dstW;
int dstH; int dstH;
@@ -41,16 +45,22 @@ AVFrame *scale_frame(const AVCodecContext *decoder, const AVFrame *frame, int si
} }
} }
if (dstW <= MIN_SIZE || dstH <= MIN_SIZE) {
return NULL;
}
AVFrame *scaled_frame = av_frame_alloc();
struct SwsContext *ctx = sws_getContext( struct SwsContext *ctx = sws_getContext(
decoder->width, decoder->height, decoder->pix_fmt, decoder->width, decoder->height, decoder->pix_fmt,
dstW, dstH, AV_PIX_FMT_YUVJ420P, dstW, dstH, AV_PIX_FMT_YUVJ420P,
SWS_FAST_BILINEAR, 0, 0, 0 SWS_FAST_BILINEAR, 0, 0, 0
); );
int dst_buf_len = avpicture_get_size(AV_PIX_FMT_YUVJ420P, dstW, dstH); int dst_buf_len = av_image_get_buffer_size(AV_PIX_FMT_YUV420P, dstW, dstH, 1);
uint8_t *dst_buf = (uint8_t *) av_malloc(dst_buf_len); uint8_t *dst_buf = (uint8_t *) av_malloc(dst_buf_len);
avpicture_fill((AVPicture *) scaled_frame, dst_buf, AV_PIX_FMT_YUVJ420P, dstW, dstH); av_image_fill_arrays(scaled_frame->data, scaled_frame->linesize, dst_buf, AV_PIX_FMT_YUV420P, dstW, dstH, 1);
sws_scale(ctx, sws_scale(ctx,
(const uint8_t *const *) frame->data, frame->linesize, (const uint8_t *const *) frame->data, frame->linesize,
@@ -67,7 +77,8 @@ AVFrame *scale_frame(const AVCodecContext *decoder, const AVFrame *frame, int si
return scaled_frame; return scaled_frame;
} }
AVFrame *read_frame(AVFormatContext *pFormatCtx, AVCodecContext *decoder, int stream_idx) { __always_inline
static AVFrame *read_frame(AVFormatContext *pFormatCtx, AVCodecContext *decoder, int stream_idx, document_t *doc) {
AVFrame *frame = av_frame_alloc(); AVFrame *frame = av_frame_alloc();
AVPacket avPacket; AVPacket avPacket;
@@ -81,7 +92,10 @@ AVFrame *read_frame(AVFormatContext *pFormatCtx, AVCodecContext *decoder, int st
if (read_frame_ret != 0) { if (read_frame_ret != 0) {
if (read_frame_ret != AVERROR_EOF) { if (read_frame_ret != AVERROR_EOF) {
fprintf(stderr, "Error reading frame: %s\n", av_err2str(read_frame_ret)); LOG_WARNINGF(doc->filepath,
"(media.c) avcodec_read_frame() returned error code [%d] %s",
read_frame_ret, av_err2str(read_frame_ret)
)
} }
av_frame_free(&frame); av_frame_free(&frame);
av_packet_unref(&avPacket); av_packet_unref(&avPacket);
@@ -99,7 +113,10 @@ AVFrame *read_frame(AVFormatContext *pFormatCtx, AVCodecContext *decoder, int st
// Feed it to decoder // Feed it to decoder
int decode_ret = avcodec_send_packet(decoder, &avPacket); int decode_ret = avcodec_send_packet(decoder, &avPacket);
if (decode_ret != 0) { if (decode_ret != 0) {
printf("Error decoding frame: %s\n", av_err2str(decode_ret)); LOG_WARNINGF(doc->filepath,
"(media.c) avcodec_send_packet() returned error code [%d] %s",
decode_ret, av_err2str(decode_ret)
)
} }
av_packet_unref(&avPacket); av_packet_unref(&avPacket);
receive_ret = avcodec_receive_frame(decoder, frame); receive_ret = avcodec_receive_frame(decoder, frame);
@@ -107,63 +124,102 @@ AVFrame *read_frame(AVFormatContext *pFormatCtx, AVCodecContext *decoder, int st
return frame; return frame;
} }
void append_audio_meta(AVFormatContext *pFormatCtx, document_t *doc) { #define APPEND_TAG_META(doc, tag_, keyname) \
text_buffer_t tex = text_buffer_create(-1); \
text_buffer_append_string0(&tex, tag_->value); \
text_buffer_terminate_string(&tex); \
meta_line_t *meta_tag = malloc(sizeof(meta_line_t) + tex.dyn_buffer.cur); \
meta_tag->key = keyname; \
strcpy(meta_tag->strval, tex.dyn_buffer.buf); \
APPEND_META(doc, meta_tag) \
text_buffer_destroy(&tex);
__always_inline
static void append_audio_meta(AVFormatContext *pFormatCtx, document_t *doc) {
AVDictionaryEntry *tag = NULL; AVDictionaryEntry *tag = NULL;
while ((tag = av_dict_get(pFormatCtx->metadata, "", tag, AV_DICT_IGNORE_SUFFIX))) { while ((tag = av_dict_get(pFormatCtx->metadata, "", tag, AV_DICT_IGNORE_SUFFIX))) {
char *key = tag->key; char key[32];
for (; *key; ++key) *key = (char) tolower(*key); strncpy(key, tag->key, sizeof(key));
if (strcmp(tag->key, "artist") == 0) { char *ptr = key;
size_t len = strlen(tag->value); for (; *ptr; ++ptr) *ptr = (char) tolower(*ptr);
meta_line_t *meta_tag = malloc(sizeof(meta_line_t) + len);
meta_tag->key = MetaArtist; if (strcmp(key, "artist") == 0) {
memcpy(meta_tag->strval, tag->value, len); APPEND_TAG_META(doc, tag, MetaArtist)
APPEND_META(doc, meta_tag) } else if (strcmp(key, "genre") == 0) {
} else if (strcmp(tag->key, "genre") == 0) { APPEND_TAG_META(doc, tag, MetaGenre)
size_t len = strlen(tag->value); } else if (strcmp(key, "title") == 0) {
meta_line_t *meta_tag = malloc(sizeof(meta_line_t) + len); APPEND_TAG_META(doc, tag, MetaTitle)
meta_tag->key = MetaGenre; } else if (strcmp(key, "album_artist") == 0) {
memcpy(meta_tag->strval, tag->value, len); APPEND_TAG_META(doc, tag, MetaAlbumArtist)
APPEND_META(doc, meta_tag) } else if (strcmp(key, "album") == 0) {
} else if (strcmp(tag->key, "title") == 0) { APPEND_TAG_META(doc, tag, MetaAlbum)
size_t len = strlen(tag->value);
meta_line_t *meta_tag = malloc(sizeof(meta_line_t) + len);
meta_tag->key = MetaTitle;
memcpy(meta_tag->strval, tag->value, len);
APPEND_META(doc, meta_tag)
} else if (strcmp(tag->key, "album_artist") == 0) {
size_t len = strlen(tag->value);
meta_line_t *meta_tag = malloc(sizeof(meta_line_t) + len);
meta_tag->key = MetaAlbumArtist;
memcpy(meta_tag->strval, tag->value, len);
APPEND_META(doc, meta_tag)
} else if (strcmp(tag->key, "album") == 0) {
size_t len = strlen(tag->value);
meta_line_t *meta_tag = malloc(sizeof(meta_line_t) + len);
meta_tag->key = MetaAlbum;
memcpy(meta_tag->strval, tag->value, len);
APPEND_META(doc, meta_tag)
} }
} }
} }
void parse_media(const char *filepath, document_t *doc) { __always_inline
static void append_video_meta(AVFormatContext *pFormatCtx, AVFrame *frame, document_t *doc, int include_audio_tags, int is_video) {
if (is_video) {
meta_line_t *meta_duration = malloc(sizeof(meta_line_t));
meta_duration->key = MetaMediaDuration;
meta_duration->longval = pFormatCtx->duration / AV_TIME_BASE;
APPEND_META(doc, meta_duration)
meta_line_t *meta_bitrate = malloc(sizeof(meta_line_t));
meta_bitrate->key = MetaMediaBitrate;
meta_bitrate->longval = pFormatCtx->bit_rate;
APPEND_META(doc, meta_bitrate)
}
AVDictionaryEntry *tag = NULL;
if (is_video) {
while ((tag = av_dict_get(pFormatCtx->metadata, "", tag, AV_DICT_IGNORE_SUFFIX))) {
if (include_audio_tags && strcmp(tag->key, "title") == 0) {
APPEND_TAG_META(doc, tag, MetaTitle)
} else if (strcmp(tag->key, "comment") == 0) {
APPEND_TAG_META(doc, tag, MetaContent)
} else if (include_audio_tags && strcmp(tag->key, "artist") == 0) {
APPEND_TAG_META(doc, tag, MetaArtist)
}
}
} else {
// EXIF metadata
while ((tag = av_dict_get(frame->metadata, "", tag, AV_DICT_IGNORE_SUFFIX))) {
if (include_audio_tags && strcmp(tag->key, "Artist") == 0) {
APPEND_TAG_META(doc, tag, MetaArtist)
} else if (strcmp(tag->key, "ImageDescription") == 0) {
APPEND_TAG_META(doc, tag, MetaContent)
} else if (strcmp(tag->key, "Make") == 0) {
APPEND_TAG_META(doc, tag, MetaExifMake)
} else if (strcmp(tag->key, "Model") == 0) {
APPEND_TAG_META(doc, tag, MetaExifModel)
} else if (strcmp(tag->key, "Software") == 0) {
APPEND_TAG_META(doc, tag, MetaExifSoftware)
} else if (strcmp(tag->key, "FNumber") == 0) {
APPEND_TAG_META(doc, tag, MetaExifFNumber)
} else if (strcmp(tag->key, "FocalLength") == 0) {
APPEND_TAG_META(doc, tag, MetaExifFocalLength)
} else if (strcmp(tag->key, "UserComment") == 0) {
APPEND_TAG_META(doc, tag, MetaExifUserComment)
} else if (strcmp(tag->key, "ISOSpeedRatings") == 0) {
APPEND_TAG_META(doc, tag, MetaExifIsoSpeedRatings)
} else if (strcmp(tag->key, "ExposureTime") == 0) {
APPEND_TAG_META(doc, tag, MetaExifExposureTime)
} else if (strcmp(tag->key, "DateTime") == 0) {
APPEND_TAG_META(doc, tag, MetaExifDateTime)
}
}
}
}
void parse_media(AVFormatContext *pFormatCtx, document_t *doc) {
int video_stream = -1; int video_stream = -1;
int audio_stream = -1; int audio_stream = -1;
AVFormatContext *pFormatCtx = avformat_alloc_context();
if (pFormatCtx == NULL) {
fprintf(stderr, "Could not allocate AVFormatContext! %s \n", filepath);
return;
}
int res = avformat_open_input(&pFormatCtx, filepath, NULL, NULL);
if (res < 0) {
printf("ERR%s %s\n", filepath, av_err2str(res));
return;
}
avformat_find_stream_info(pFormatCtx, NULL); avformat_find_stream_info(pFormatCtx, NULL);
for (int i = (int) pFormatCtx->nb_streams - 1; i >= 0; i--) { for (int i = (int) pFormatCtx->nb_streams - 1; i >= 0; i--) {
@@ -202,23 +258,10 @@ void parse_media(const char *filepath, document_t *doc) {
} }
} }
if (video_stream != -1) { if (video_stream != -1 && ScanCtx.tn_size > 0) {
AVStream *stream = pFormatCtx->streams[video_stream]; AVStream *stream = pFormatCtx->streams[video_stream];
if (stream->nb_frames > 1) { if (stream->codecpar->width <= MIN_SIZE || stream->codecpar->height <= MIN_SIZE) {
//This is a video (not a still image)
meta_line_t *meta_duration = malloc(sizeof(meta_line_t));
meta_duration->key = MetaMediaDuration;
meta_duration->longval = pFormatCtx->duration / AV_TIME_BASE;
APPEND_META(doc, meta_duration)
meta_line_t *meta_bitrate = malloc(sizeof(meta_line_t));
meta_bitrate->key = MetaMediaBitrate;
meta_bitrate->intval = pFormatCtx->bit_rate;
APPEND_META(doc, meta_bitrate)
}
if (stream->codecpar->width <= 20 || stream->codecpar->height <= 20) {
avformat_close_input(&pFormatCtx); avformat_close_input(&pFormatCtx);
avformat_free_context(pFormatCtx); avformat_free_context(pFormatCtx);
return; return;
@@ -242,7 +285,7 @@ void parse_media(const char *filepath, document_t *doc) {
} }
} }
AVFrame *frame = read_frame(pFormatCtx, decoder, video_stream); AVFrame *frame = read_frame(pFormatCtx, decoder, video_stream, doc);
if (frame == NULL) { if (frame == NULL) {
avcodec_free_context(&decoder); avcodec_free_context(&decoder);
avformat_close_input(&pFormatCtx); avformat_close_input(&pFormatCtx);
@@ -250,9 +293,19 @@ void parse_media(const char *filepath, document_t *doc) {
return; return;
} }
append_video_meta(pFormatCtx, frame, doc, audio_stream == -1, stream->nb_frames > 1);
// Scale frame // Scale frame
AVFrame *scaled_frame = scale_frame(decoder, frame, ScanCtx.tn_size); AVFrame *scaled_frame = scale_frame(decoder, frame, ScanCtx.tn_size);
if (scaled_frame == NULL) {
av_frame_free(&frame);
avcodec_free_context(&decoder);
avformat_close_input(&pFormatCtx);
avformat_free_context(pFormatCtx);
return;
}
// Encode frame to jpeg // Encode frame to jpeg
AVCodecContext *jpeg_encoder = alloc_jpeg_encoder(scaled_frame->width, scaled_frame->height, ScanCtx.tn_qscale); AVCodecContext *jpeg_encoder = alloc_jpeg_encoder(scaled_frame->width, scaled_frame->height, ScanCtx.tn_qscale);
avcodec_send_frame(jpeg_encoder, scaled_frame); avcodec_send_frame(jpeg_encoder, scaled_frame);
@@ -262,7 +315,8 @@ void parse_media(const char *filepath, document_t *doc) {
avcodec_receive_packet(jpeg_encoder, &jpeg_packet); avcodec_receive_packet(jpeg_encoder, &jpeg_packet);
// Save thumbnail // Save thumbnail
store_write(ScanCtx.index.store, (char *) doc->uuid, sizeof(doc->uuid), (char *) jpeg_packet.data, jpeg_packet.size); store_write(ScanCtx.index.store, (char *) doc->uuid, sizeof(doc->uuid), (char *) jpeg_packet.data,
jpeg_packet.size);
av_packet_unref(&jpeg_packet); av_packet_unref(&jpeg_packet);
av_frame_free(&frame); av_frame_free(&frame);
@@ -276,3 +330,69 @@ void parse_media(const char *filepath, document_t *doc) {
avformat_free_context(pFormatCtx); avformat_free_context(pFormatCtx);
} }
void parse_media_filename(const char *filepath, document_t *doc) {
AVFormatContext *pFormatCtx = avformat_alloc_context();
if (pFormatCtx == NULL) {
LOG_ERROR(doc->filepath, "(media.c) Could not allocate context with avformat_alloc_context()")
return;
}
int res = avformat_open_input(&pFormatCtx, filepath, NULL, NULL);
if (res < 0) {
LOG_ERRORF(doc->filepath, "(media.c) avformat_open_input() returned [%d] %s", res, av_err2str(res))
avformat_close_input(&pFormatCtx);
avformat_free_context(pFormatCtx);
return;
}
parse_media(pFormatCtx, doc);
}
int vfile_read(void *ptr, uint8_t *buf, int buf_size) {
struct vfile *f = ptr;
int ret = f->read(f, buf, buf_size);
if (ret == 0) {
return AVERROR_EOF;
}
return ret;
}
void parse_media_vfile(struct vfile *f, document_t *doc) {
AVFormatContext *pFormatCtx = avformat_alloc_context();
if (pFormatCtx == NULL) {
LOG_ERROR(doc->filepath, "(media.c) Could not allocate context with avformat_alloc_context()")
return;
}
unsigned char *buffer = (unsigned char *) av_malloc(AVIO_BUF_SIZE);
AVIOContext *io_ctx = avio_alloc_context(buffer, AVIO_BUF_SIZE, 0, f, vfile_read, NULL, NULL);
pFormatCtx->pb = io_ctx;
pFormatCtx->flags |= AVFMT_FLAG_CUSTOM_IO;
int res = avformat_open_input(&pFormatCtx, "", NULL, NULL);
if (res == -5) {
// Tried to parse media that requires seek
av_free(io_ctx->buffer);
avio_context_free(&io_ctx);
avformat_close_input(&pFormatCtx);
avformat_free_context(pFormatCtx);
return;
} else if (res < 0) {
LOG_ERRORF(doc->filepath, "(media.c) avformat_open_input() returned [%d] %s", res, av_err2str(res))
av_free(io_ctx->buffer);
avio_context_free(&io_ctx);
avformat_close_input(&pFormatCtx);
avformat_free_context(pFormatCtx);
return;
}
parse_media(pFormatCtx, doc);
av_free(io_ctx->buffer);
avio_context_free(&io_ctx);
}

View File

@@ -5,7 +5,10 @@
#include "src/sist.h" #include "src/sist.h"
#define MIN_VIDEO_SIZE 1024 * 64 #define MIN_VIDEO_SIZE 1024 * 64
#define MIN_IMAGE_SIZE 1024 * 2
void parse_media(const char * filepath, document_t *doc); void parse_media_filename(const char * filepath, document_t *doc);
void parse_media_vfile(struct vfile *f, document_t *doc);
#endif #endif

View File

@@ -1,10 +1,12 @@
#include "mime.h" #include "mime.h"
unsigned int mime_get_mime_by_ext(GHashTable *ext_table, const char * ext) { unsigned int mime_get_mime_by_ext(GHashTable *ext_table, const char * ext) {
char lower[64]; char lower[8];
char *p = lower; char *p = lower;
while ((*ext)) { int cnt = 0;
while ((*ext) != '\0' && cnt + 1 < sizeof(lower)) {
*p++ = (char)tolower(*ext++); *p++ = (char)tolower(*ext++);
cnt++;
} }
*p = '\0'; *p = '\0';
return (size_t) g_hash_table_lookup(ext_table, lower); return (size_t) g_hash_table_lookup(ext_table, lower);

View File

@@ -8,7 +8,7 @@
#define MIME_EMPTY 1 #define MIME_EMPTY 1
#define DONT_PARSE 0x80000000 #define DONT_PARSE 0x80000000
#define SHOULD_PARSE(mime_id) (mime_id & DONT_PARSE) != DONT_PARSE #define SHOULD_PARSE(mime_id) (ScanCtx.fast == 0 && (mime_id & DONT_PARSE) != DONT_PARSE && mime_id != 0)
#define PDF_MASK 0x40000000 #define PDF_MASK 0x40000000
#define IS_PDF(mime_id) (mime_id & PDF_MASK) == PDF_MASK #define IS_PDF(mime_id) (mime_id & PDF_MASK) == PDF_MASK
@@ -16,6 +16,15 @@
#define FONT_MASK 0x20000000 #define FONT_MASK 0x20000000
#define IS_FONT(mime_id) (mime_id & FONT_MASK) == FONT_MASK #define IS_FONT(mime_id) (mime_id & FONT_MASK) == FONT_MASK
#define ARC_MASK 0x10000000
#define IS_ARC(mime_id) (mime_id & ARC_MASK) == ARC_MASK
#define ARC_FILTER_MASK 0x08000000
#define IS_ARC_FILTER(mime_id) (mime_id & ARC_FILTER_MASK) == ARC_FILTER_MASK
#define DOC_MASK 0x04000000
#define IS_DOC(mime_id) (mime_id & DOC_MASK) == DOC_MASK
enum major_mime { enum major_mime {
MimeInvalid = 0, MimeInvalid = 0,
MimeModel = 1, MimeModel = 1,

View File

@@ -16,11 +16,11 @@ enum mime {
application_commonground=655368, application_commonground=655368,
application_dicom=655369, application_dicom=655369,
application_drafting=655370, application_drafting=655370,
application_epub_zip=655371, application_epub_zip=655371 | 0x40000000,
application_freeloader=655372, application_freeloader=655372,
application_futuresplash=655373, application_futuresplash=655373,
application_groupwise=655374, application_groupwise=655374,
application_gzip=655375, application_gzip=655375 | 0x08000000,
application_hta=655376, application_hta=655376,
application_i_deas=655377, application_i_deas=655377,
application_iges=655378, application_iges=655378,
@@ -39,333 +39,389 @@ enum mime {
application_oda=655391, application_oda=655391,
application_ogg=655392, application_ogg=655392,
application_pdf=655393 | 0x40000000, application_pdf=655393 | 0x40000000,
application_pgp_signature=655394, application_pgp_keys=655394,
application_pkcs7_signature=655395, application_pgp_signature=655395,
application_pkix_cert=655396, application_pkcs7_signature=655396,
application_postscript=655397, application_pkix_cert=655397,
application_pro_eng=655398, application_postscript=655398,
application_ringing_tones=655399, application_pro_eng=655399,
application_smil=655400, application_ringing_tones=655400,
application_solids=655401, application_smil=655401,
application_sounder=655402, application_solids=655402,
application_step=655403, application_sounder=655403,
application_streamingmedia=655404, application_step=655404,
application_vda=655405, application_streamingmedia=655405,
application_vnd_fdf=655406, application_vda=655406,
application_vnd_font_fontforge_sfd=655407, application_vnd_fdf=655407,
application_vnd_hp_hpgl=655408, application_vnd_font_fontforge_sfd=655408,
application_vnd_iccprofile=655409, application_vnd_hp_hpgl=655409,
application_vnd_ms_cab_compressed=655410, application_vnd_iccprofile=655410,
application_vnd_ms_excel=655411, application_vnd_lotus_1_2_3=655411,
application_vnd_ms_fontobject=655412, application_vnd_ms_cab_compressed=655412,
application_vnd_ms_opentype=655413 | 0x20000000, application_vnd_ms_excel=655413,
application_vnd_ms_pki_certstore=655414, application_vnd_ms_fontobject=655414,
application_vnd_ms_pki_pko=655415, application_vnd_ms_opentype=655415 | 0x20000000,
application_vnd_ms_pki_seccat=655416, application_vnd_ms_pki_certstore=655416,
application_vnd_ms_powerpoint=655417, application_vnd_ms_pki_pko=655417,
application_vnd_ms_project=655418, application_vnd_ms_pki_seccat=655418,
application_vnd_oasis_opendocument_base=655419, application_vnd_ms_powerpoint=655419,
application_vnd_oasis_opendocument_formula=655420, application_vnd_ms_project=655420,
application_vnd_oasis_opendocument_graphics=655421, application_vnd_oasis_opendocument_base=655421,
application_vnd_oasis_opendocument_text=655422, application_vnd_oasis_opendocument_formula=655422,
application_vnd_openxmlformats_officedocument_spreadsheetml_sheet=655423, application_vnd_oasis_opendocument_graphics=655423,
application_vnd_openxmlformats_officedocument_wordprocessingml_document=655424, application_vnd_oasis_opendocument_presentation=655424,
application_vnd_wap_wmlc=655425, application_vnd_oasis_opendocument_spreadsheet=655425,
application_vnd_wap_wmlscriptc=655426, application_vnd_oasis_opendocument_text=655426,
application_vnd_xara=655427, application_vnd_openxmlformats_officedocument_presentationml_presentation=655427 | 0x04000000,
application_vocaltec_media_desc=655428, application_vnd_openxmlformats_officedocument_spreadsheetml_sheet=655428 | 0x04000000,
application_vocaltec_media_file=655429, application_vnd_openxmlformats_officedocument_wordprocessingml_document=655429 | 0x04000000,
application_winhelp=655430, application_vnd_symbian_install=655430,
application_wordperfect=655431, application_vnd_tcpdump_pcap=655431,
application_wordperfect6_0=655432, application_vnd_wap_wmlc=655432,
application_wordperfect6_1=655433, application_vnd_wap_wmlscriptc=655433,
application_x_123=655434, application_vnd_xara=655434,
application_x_7z_compressed=655435, application_vocaltec_media_desc=655435,
application_x_aim=655436, application_vocaltec_media_file=655436,
application_x_archive=655437, application_warc=655437,
application_x_authorware_bin=655438, application_winhelp=655438,
application_x_authorware_map=655439, application_wordperfect=655439,
application_x_authorware_seg=655440, application_wordperfect6_0=655440,
application_x_bcpio=655441, application_wordperfect6_1=655441,
application_x_bittorrent=655442, application_x_123=655442,
application_x_bsh=655443, application_x_7z_compressed=655443 | 0x10000000,
application_x_bytecode_python=655444, application_x_aim=655444,
application_x_bzip=655445, application_x_apple_diskimage=655445,
application_x_bzip2=655446, application_x_arc=655446 | 0x10000000,
application_x_cbr=655447, application_x_archive=655447,
application_x_cbz=655448 | 0x40000000, application_x_atari_7800_rom=655448,
application_x_cdlink=655449, application_x_authorware_bin=655449,
application_x_chat=655450, application_x_authorware_map=655450,
application_x_cocoa=655451, application_x_authorware_seg=655451,
application_x_conference=655452, application_x_avira_qua=655452,
application_x_cpio=655453, application_x_bcpio=655453,
application_x_dbf=655454, application_x_bittorrent=655454,
application_x_dbt=655455, application_x_bsh=655455,
application_x_debian_package=655456, application_x_bytecode_python=655456,
application_x_deepv=655457, application_x_bzip=655457,
application_x_director=655458, application_x_bzip2=655458 | 0x08000000,
application_x_dosexec=655459, application_x_cbr=655459,
application_x_dvi=655460, application_x_cbz=655460 | 0x40000000,
application_x_elc=655461, application_x_cdlink=655461,
application_x_chat=655462,
application_x_chrome_extension=655463,
application_x_cocoa=655464,
application_x_conference=655465,
application_x_coredump=655466,
application_x_cpio=655467,
application_x_dbf=655468,
application_x_dbt=655469,
application_x_debian_package=655470,
application_x_deepv=655471,
application_x_director=655472,
application_x_dmp=655473,
application_x_dosdriver=655474,
application_x_dosexec=655475,
application_x_dvi=655476,
application_x_elc=655477,
application_x_empty=1, application_x_empty=1,
application_x_envoy=655463, application_x_envoy=655479,
application_x_esrehber=655464, application_x_esrehber=655480,
application_x_excel=655465, application_x_excel=655481,
application_x_executable=655466, application_x_executable=655482,
application_x_font_sfn=655467 | 0x20000000, application_x_font_gdos=655483,
application_x_font_ttf=655468 | 0x20000000, application_x_font_pf2=655484,
application_x_freelance=655469, application_x_font_pfm=655485,
application_x_git=655470, application_x_font_sfn=655486,
application_x_gsp=655471, application_x_font_ttf=655487 | 0x20000000,
application_x_gss=655472, application_x_freelance=655488,
application_x_gtar=655473, application_x_gamecube_rom=655489,
application_x_gzip=655474, application_x_gdbm=655490,
application_x_hdf=655475, application_x_gettext_translation=655491,
application_x_helpfile=655476, application_x_git=655492,
application_x_httpd_imap=655477, application_x_gsp=655493,
application_x_ima=655478, application_x_gss=655494,
application_x_innosetup=655479, application_x_gtar=655495,
application_x_internett_signup=655480, application_x_gzip=655496,
application_x_inventor=655481, application_x_hdf=655497,
application_x_ip2=655482, application_x_helpfile=655498,
application_x_java_applet=655483, application_x_httpd_imap=655499,
application_x_java_commerce=655484, application_x_ima=655500,
application_x_java_image=655485, application_x_innosetup=655501,
application_x_java_keystore=655486, application_x_internett_signup=655502,
application_x_kdelnk=655487, application_x_inventor=655503,
application_x_koan=655488, application_x_ip2=655504,
application_x_latex=655489, application_x_java_applet=655505,
application_x_livescreen=655490, application_x_java_commerce=655506,
application_x_lotus=655491, application_x_java_image=655507,
application_x_lzh=655492, application_x_java_jmod=655508,
application_x_lzx=655493, application_x_java_keystore=655509,
application_x_mach_binary=655494, application_x_kdelnk=655510,
application_x_mach_executable=655495, application_x_koan=655511,
application_x_magic_cap_package_1_0=655496, application_x_latex=655512,
application_x_mathcad=655497, application_x_livescreen=655513,
application_x_meme=655498, application_x_lotus=655514,
application_x_midi=655499, application_x_lz4=655515 | 0x08000000,
application_x_mif=655500, application_x_lz4_json=655516,
application_x_mix_transfer=655501, application_x_lzh=655517,
application_x_mobipocket_ebook=655502, application_x_lzh_compressed=655518,
application_x_ms_pdb=655503, application_x_lzip=655519 | 0x08000000,
application_x_ms_reader=655504, application_x_lzma=655520 | 0x08000000,
application_x_navi_animation=655505, application_x_lzop=655521 | 0x08000000,
application_x_navidoc=655506, application_x_lzx=655522,
application_x_navimap=655507, application_x_mach_binary=655523,
application_x_navistyle=655508, application_x_mach_executable=655524,
application_x_netcdf=655509, application_x_magic_cap_package_1_0=655525,
application_x_newton_compatible_pkg=655510, application_x_mathcad=655526,
application_x_object=655511, application_x_maxis_dbpf=655527,
application_x_omc=655512, application_x_meme=655528,
application_x_omcdatamaker=655513, application_x_midi=655529,
application_x_omcregerator=655514, application_x_mif=655530,
application_x_pagemaker=655515, application_x_mix_transfer=655531,
application_x_pcl=655516, application_x_mobipocket_ebook=655532,
application_x_pixclscript=655517, application_x_ms_compress_szdd=655533,
application_x_pkcs7_certreqresp=655518, application_x_ms_pdb=655534,
application_x_pkcs7_signature=655519, application_x_ms_reader=655535,
application_x_project=655520, application_x_msaccess=655536,
application_x_qpro=655521, application_x_navi_animation=655537,
application_x_rar=655522, application_x_navidoc=655538,
application_x_rpm=655523, application_x_navimap=655539,
application_x_sdp=655524, application_x_navistyle=655540,
application_x_sea=655525, application_x_nes_rom=655541,
application_x_seelogo=655526, application_x_netcdf=655542,
application_x_setupscript=655527, application_x_newton_compatible_pkg=655543,
application_x_shar=655528, application_x_nintendo_ds_rom=655544,
application_x_sharedlib=655529, application_x_object=655545,
application_x_shockwave_flash=655530, application_x_omc=655546,
application_x_sprite=655531, application_x_omcdatamaker=655547,
application_x_sqlite3=655532, application_x_omcregerator=655548,
application_x_sv4cpio=655533, application_x_pagemaker=655549,
application_x_sv4crc=655534, application_x_pcl=655550,
application_x_tar=655535, application_x_pgp_keyring=655551,
application_x_tbook=655536, application_x_pixclscript=655552,
application_x_tex_tfm=655537, application_x_pkcs7_certreqresp=655553,
application_x_texinfo=655538, application_x_pkcs7_signature=655554,
application_x_ustar=655539, application_x_project=655555,
application_x_visio=655540, application_x_qpro=655556,
application_x_vnd_audioexplosion_mzz=655541, application_x_rar=655557 | 0x10000000,
application_x_vnd_ls_xpix=655542, application_x_rpm=655558,
application_x_vrml=655543, application_x_sdp=655559,
application_x_wais_source=655544, application_x_sea=655560,
application_x_wine_extension_ini=655545, application_x_seelogo=655561,
application_x_wintalk=655546, application_x_setupscript=655562,
application_x_world=655547, application_x_shar=655563,
application_x_wri=655548, application_x_sharedlib=655564,
application_x_x509_ca_cert=655549, application_x_shockwave_flash=655565,
application_x_xz=655550, application_x_snappy_framed=655566,
application_xml=655551, application_x_sprite=655567,
application_zip=655552, application_x_sqlite3=655568,
audio_it=458945, application_x_sv4cpio=655569,
audio_make=458946, application_x_sv4crc=655570,
audio_mid=458947, application_x_tar=655571 | 0x10000000,
audio_midi=458948, application_x_tbook=655572,
audio_mp4=458949, application_x_terminfo=655573,
audio_mpeg=458950, application_x_terminfo2=655574,
audio_ogg=458951, application_x_tex_tfm=655575,
audio_s3m=458952, application_x_texinfo=655576,
audio_tsp_audio=458953, application_x_ustar=655577,
audio_tsplayer=458954, application_x_visio=655578,
audio_vnd_qcelp=458955, application_x_vnd_audioexplosion_mzz=655579,
audio_voxware=458956, application_x_vnd_ls_xpix=655580,
audio_x_flac=458957, application_x_vrml=655581,
audio_x_gsm=458958, application_x_wais_source=655582,
audio_x_jam=458959, application_x_wine_extension_ini=655583,
audio_x_liveaudio=458960, application_x_wintalk=655584,
audio_x_m4a=458961, application_x_world=655585,
audio_x_midi=458962, application_x_wri=655586,
audio_x_mod=458963, application_x_x509_ca_cert=655587,
audio_x_mp4a_latm=458964, application_x_xz=655588 | 0x08000000,
audio_x_mpeg_3=458965, application_x_zip=655589,
audio_x_mpequrl=458966, application_x_zstd=655590 | 0x08000000,
audio_x_nspaudio=458967, application_xml=655591,
audio_x_pn_realaudio=458968, application_zip=655592 | 0x10000000,
audio_x_psid=458969, application_zlib=655593,
audio_x_realaudio=458970, audio_it=458986,
audio_x_twinvq=458971, audio_make=458987,
audio_x_twinvq_plugin=458972, audio_mid=458988,
audio_x_voc=458973, audio_midi=458989,
audio_x_wav=458974, audio_mp4=458990,
audio_xm=458975, audio_mpeg=458991,
font_otf=327904 | 0x20000000, audio_ogg=458992,
font_sfnt=327905 | 0x20000000, audio_s3m=458993,
font_woff=327906 | 0x20000000, audio_tsp_audio=458994,
font_woff2=327907 | 0x20000000, audio_tsplayer=458995,
image_cmu_raster=524516, audio_vnd_qcelp=458996,
image_fif=524517, audio_voxware=458997,
image_florian=524518, audio_x_aiff=458998,
image_g3fax=524519, audio_x_flac=458999,
image_gif=524520, audio_x_gsm=459000,
image_ief=524521, audio_x_hx_aac_adts=459001,
image_jpeg=524522, audio_x_jam=459002,
image_jutvision=524523, audio_x_liveaudio=459003,
image_naplps=524524, audio_x_m4a=459004,
image_pict=524525, audio_x_midi=459005,
image_png=524526, audio_x_mod=459006,
image_svg=524527 | 0x80000000, audio_x_mp4a_latm=459007,
image_svg_xml=524528 | 0x80000000, audio_x_mpeg_3=459008,
image_tiff=524529, audio_x_mpequrl=459009,
image_vnd_adobe_photoshop=524530 | 0x80000000, audio_x_nspaudio=459010,
image_vnd_djvu=524531 | 0x80000000, audio_x_pn_realaudio=459011,
image_vnd_fpx=524532, audio_x_psid=459012,
image_vnd_microsoft_icon=524533, audio_x_realaudio=459013,
image_vnd_rn_realflash=524534, audio_x_twinvq=459014,
image_vnd_rn_realpix=524535, audio_x_twinvq_plugin=459015,
image_vnd_wap_wbmp=524536, audio_x_voc=459016,
image_vnd_xiff=524537, audio_x_wav=459017,
image_webp=524538, audio_xm=459018,
image_x_cmu_raster=524539, font_otf=327947 | 0x20000000,
image_x_cur=524540, font_sfnt=327948 | 0x20000000,
image_x_dwg=524541, font_woff=327949 | 0x20000000,
image_x_eps=524542, font_woff2=327950 | 0x20000000,
image_x_exr=524543, image_cmu_raster=524559,
image_x_icns=524544, image_fif=524560,
image_x_icon=524545 | 0x80000000, image_florian=524561,
image_x_jg=524546, image_g3fax=524562,
image_x_jps=524547, image_gif=524563,
image_x_ms_bmp=524548, image_heic=524564,
image_x_niff=524549, image_ief=524565,
image_x_pcx=524550, image_jpeg=524566,
image_x_pict=524551, image_jutvision=524567,
image_x_portable_bitmap=524552, image_naplps=524568,
image_x_portable_graymap=524553, image_pict=524569,
image_x_portable_pixmap=524554, image_png=524570,
image_x_quicktime=524555, image_svg=524571 | 0x80000000,
image_x_rgb=524556, image_svg_xml=524572 | 0x80000000,
image_x_tga=524557, image_tiff=524573,
image_x_tiff=524558, image_vnd_adobe_photoshop=524574 | 0x80000000,
image_x_xcf=524559 | 0x80000000, image_vnd_djvu=524575 | 0x80000000,
image_x_xpixmap=524560 | 0x80000000, image_vnd_fpx=524576,
image_x_xwindowdump=524561, image_vnd_microsoft_icon=524577,
message_rfc822=196882, image_vnd_rn_realflash=524578,
model_vnd_dwf=65811, image_vnd_rn_realpix=524579,
model_vnd_gdl=65812, image_vnd_wap_wbmp=524580,
model_vnd_gs_gdl=65813, image_vnd_xiff=524581,
model_vrml=65814, image_webp=524582,
model_x_pov=65815, image_wmf=524583,
text_asp=590104, image_x_3ds=524584,
text_css=590105, image_x_cmu_raster=524585,
text_html=590106, image_x_cur=524586,
text_javascript=590107, image_x_dwg=524587,
text_mcf=590108, image_x_eps=524588,
text_pascal=590109, image_x_exr=524589,
text_plain=590110, image_x_gem=524590,
text_richtext=590111, image_x_icns=524591,
text_scriplet=590112, image_x_icon=524592 | 0x80000000,
text_tab_separated_values=590113, image_x_jg=524593,
text_troff=590114, image_x_jps=524594,
text_uri_list=590115, image_x_ms_bmp=524595,
text_vnd_abc=590116, image_x_niff=524596,
text_vnd_fmi_flexstor=590117, image_x_pcx=524597,
text_vnd_wap_wml=590118, image_x_pict=524598,
text_vnd_wap_wmlscript=590119, image_x_portable_bitmap=524599,
text_webviewhtml=590120, image_x_portable_graymap=524600,
text_x_Algol68=590121, image_x_portable_pixmap=524601,
text_x_asm=590122, image_x_quicktime=524602,
text_x_audiosoft_intra=590123, image_x_rgb=524603,
text_x_awk=590124, image_x_tga=524604,
text_x_bcpl=590125, image_x_tiff=524605,
text_x_c=590126, image_x_win_bitmap=524606,
text_x_c__=590127, image_x_xcf=524607 | 0x80000000,
text_x_component=590128, image_x_xpixmap=524608 | 0x80000000,
text_x_diff=590129, image_x_xwindowdump=524609,
text_x_fortran=590130, message_news=196930,
text_x_java=590131, message_rfc822=196931,
text_x_la_asf=590132, model_vnd_dwf=65860,
text_x_lisp=590133, model_vnd_gdl=65861,
text_x_m=590134, model_vnd_gs_gdl=65862,
text_x_m4=590135, model_vrml=65863,
text_x_makefile=590136, model_x_pov=65864,
text_x_msdos_batch=590137, text_PGP=590153,
text_x_pascal=590138, text_asp=590154,
text_x_perl=590139, text_css=590155,
text_x_php=590140, text_html=590156,
text_x_po=590141, text_javascript=590157,
text_x_python=590142, text_mcf=590158,
text_x_ruby=590143, text_pascal=590159,
text_x_sass=590144, text_plain=590160,
text_x_scss=590145, text_richtext=590161,
text_x_server_parsed_html=590146, text_rtf=590162,
text_x_setext=590147, text_scriplet=590163,
text_x_sgml=590148, text_tab_separated_values=590164,
text_x_shellscript=590149, text_troff=590165,
text_x_speech=590150, text_uri_list=590166,
text_x_tcl=590151, text_vnd_abc=590167,
text_x_tex=590152, text_vnd_fmi_flexstor=590168,
text_x_uil=590153, text_vnd_wap_wml=590169,
text_x_uuencode=590154, text_vnd_wap_wmlscript=590170,
text_x_vcalendar=590155, text_webviewhtml=590171,
text_x_vcard=590156, text_x_Algol68=590172,
text_xml=590157, text_x_asm=590173,
video_animaflex=393550, text_x_audiosoft_intra=590174,
video_avi=393551, text_x_awk=590175,
video_avs_video=393552, text_x_bcpl=590176,
video_mp4=393553, text_x_c=590177,
video_mpeg=393554, text_x_c__=590178,
video_quicktime=393555, text_x_component=590179,
video_vdo=393556, text_x_diff=590180,
video_vivo=393557, text_x_fortran=590181,
video_vnd_rn_realvideo=393558, text_x_java=590182,
video_vosaic=393559, text_x_la_asf=590183,
video_webm=393560, text_x_lisp=590184,
video_x_amt_demorun=393561, text_x_m=590185,
video_x_amt_showrun=393562, text_x_m4=590186,
video_x_atomic3d_feature=393563, text_x_makefile=590187,
video_x_dl=393564, text_x_ms_regedit=590188,
video_x_dv=393565, text_x_msdos_batch=590189,
video_x_fli=393566, text_x_objective_c=590190,
video_x_flv=393567, text_x_pascal=590191,
video_x_isvideo=393568, text_x_perl=590192,
video_x_jng=393569 | 0x80000000, text_x_php=590193,
video_x_matroska=393570, text_x_po=590194,
video_x_mng=393571, text_x_python=590195,
video_x_motion_jpeg=393572, text_x_ruby=590196,
video_x_ms_asf=393573, text_x_sass=590197,
video_x_msvideo=393574, text_x_scss=590198,
video_x_qtc=393575, text_x_server_parsed_html=590199,
video_x_sgi_movie=393576, text_x_setext=590200,
text_x_sgml=590201,
text_x_shellscript=590202,
text_x_speech=590203,
text_x_tcl=590204,
text_x_tex=590205,
text_x_uil=590206,
text_x_uuencode=590207,
text_x_vcalendar=590208,
text_x_vcard=590209,
text_xml=590210,
video_MP2T=393603,
video_animaflex=393604,
video_avi=393605,
video_avs_video=393606,
video_mp4=393607,
video_mpeg=393608,
video_quicktime=393609,
video_vdo=393610,
video_vivo=393611,
video_vnd_rn_realvideo=393612,
video_vosaic=393613,
video_webm=393614,
video_x_amt_demorun=393615,
video_x_amt_showrun=393616,
video_x_atomic3d_feature=393617,
video_x_dl=393618,
video_x_dv=393619,
video_x_fli=393620,
video_x_flv=393621,
video_x_isvideo=393622,
video_x_jng=393623 | 0x80000000,
video_x_m4v=393624,
video_x_matroska=393625,
video_x_mng=393626,
video_x_motion_jpeg=393627,
video_x_ms_asf=393628,
video_x_msvideo=393629,
video_x_qtc=393630,
video_x_sgi_movie=393631,
x_epoc_x_sisx_app=721312,
}; };
char *mime_get_mime_text(unsigned int mime_id) {switch (mime_id) { char *mime_get_mime_text(unsigned int mime_id) {switch (mime_id) {
case application_arj: return "application/arj"; case application_arj: return "application/arj";
@@ -624,6 +680,7 @@ case text_mcf: return "text/mcf";
case text_pascal: return "text/pascal"; case text_pascal: return "text/pascal";
case text_plain: return "text/plain"; case text_plain: return "text/plain";
case text_richtext: return "text/richtext"; case text_richtext: return "text/richtext";
case text_rtf: return "text/rtf";
case text_scriplet: return "text/scriplet"; case text_scriplet: return "text/scriplet";
case text_x_awk: return "text/x-awk"; case text_x_awk: return "text/x-awk";
case video_x_jng: return "video/x-jng"; case video_x_jng: return "video/x-jng";
@@ -728,6 +785,61 @@ case image_x_tga: return "image/x-tga";
case application_x_wine_extension_ini: return "application/x-wine-extension-ini"; case application_x_wine_extension_ini: return "application/x-wine-extension-ini";
case application_x_cbz: return "application/x-cbz"; case application_x_cbz: return "application/x-cbz";
case application_x_cbr: return "application/x-cbr"; case application_x_cbr: return "application/x-cbr";
case application_x_ms_compress_szdd: return "application/x-ms-compress-szdd";
case application_x_atari_7800_rom: return "application/x-atari-7800-rom";
case application_x_nes_rom: return "application/x-nes-rom";
case application_x_font_pfm: return "application/x-font-pfm";
case application_x_gettext_translation: return "application/x-gettext-translation";
case image_wmf: return "image/wmf";
case application_pgp_keys: return "application/pgp-keys";
case image_x_3ds: return "image/x-3ds";
case application_x_lz4: return "application/x-lz4";
case application_vnd_openxmlformats_officedocument_presentationml_presentation: return "application/vnd.openxmlformats-officedocument.presentationml.presentation";
case application_vnd_oasis_opendocument_presentation: return "application/vnd.oasis.opendocument.presentation";
case application_x_msaccess: return "application/x-msaccess";
case application_vnd_oasis_opendocument_spreadsheet: return "application/vnd.oasis.opendocument.spreadsheet";
case audio_x_aiff: return "audio/x-aiff";
case text_x_ms_regedit: return "text/x-ms-regedit";
case application_x_gamecube_rom: return "application/x-gamecube-rom";
case application_x_nintendo_ds_rom: return "application/x-nintendo-ds-rom";
case text_x_objective_c: return "text/x-objective-c";
case application_x_font_gdos: return "application/x-font-gdos";
case application_x_apple_diskimage: return "application/x-apple-diskimage";
case application_x_zstd: return "application/x-zstd";
case video_x_m4v: return "video/x-m4v";
case message_news: return "message/news";
case application_vnd_symbian_install: return "application/vnd.symbian.install";
case application_x_lzh_compressed: return "application/x-lzh-compressed";
case application_x_dosdriver: return "application/x-dosdriver";
case application_vnd_tcpdump_pcap: return "application/vnd.tcpdump.pcap";
case x_epoc_x_sisx_app: return "x-epoc/x-sisx-app";
case application_x_avira_qua: return "application/x-avira-qua";
case video_MP2T: return "video/MP2T";
case application_x_snappy_framed: return "application/x-snappy-framed";
case application_x_lz4_json: return "application/x-lz4+json";
case application_x_dmp: return "application/x-dmp";
case application_zlib: return "application/zlib";
case application_x_pgp_keyring: return "application/x-pgp-keyring";
case application_x_gdbm: return "application/x-gdbm";
case application_x_font_pf2: return "application/x-font-pf2";
case application_x_zip: return "application/x-zip";
case application_x_coredump: return "application/x-coredump";
case application_x_java_jmod: return "application/x-java-jmod";
case application_x_terminfo: return "application/x-terminfo";
case application_x_terminfo2: return "application/x-terminfo2";
case application_x_arc: return "application/x-arc";
case application_vnd_lotus_1_2_3: return "application/vnd.lotus-1-2-3";
case image_x_win_bitmap: return "image/x-win-bitmap";
case application_x_maxis_dbpf: return "application/x-maxis-dbpf";
case text_PGP: return "text/PGP";
case audio_x_hx_aac_adts: return "audio/x-hx-aac-adts";
case application_x_chrome_extension: return "application/x-chrome-extension";
case image_heic: return "image/heic";
case image_x_gem: return "image/x-gem";
case application_x_lzma: return "application/x-lzma";
case application_warc: return "application/warc";
case application_x_lzip: return "application/x-lzip";
case application_x_lzop: return "application/x-lzop";
default: return NULL;}} default: return NULL;}}
GHashTable *mime_get_ext_table() {GHashTable *ext_table = g_hash_table_new(g_str_hash, g_str_equal); GHashTable *mime_get_ext_table() {GHashTable *ext_table = g_hash_table_new(g_str_hash, g_str_equal);
g_hash_table_insert(ext_table, "arj", (gpointer)application_arj); g_hash_table_insert(ext_table, "arj", (gpointer)application_arj);
@@ -857,6 +969,7 @@ g_hash_table_insert(ext_table, "xlt", (gpointer)application_x_excel);
g_hash_table_insert(ext_table, "xlv", (gpointer)application_x_excel); g_hash_table_insert(ext_table, "xlv", (gpointer)application_x_excel);
g_hash_table_insert(ext_table, "exe", (gpointer)application_x_executable); g_hash_table_insert(ext_table, "exe", (gpointer)application_x_executable);
g_hash_table_insert(ext_table, "ttf", (gpointer)application_x_font_ttf); g_hash_table_insert(ext_table, "ttf", (gpointer)application_x_font_ttf);
g_hash_table_insert(ext_table, "ttc", (gpointer)application_x_font_ttf);
g_hash_table_insert(ext_table, "pre", (gpointer)application_x_freelance); g_hash_table_insert(ext_table, "pre", (gpointer)application_x_freelance);
g_hash_table_insert(ext_table, "gsp", (gpointer)application_x_gsp); g_hash_table_insert(ext_table, "gsp", (gpointer)application_x_gsp);
g_hash_table_insert(ext_table, "gss", (gpointer)application_x_gss); g_hash_table_insert(ext_table, "gss", (gpointer)application_x_gss);
@@ -1077,6 +1190,11 @@ g_hash_table_insert(ext_table, "d", (gpointer)text_plain);
g_hash_table_insert(ext_table, "cs", (gpointer)text_plain); g_hash_table_insert(ext_table, "cs", (gpointer)text_plain);
g_hash_table_insert(ext_table, "hpp", (gpointer)text_plain); g_hash_table_insert(ext_table, "hpp", (gpointer)text_plain);
g_hash_table_insert(ext_table, "srt", (gpointer)text_plain); g_hash_table_insert(ext_table, "srt", (gpointer)text_plain);
g_hash_table_insert(ext_table, "nfo", (gpointer)text_plain);
g_hash_table_insert(ext_table, "sfv", (gpointer)text_plain);
g_hash_table_insert(ext_table, "m3u", (gpointer)text_plain);
g_hash_table_insert(ext_table, "csv", (gpointer)text_plain);
g_hash_table_insert(ext_table, "eml", (gpointer)text_plain);
g_hash_table_insert(ext_table, "rt", (gpointer)text_richtext); g_hash_table_insert(ext_table, "rt", (gpointer)text_richtext);
g_hash_table_insert(ext_table, "rtf", (gpointer)text_richtext); g_hash_table_insert(ext_table, "rtf", (gpointer)text_richtext);
g_hash_table_insert(ext_table, "rtx", (gpointer)text_richtext); g_hash_table_insert(ext_table, "rtx", (gpointer)text_richtext);
@@ -1094,7 +1212,7 @@ g_hash_table_insert(ext_table, "ms", (gpointer)text_troff);
g_hash_table_insert(ext_table, "roff", (gpointer)text_troff); g_hash_table_insert(ext_table, "roff", (gpointer)text_troff);
g_hash_table_insert(ext_table, "t", (gpointer)text_troff); g_hash_table_insert(ext_table, "t", (gpointer)text_troff);
g_hash_table_insert(ext_table, "tr", (gpointer)text_troff); g_hash_table_insert(ext_table, "tr", (gpointer)text_troff);
g_hash_table_insert(ext_table, "uni", (gpointer)text_uri_list); g_hash_table_insert(ext_table, "uji", (gpointer)text_uri_list);
g_hash_table_insert(ext_table, "unis", (gpointer)text_uri_list); g_hash_table_insert(ext_table, "unis", (gpointer)text_uri_list);
g_hash_table_insert(ext_table, "uri", (gpointer)text_uri_list); g_hash_table_insert(ext_table, "uri", (gpointer)text_uri_list);
g_hash_table_insert(ext_table, "uris", (gpointer)text_uri_list); g_hash_table_insert(ext_table, "uris", (gpointer)text_uri_list);
@@ -1175,6 +1293,7 @@ g_hash_table_insert(ext_table, "isu", (gpointer)video_x_isvideo);
g_hash_table_insert(ext_table, "mjpg", (gpointer)video_x_motion_jpeg); g_hash_table_insert(ext_table, "mjpg", (gpointer)video_x_motion_jpeg);
g_hash_table_insert(ext_table, "asf", (gpointer)video_x_ms_asf); g_hash_table_insert(ext_table, "asf", (gpointer)video_x_ms_asf);
g_hash_table_insert(ext_table, "asx", (gpointer)video_x_ms_asf); g_hash_table_insert(ext_table, "asx", (gpointer)video_x_ms_asf);
g_hash_table_insert(ext_table, "wmv", (gpointer)video_x_ms_asf);
g_hash_table_insert(ext_table, "qtc", (gpointer)video_x_qtc); g_hash_table_insert(ext_table, "qtc", (gpointer)video_x_qtc);
g_hash_table_insert(ext_table, "movie", (gpointer)video_x_sgi_movie); g_hash_table_insert(ext_table, "movie", (gpointer)video_x_sgi_movie);
g_hash_table_insert(ext_table, "mv", (gpointer)video_x_sgi_movie); g_hash_table_insert(ext_table, "mv", (gpointer)video_x_sgi_movie);
@@ -1207,6 +1326,32 @@ g_hash_table_insert(ext_table, "vcf", (gpointer)text_x_vcard);
g_hash_table_insert(ext_table, "hlp", (gpointer)application_winhelp); g_hash_table_insert(ext_table, "hlp", (gpointer)application_winhelp);
g_hash_table_insert(ext_table, "cbz", (gpointer)application_x_cbz); g_hash_table_insert(ext_table, "cbz", (gpointer)application_x_cbz);
g_hash_table_insert(ext_table, "cbr", (gpointer)application_x_cbr); g_hash_table_insert(ext_table, "cbr", (gpointer)application_x_cbr);
g_hash_table_insert(ext_table, "fon", (gpointer)application_x_ms_compress_szdd);
g_hash_table_insert(ext_table, "a78", (gpointer)application_x_atari_7800_rom);
g_hash_table_insert(ext_table, "nes", (gpointer)application_x_nes_rom);
g_hash_table_insert(ext_table, "pfm", (gpointer)application_x_font_pfm);
g_hash_table_insert(ext_table, "3ds", (gpointer)image_x_3ds);
g_hash_table_insert(ext_table, "lz4", (gpointer)application_x_lz4);
g_hash_table_insert(ext_table, "pptx", (gpointer)application_vnd_openxmlformats_officedocument_presentationml_presentation);
g_hash_table_insert(ext_table, "odp", (gpointer)application_vnd_oasis_opendocument_presentation);
g_hash_table_insert(ext_table, "accdb", (gpointer)application_x_msaccess);
g_hash_table_insert(ext_table, "ods", (gpointer)application_vnd_oasis_opendocument_spreadsheet);
g_hash_table_insert(ext_table, "aiff", (gpointer)audio_x_aiff);
g_hash_table_insert(ext_table, "aif", (gpointer)audio_x_aiff);
g_hash_table_insert(ext_table, "reg", (gpointer)text_x_ms_regedit);
g_hash_table_insert(ext_table, "zst", (gpointer)application_x_zstd);
g_hash_table_insert(ext_table, "m4v", (gpointer)video_x_m4v);
g_hash_table_insert(ext_table, "pcap", (gpointer)application_vnd_tcpdump_pcap);
g_hash_table_insert(ext_table, "jsonlz4", (gpointer)application_x_lz4_json);
g_hash_table_insert(ext_table, "dmp", (gpointer)application_x_dmp);
g_hash_table_insert(ext_table, "z", (gpointer)application_zlib);
g_hash_table_insert(ext_table, "pf2", (gpointer)application_x_font_pf2);
g_hash_table_insert(ext_table, "jmod", (gpointer)application_x_java_jmod);
g_hash_table_insert(ext_table, "heic", (gpointer)image_heic);
g_hash_table_insert(ext_table, "lzma", (gpointer)application_x_lzma);
g_hash_table_insert(ext_table, "warc", (gpointer)application_warc);
g_hash_table_insert(ext_table, "lz", (gpointer)application_x_lzip);
g_hash_table_insert(ext_table, "lzo", (gpointer)application_x_lzop);
return ext_table;} return ext_table;}
GHashTable *mime_get_mime_table() {GHashTable *mime_table = g_hash_table_new(g_str_hash, g_str_equal); GHashTable *mime_get_mime_table() {GHashTable *mime_table = g_hash_table_new(g_str_hash, g_str_equal);
g_hash_table_insert(mime_table, "application/arj", (gpointer)application_arj); g_hash_table_insert(mime_table, "application/arj", (gpointer)application_arj);
@@ -1465,6 +1610,7 @@ g_hash_table_insert(mime_table, "text/mcf", (gpointer)text_mcf);
g_hash_table_insert(mime_table, "text/pascal", (gpointer)text_pascal); g_hash_table_insert(mime_table, "text/pascal", (gpointer)text_pascal);
g_hash_table_insert(mime_table, "text/plain", (gpointer)text_plain); g_hash_table_insert(mime_table, "text/plain", (gpointer)text_plain);
g_hash_table_insert(mime_table, "text/richtext", (gpointer)text_richtext); g_hash_table_insert(mime_table, "text/richtext", (gpointer)text_richtext);
g_hash_table_insert(mime_table, "text/rtf", (gpointer)text_rtf);
g_hash_table_insert(mime_table, "text/scriplet", (gpointer)text_scriplet); g_hash_table_insert(mime_table, "text/scriplet", (gpointer)text_scriplet);
g_hash_table_insert(mime_table, "text/x-awk", (gpointer)text_x_awk); g_hash_table_insert(mime_table, "text/x-awk", (gpointer)text_x_awk);
g_hash_table_insert(mime_table, "video/x-jng", (gpointer)video_x_jng); g_hash_table_insert(mime_table, "video/x-jng", (gpointer)video_x_jng);
@@ -1569,5 +1715,60 @@ g_hash_table_insert(mime_table, "image/x-tga", (gpointer)image_x_tga);
g_hash_table_insert(mime_table, "application/x-wine-extension-ini", (gpointer)application_x_wine_extension_ini); g_hash_table_insert(mime_table, "application/x-wine-extension-ini", (gpointer)application_x_wine_extension_ini);
g_hash_table_insert(mime_table, "application/x-cbz", (gpointer)application_x_cbz); g_hash_table_insert(mime_table, "application/x-cbz", (gpointer)application_x_cbz);
g_hash_table_insert(mime_table, "application/x-cbr", (gpointer)application_x_cbr); g_hash_table_insert(mime_table, "application/x-cbr", (gpointer)application_x_cbr);
g_hash_table_insert(mime_table, "application/x-ms-compress-szdd", (gpointer)application_x_ms_compress_szdd);
g_hash_table_insert(mime_table, "application/x-atari-7800-rom", (gpointer)application_x_atari_7800_rom);
g_hash_table_insert(mime_table, "application/x-nes-rom", (gpointer)application_x_nes_rom);
g_hash_table_insert(mime_table, "application/x-font-pfm", (gpointer)application_x_font_pfm);
g_hash_table_insert(mime_table, "application/x-gettext-translation", (gpointer)application_x_gettext_translation);
g_hash_table_insert(mime_table, "image/wmf", (gpointer)image_wmf);
g_hash_table_insert(mime_table, "application/pgp-keys", (gpointer)application_pgp_keys);
g_hash_table_insert(mime_table, "image/x-3ds", (gpointer)image_x_3ds);
g_hash_table_insert(mime_table, "application/x-lz4", (gpointer)application_x_lz4);
g_hash_table_insert(mime_table, "application/vnd.openxmlformats-officedocument.presentationml.presentation", (gpointer)application_vnd_openxmlformats_officedocument_presentationml_presentation);
g_hash_table_insert(mime_table, "application/vnd.oasis.opendocument.presentation", (gpointer)application_vnd_oasis_opendocument_presentation);
g_hash_table_insert(mime_table, "application/x-msaccess", (gpointer)application_x_msaccess);
g_hash_table_insert(mime_table, "application/vnd.oasis.opendocument.spreadsheet", (gpointer)application_vnd_oasis_opendocument_spreadsheet);
g_hash_table_insert(mime_table, "audio/x-aiff", (gpointer)audio_x_aiff);
g_hash_table_insert(mime_table, "text/x-ms-regedit", (gpointer)text_x_ms_regedit);
g_hash_table_insert(mime_table, "application/x-gamecube-rom", (gpointer)application_x_gamecube_rom);
g_hash_table_insert(mime_table, "application/x-nintendo-ds-rom", (gpointer)application_x_nintendo_ds_rom);
g_hash_table_insert(mime_table, "text/x-objective-c", (gpointer)text_x_objective_c);
g_hash_table_insert(mime_table, "application/x-font-gdos", (gpointer)application_x_font_gdos);
g_hash_table_insert(mime_table, "application/x-apple-diskimage", (gpointer)application_x_apple_diskimage);
g_hash_table_insert(mime_table, "application/x-zstd", (gpointer)application_x_zstd);
g_hash_table_insert(mime_table, "video/x-m4v", (gpointer)video_x_m4v);
g_hash_table_insert(mime_table, "message/news", (gpointer)message_news);
g_hash_table_insert(mime_table, "application/vnd.symbian.install", (gpointer)application_vnd_symbian_install);
g_hash_table_insert(mime_table, "application/x-lzh-compressed", (gpointer)application_x_lzh_compressed);
g_hash_table_insert(mime_table, "application/x-dosdriver", (gpointer)application_x_dosdriver);
g_hash_table_insert(mime_table, "application/vnd.tcpdump.pcap", (gpointer)application_vnd_tcpdump_pcap);
g_hash_table_insert(mime_table, "x-epoc/x-sisx-app", (gpointer)x_epoc_x_sisx_app);
g_hash_table_insert(mime_table, "application/x-avira-qua", (gpointer)application_x_avira_qua);
g_hash_table_insert(mime_table, "video/MP2T", (gpointer)video_MP2T);
g_hash_table_insert(mime_table, "application/x-snappy-framed", (gpointer)application_x_snappy_framed);
g_hash_table_insert(mime_table, "application/x-lz4+json", (gpointer)application_x_lz4_json);
g_hash_table_insert(mime_table, "application/x-dmp", (gpointer)application_x_dmp);
g_hash_table_insert(mime_table, "application/zlib", (gpointer)application_zlib);
g_hash_table_insert(mime_table, "application/x-pgp-keyring", (gpointer)application_x_pgp_keyring);
g_hash_table_insert(mime_table, "application/x-gdbm", (gpointer)application_x_gdbm);
g_hash_table_insert(mime_table, "application/x-font-pf2", (gpointer)application_x_font_pf2);
g_hash_table_insert(mime_table, "application/x-zip", (gpointer)application_x_zip);
g_hash_table_insert(mime_table, "application/x-coredump", (gpointer)application_x_coredump);
g_hash_table_insert(mime_table, "application/x-java-jmod", (gpointer)application_x_java_jmod);
g_hash_table_insert(mime_table, "application/x-terminfo", (gpointer)application_x_terminfo);
g_hash_table_insert(mime_table, "application/x-terminfo2", (gpointer)application_x_terminfo2);
g_hash_table_insert(mime_table, "application/x-arc", (gpointer)application_x_arc);
g_hash_table_insert(mime_table, "application/vnd.lotus-1-2-3", (gpointer)application_vnd_lotus_1_2_3);
g_hash_table_insert(mime_table, "image/x-win-bitmap", (gpointer)image_x_win_bitmap);
g_hash_table_insert(mime_table, "application/x-maxis-dbpf", (gpointer)application_x_maxis_dbpf);
g_hash_table_insert(mime_table, "text/PGP", (gpointer)text_PGP);
g_hash_table_insert(mime_table, "audio/x-hx-aac-adts", (gpointer)audio_x_hx_aac_adts);
g_hash_table_insert(mime_table, "application/x-chrome-extension", (gpointer)application_x_chrome_extension);
g_hash_table_insert(mime_table, "image/heic", (gpointer)image_heic);
g_hash_table_insert(mime_table, "image/x-gem", (gpointer)image_x_gem);
g_hash_table_insert(mime_table, "application/x-lzma", (gpointer)application_x_lzma);
g_hash_table_insert(mime_table, "application/warc", (gpointer)application_warc);
g_hash_table_insert(mime_table, "application/x-lzip", (gpointer)application_x_lzip);
g_hash_table_insert(mime_table, "application/x-lzop", (gpointer)application_x_lzop);
return mime_table;} return mime_table;}
#endif #endif

View File

@@ -1,9 +1,30 @@
#include "src/sist.h" #include "src/sist.h"
#include "src/ctx.h" #include "src/ctx.h"
__thread magic_t Magic; __thread magic_t Magic = NULL;
void *read_all(parse_job_t *job, const char *buf, int bytes_read, int *fd) { int fs_read(struct vfile *f, void *buf, size_t size) {
if (f->fd == -1) {
f->fd = open(f->filepath, O_RDONLY);
if (f->fd == -1) {
LOG_ERRORF(f->filepath, "open(): [%d] %s", errno, strerror(errno))
return -1;
}
}
return read(f->fd, buf, size);
}
#define CLOSE_FILE(f) if (f.close != NULL) {f.close(&f);};
void fs_close(struct vfile *f) {
if (f->fd != -1) {
close(f->fd);
}
}
void *read_all(parse_job_t *job, const char *buf, int bytes_read) {
void *full_buf; void *full_buf;
@@ -11,20 +32,13 @@ void *read_all(parse_job_t *job, const char *buf, int bytes_read, int *fd) {
full_buf = malloc(job->info.st_size); full_buf = malloc(job->info.st_size);
memcpy(full_buf, buf, job->info.st_size); memcpy(full_buf, buf, job->info.st_size);
} else { } else {
if (*fd == -1) {
*fd = open(job->filepath, O_RDONLY);
if (*fd == -1) {
perror("open");
printf("%s\n", job->filepath);
free(job);
return NULL;
}
}
full_buf = malloc(job->info.st_size); full_buf = malloc(job->info.st_size);
memcpy(full_buf, buf, bytes_read); memcpy(full_buf, buf, bytes_read);
int ret = read(*fd, full_buf + bytes_read, job->info.st_size - bytes_read);
if (ret == -1) { int ret = job->vfile.read(&job->vfile, full_buf + bytes_read, job->info.st_size - bytes_read);
perror("read"); if (ret < 0) {
LOG_ERRORF(job->filepath, "read(): [%d] %s", errno, strerror(errno))
return NULL;
} }
} }
@@ -36,9 +50,9 @@ void parse(void *arg) {
parse_job_t *job = arg; parse_job_t *job = arg;
document_t doc; document_t doc;
if (incremental_get(ScanCtx.original_table, job->info.st_ino) == job->info.st_mtim.tv_sec) { int inc_ts = incremental_get(ScanCtx.original_table, job->info.st_ino);
if (inc_ts != 0 && inc_ts == job->info.st_mtim.tv_sec) {
incremental_mark_file_for_copy(ScanCtx.copy_table, job->info.st_ino); incremental_mark_file_for_copy(ScanCtx.copy_table, job->info.st_ino);
free(job);
return; return;
} }
@@ -60,67 +74,109 @@ void parse(void *arg) {
uuid_generate(doc.uuid); uuid_generate(doc.uuid);
char *buf[PARSE_BUF_SIZE]; char *buf[PARSE_BUF_SIZE];
if (LogCtx.very_verbose) {
char uuid_str[UUID_STR_LEN];
uuid_unparse(doc.uuid, uuid_str);
LOG_DEBUGF(job->filepath, "Starting parse job {%s}", uuid_str)
}
if (job->info.st_size == 0) { if (job->info.st_size == 0) {
doc.mime = MIME_EMPTY; doc.mime = MIME_EMPTY;
} else if (*(job->filepath + job->ext) != '\0') { } else if (*(job->filepath + job->ext) != '\0' && (job->ext - job->base != 1)) {
doc.mime = mime_get_mime_by_ext(ScanCtx.ext_table, job->filepath + job->ext); doc.mime = mime_get_mime_by_ext(ScanCtx.ext_table, job->filepath + job->ext);
} }
int fd = -1;
int bytes_read = 0; int bytes_read = 0;
if (doc.mime == 0) { if (doc.mime == 0 && !ScanCtx.fast) {
// Get mime type with libmagic // Get mime type with libmagic
fd = open(job->filepath, O_RDONLY); bytes_read = job->vfile.read(&job->vfile, buf, PARSE_BUF_SIZE);
if (fd == -1) { if (bytes_read < 0) {
perror("open"); LOG_WARNINGF(job->filepath, "read() Error: %s", strerror(errno))
free(job); CLOSE_FILE(job->vfile)
return; return;
} }
bytes_read = read(fd, buf, PARSE_BUF_SIZE);
const char *magic_mime_str = magic_buffer(Magic, buf, bytes_read); const char *magic_mime_str = magic_buffer(Magic, buf, bytes_read);
if (magic_mime_str != NULL) { if (magic_mime_str != NULL) {
doc.mime = mime_get_mime_by_string(ScanCtx.mime_table, magic_mime_str); doc.mime = mime_get_mime_by_string(ScanCtx.mime_table, magic_mime_str);
LOG_DEBUGF(job->filepath, "libmagic: %s", magic_mime_str);
if (doc.mime == 0) { if (doc.mime == 0) {
fprintf(stderr, "Couldn't find mime %s, %s!\n", magic_mime_str, job->filepath + job->base); LOG_WARNINGF(job->filepath, "Couldn't find mime %s", magic_mime_str);
} }
} }
magic_close(Magic);
Magic = NULL;
} }
int mmime = MAJOR_MIME(doc.mime); int mmime = MAJOR_MIME(doc.mime);
if (!(SHOULD_PARSE(doc.mime))) { if (!(SHOULD_PARSE(doc.mime))) {
} else if ((mmime == MimeVideo && doc.size >= MIN_VIDEO_SIZE) || mmime == MimeAudio || mmime == MimeImage) { } else if ((mmime == MimeVideo && doc.size >= MIN_VIDEO_SIZE) ||
parse_media(job->filepath, &doc); (mmime == MimeImage && doc.size >= MIN_IMAGE_SIZE) || mmime == MimeAudio) {
// if (job->vfile.is_fs_file) {
// parse_media_filename(job->filepath, &doc);
// } else {
// parse_media_vfile(&job->vfile, &doc);
// }
} else if (IS_PDF(doc.mime)) { } else if (IS_PDF(doc.mime)) {
void *pdf_buf = read_all(job, (char *) buf, bytes_read, &fd); void *pdf_buf = read_all(job, (char *) buf, bytes_read);
parse_pdf(pdf_buf, doc.size, &doc); parse_pdf(pdf_buf, doc.size, &doc);
if (pdf_buf != buf) { if (pdf_buf != buf && pdf_buf != NULL) {
free(pdf_buf); free(pdf_buf);
} }
} else if (mmime == MimeText && ScanCtx.content_size > 0) { } else if (mmime == MimeText && ScanCtx.content_size > 0) {
parse_text(bytes_read, &fd, (char *) buf, &doc); parse_text(bytes_read, &job->vfile, (char *) buf, &doc);
} else if (IS_FONT(doc.mime)) { } else if (IS_FONT(doc.mime)) {
void *font_buf = read_all(job, (char *) buf, bytes_read, &fd); void *font_buf = read_all(job, (char *) buf, bytes_read);
parse_font(font_buf, doc.size, &doc); parse_font(font_buf, doc.size, &doc);
if (font_buf != buf) { if (font_buf != buf && font_buf != NULL) {
free(font_buf); free(font_buf);
} }
} else if (
ScanCtx.archive_mode != ARC_MODE_SKIP && (
IS_ARC(doc.mime) ||
(IS_ARC_FILTER(doc.mime) && should_parse_filtered_file(doc.filepath, doc.ext))
)) {
parse_archive(&job->vfile, &doc);
} else if (ScanCtx.content_size > 0 && IS_DOC(doc.mime)) {
void *doc_buf = read_all(job, (char *) buf, bytes_read);
parse_doc(doc_buf, doc.size, &doc);
if (doc_buf != buf && doc_buf != NULL) {
free(doc_buf);
}
} else if (is_cbr(doc.mime)) {
void *cbr_buf = read_all(job, (char *) buf, bytes_read);
parse_cbr(cbr_buf, doc.size, &doc);
if (cbr_buf != buf && cbr_buf != NULL) {
free(cbr_buf);
}
}
//Parent meta
if (!uuid_is_null(job->parent)) {
char tmp[UUID_STR_LEN];
uuid_unparse(job->parent, tmp);
meta_line_t *meta_parent = malloc(sizeof(meta_line_t) + UUID_STR_LEN + 1);
meta_parent->key = MetaParent;
strcpy(meta_parent->strval, tmp);
APPEND_META((&doc), meta_parent)
} }
write_document(&doc); write_document(&doc);
if (fd != -1) { CLOSE_FILE(job->vfile)
close(fd);
}
free(job);
} }

View File

@@ -5,6 +5,9 @@
#define PARSE_BUF_SIZE 4096 #define PARSE_BUF_SIZE 4096
int fs_read(struct vfile *f, void *buf, size_t size);
void fs_close(struct vfile *f);
void parse(void *arg); void parse(void *arg);
#endif #endif

View File

@@ -1,10 +1,29 @@
#include <src/ctx.h>
#include "pdf.h" #include "pdf.h"
#include "src/ctx.h" #include "src/ctx.h"
fz_page *render_cover(fz_context *ctx, document_t *doc, fz_document *fzdoc) { #define MIN_OCR_SIZE 350
#define MIN_OCR_LEN 10
__thread text_buffer_t thread_buffer;
int render_cover(fz_context *ctx, document_t *doc, fz_document *fzdoc) {
int err = 0;
fz_page *cover = NULL;
fz_var(cover);
fz_var(err);
fz_try(ctx)
cover = fz_load_page(ctx, fzdoc, 0);
fz_catch(ctx)
err = 1;
if (err != 0) {
fz_drop_page(ctx, cover);
LOG_WARNINGF(doc->filepath, "fz_load_page() returned error code [%d] %s", err, ctx->error.message)
return FALSE;
}
fz_page *cover = fz_load_page(ctx, fzdoc, 0);
fz_rect bounds = fz_bound_page(ctx, cover); fz_rect bounds = fz_bound_page(ctx, cover);
float scale; float scale;
@@ -24,128 +43,289 @@ fz_page *render_cover(fz_context *ctx, document_t *doc, fz_document *fzdoc) {
fz_clear_pixmap_with_value(ctx, pixmap, 0xFF); fz_clear_pixmap_with_value(ctx, pixmap, 0xFF);
fz_device *dev = fz_new_draw_device(ctx, m, pixmap); fz_device *dev = fz_new_draw_device(ctx, m, pixmap);
pthread_mutex_lock(&ScanCtx.mupdf_mu); fz_var(err);
fz_try(ctx) fz_try(ctx)
{
pthread_mutex_lock(&ScanCtx.mupdf_mu);
fz_run_page(ctx, cover, dev, fz_identity, NULL); fz_run_page(ctx, cover, dev, fz_identity, NULL);
}
fz_always(ctx) fz_always(ctx)
{
fz_close_device(ctx, dev);
fz_drop_device(ctx, dev);
pthread_mutex_unlock(&ScanCtx.mupdf_mu); pthread_mutex_unlock(&ScanCtx.mupdf_mu);
}
fz_catch(ctx) fz_catch(ctx)
fz_rethrow(ctx); err = ctx->error.errcode;
fz_drop_device(ctx, dev); if (err != 0) {
LOG_WARNINGF(doc->filepath, "fz_run_page() returned error code [%d] %s", err, ctx->error.message)
fz_drop_page(ctx, cover);
fz_drop_pixmap(ctx, pixmap);
return FALSE;
}
fz_buffer *fzbuf = fz_new_buffer_from_pixmap_as_png(ctx, pixmap, fz_default_color_params); fz_buffer *fzbuf = NULL;
unsigned char *tn_buf; fz_var(fzbuf);
size_t tn_len = fz_buffer_storage(ctx, fzbuf, &tn_buf); fz_var(err);
store_write(ScanCtx.index.store, (char *) doc->uuid, sizeof(doc->uuid), (char *) tn_buf, tn_len); fz_try(ctx)
fzbuf = fz_new_buffer_from_pixmap_as_png(ctx, pixmap, fz_default_color_params);
fz_catch(ctx)
err = ctx->error.errcode;
if (err == 0) {
unsigned char *tn_buf;
size_t tn_len = fz_buffer_storage(ctx, fzbuf, &tn_buf);
store_write(ScanCtx.index.store, (char *) doc->uuid, sizeof(doc->uuid), (char *) tn_buf, tn_len);
}
fz_drop_pixmap(ctx, pixmap);
fz_drop_buffer(ctx, fzbuf); fz_drop_buffer(ctx, fzbuf);
fz_drop_pixmap(ctx, pixmap);
fz_drop_page(ctx, cover);
return cover; if (err != 0) {
LOG_WARNINGF(doc->filepath, "fz_new_buffer_from_pixmap_as_png() returned error code [%d] %s", err,
ctx->error.message)
return FALSE;
}
return TRUE;
} }
void fz_noop_callback(__attribute__((unused)) void *user, __attribute__((unused)) const char *message) {} void fz_err_callback(void *user, UNUSED(const char *message)) {
if (LogCtx.verbose) {
document_t *doc = (document_t *) user;
LOG_WARNINGF(doc->filepath, "FZ: %s", message)
}
}
__always_inline
static void init_ctx(fz_context *ctx, document_t *doc) {
fz_disable_icc(ctx);
fz_register_document_handlers(ctx);
ctx->warn.print_user = doc;
ctx->warn.print = fz_err_callback;
ctx->error.print_user = doc;
ctx->error.print = fz_err_callback;
}
__always_inline
static int read_stext_block(fz_stext_block *block, text_buffer_t *tex) {
if (block->type != FZ_STEXT_BLOCK_TEXT) {
return 0;
}
fz_stext_line *line = block->u.t.first_line;
while (line != NULL) {
fz_stext_char *c = line->first_char;
while (c != NULL) {
if (text_buffer_append_char(tex, c->c) == TEXT_BUF_FULL) {
return TEXT_BUF_FULL;
}
c = c->next;
}
line = line->next;
}
return 0;
}
#define IS_VALID_BPP(d) (d==1 || d==2 || d==4 || d==8 || d==16 || d==24 || d==32)
void fill_image(fz_context *ctx, UNUSED(fz_device *dev),
fz_image *img, UNUSED(fz_matrix ctm), UNUSED(float alpha),
UNUSED(fz_color_params color_params)) {
int l2factor = 0;
if (img->w > MIN_OCR_SIZE && img->h > MIN_OCR_SIZE && IS_VALID_BPP(img->n)) {
fz_pixmap *pix = img->get_pixmap(ctx, img, NULL, img->w, img->h, &l2factor);
if (pix->h > MIN_OCR_SIZE && img->h > MIN_OCR_SIZE && img->xres != 0) {
TessBaseAPI *api = TessBaseAPICreate();
TessBaseAPIInit3(api, ScanCtx.tesseract_path, ScanCtx.tesseract_lang);
TessBaseAPISetImage(api, pix->samples, pix->w, pix->h, pix->n, pix->stride);
TessBaseAPISetSourceResolution(api, pix->xres);
char *text = TessBaseAPIGetUTF8Text(api);
size_t len = strlen(text);
if (len >= MIN_OCR_LEN) {
text_buffer_append_string(&thread_buffer, text, len - 1);
LOG_DEBUGF(
"pdf.c",
"(OCR) %dx%d got %dB from tesseract (%s), buffer:%dB",
pix->w, pix->h, len, ScanCtx.tesseract_lang, thread_buffer.dyn_buffer.cur
)
}
TessBaseAPIEnd(api);
TessBaseAPIDelete(api);
}
fz_drop_pixmap(ctx, pix);
}
}
void parse_pdf(void *buf, size_t buf_len, document_t *doc) { void parse_pdf(void *buf, size_t buf_len, document_t *doc) {
if (buf == NULL) {
return;
}
static int mu_is_initialized = 0; static int mu_is_initialized = 0;
if (!mu_is_initialized) { if (!mu_is_initialized) {
pthread_mutex_init(&ScanCtx.mupdf_mu, NULL); pthread_mutex_init(&ScanCtx.mupdf_mu, NULL);
mu_is_initialized = 1; mu_is_initialized = 1;
} }
fz_context *ctx = fz_new_context(NULL, NULL, FZ_STORE_UNLIMITED); fz_context *ctx = fz_new_context(NULL, NULL, FZ_STORE_UNLIMITED);
fz_stream *stream = NULL;
fz_document *fzdoc = NULL;
fz_var(stream); init_ctx(ctx, doc);
int err = 0;
fz_document *fzdoc = NULL;
fz_stream *stream = NULL;
fz_var(fzdoc); fz_var(fzdoc);
fz_var(stream);
fz_var(err);
fz_try(ctx) fz_try(ctx)
{ {
fz_disable_icc(ctx);
fz_register_document_handlers(ctx);
//disable warnings
ctx->warn.print = fz_noop_callback;
ctx->error.print = fz_noop_callback;
stream = fz_open_memory(ctx, buf, buf_len); stream = fz_open_memory(ctx, buf, buf_len);
fzdoc = fz_open_document_with_stream(ctx, mime_get_mime_text(doc->mime), stream); fzdoc = fz_open_document_with_stream(ctx, mime_get_mime_text(doc->mime), stream);
}
fz_catch(ctx)
err = ctx->error.errcode;
int page_count = fz_count_pages(ctx, fzdoc); if (err != 0) {
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
return;
}
fz_page *cover = render_cover(ctx, doc, fzdoc); char title[4096] = {'\0',};
fz_try(ctx)
fz_lookup_metadata(ctx, fzdoc, FZ_META_INFO_TITLE, title, sizeof(title));
fz_catch(ctx)
;
fz_stext_options opts; if (strlen(title) > 0) {
meta_line_t *meta_content = malloc(sizeof(meta_line_t) + strlen(title));
meta_content->key = MetaTitle;
strcpy(meta_content->strval, title);
APPEND_META(doc, meta_content)
}
text_buffer_t text_buf = text_buffer_create(ScanCtx.content_size); int page_count = -1;
fz_var(err);
fz_try(ctx)
page_count = fz_count_pages(ctx, fzdoc);
fz_catch(ctx)
err = ctx->error.errcode;
if (err) {
LOG_WARNINGF(doc->filepath, "fz_count_pages() returned error code [%d] %s", err, ctx->error.message)
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
return;
}
if (ScanCtx.tn_size > 0) {
err = render_cover(ctx, doc, fzdoc);
}
if (err == TRUE) {
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
return;
}
if (ScanCtx.content_size > 0) {
fz_stext_options opts = {0};
thread_buffer = text_buffer_create(ScanCtx.content_size);
for (int current_page = 0; current_page < page_count; current_page++) { for (int current_page = 0; current_page < page_count; current_page++) {
fz_page *page; fz_page *page = NULL;
if (current_page == 0) { fz_var(err);
page = cover; fz_try(ctx)
} else {
page = fz_load_page(ctx, fzdoc, current_page); page = fz_load_page(ctx, fzdoc, current_page);
fz_catch(ctx)
err = ctx->error.errcode;
if (err != 0) {
LOG_WARNINGF(doc->filepath, "fz_load_page() returned error code [%d] %s", err, ctx->error.message)
text_buffer_destroy(&thread_buffer);
fz_drop_page(ctx, page);
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
return;
} }
fz_stext_page *stext = fz_new_stext_page(ctx, fz_bound_page(ctx, page)); fz_stext_page *stext = fz_new_stext_page(ctx, fz_bound_page(ctx, page));
fz_device *dev = fz_new_stext_device(ctx, stext, &opts); fz_device *dev = fz_new_stext_device(ctx, stext, &opts);
dev->stroke_path = NULL;
dev->stroke_text = NULL;
dev->clip_text = NULL;
dev->clip_stroke_path = NULL;
dev->clip_stroke_text = NULL;
pthread_mutex_lock(&ScanCtx.mupdf_mu); if (ScanCtx.tesseract_lang != NULL) {
dev->fill_image = fill_image;
}
fz_var(err);
fz_try(ctx) fz_try(ctx)
fz_run_page_contents(ctx, page, dev, fz_identity, NULL); fz_run_page(ctx, page, dev, fz_identity, NULL);
fz_always(ctx) fz_always(ctx)
pthread_mutex_unlock(&ScanCtx.mupdf_mu); {
fz_close_device(ctx, dev);
fz_drop_device(ctx, dev);
}
fz_catch(ctx) fz_catch(ctx)
fz_rethrow(ctx); err = ctx->error.errcode;
fz_drop_device(ctx, dev); if (err != 0) {
LOG_WARNINGF(doc->filepath, "fz_run_page() returned error code [%d] %s", err, ctx->error.message)
text_buffer_destroy(&thread_buffer);
fz_drop_page(ctx, page);
fz_drop_stext_page(ctx, stext);
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
return;
}
fz_stext_block *block = stext->first_block; fz_stext_block *block = stext->first_block;
while (block != NULL) { while (block != NULL) {
int ret = read_stext_block(block, &thread_buffer);
if (block->type != FZ_STEXT_BLOCK_TEXT) { if (ret == TEXT_BUF_FULL) {
block = block->next; break;
continue;
}
fz_stext_line *line = block->u.t.first_line;
while (line != NULL) {
fz_stext_char *c = line->first_char;
while (c != NULL) {
if (text_buffer_append_char(&text_buf, c->c) == TEXT_BUF_FULL) {
fz_drop_page(ctx, page);
fz_drop_stext_page(ctx, stext);
goto write_loop_end;
}
c = c->next;
}
line = line->next;
} }
block = block->next; block = block->next;
} }
fz_drop_page(ctx, page);
fz_drop_stext_page(ctx, stext); fz_drop_stext_page(ctx, stext);
fz_drop_page(ctx, page);
if (thread_buffer.dyn_buffer.cur >= thread_buffer.dyn_buffer.size) {
break;
}
} }
write_loop_end:; text_buffer_terminate_string(&thread_buffer);
text_buffer_terminate_string(&text_buf);
meta_line_t *meta_content = malloc(sizeof(meta_line_t) + text_buf.dyn_buffer.cur); meta_line_t *meta_content = malloc(sizeof(meta_line_t) + thread_buffer.dyn_buffer.cur);
meta_content->key = MetaContent; meta_content->key = MetaContent;
memcpy(meta_content->strval, text_buf.dyn_buffer.buf, text_buf.dyn_buffer.cur); memcpy(meta_content->strval, thread_buffer.dyn_buffer.buf, thread_buffer.dyn_buffer.cur);
text_buffer_destroy(&text_buf);
APPEND_META(doc, meta_content) APPEND_META(doc, meta_content)
}
fz_always(ctx)
{
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
} fz_catch(ctx) {
fprintf(stderr, "Error %s %s\n", doc->filepath, ctx->error.message);
}
}
text_buffer_destroy(&thread_buffer);
}
fz_drop_stream(ctx, stream);
fz_drop_document(ctx, fzdoc);
fz_drop_context(ctx);
}

View File

@@ -1,7 +1,7 @@
#include "text.h" #include "text.h"
#include "src/ctx.h" #include "src/ctx.h"
void parse_text(int bytes_read, int *fd, char *buf, document_t *doc) { void parse_text(int bytes_read, struct vfile *f, char *buf, document_t *doc) {
char *intermediate_buf; char *intermediate_buf;
int intermediate_buf_len; int intermediate_buf_len;
@@ -13,10 +13,6 @@ void parse_text(int bytes_read, int *fd, char *buf, document_t *doc) {
memcpy(intermediate_buf, buf, to_copy); memcpy(intermediate_buf, buf, to_copy);
} else { } else {
if (*fd == -1) {
*fd = open(doc->filepath, O_RDONLY);
}
int to_read = MIN(ScanCtx.content_size, doc->size) - bytes_read; int to_read = MIN(ScanCtx.content_size, doc->size) - bytes_read;
intermediate_buf = malloc(to_read + bytes_read); intermediate_buf = malloc(to_read + bytes_read);
@@ -25,19 +21,17 @@ void parse_text(int bytes_read, int *fd, char *buf, document_t *doc) {
memcpy(intermediate_buf, buf, bytes_read); memcpy(intermediate_buf, buf, bytes_read);
} }
read(*fd, intermediate_buf + bytes_read, to_read); f->read(f, intermediate_buf + bytes_read, to_read);
} }
text_buffer_t tex = text_buffer_create(ScanCtx.content_size);
text_buffer_append_string(&tex, intermediate_buf, intermediate_buf_len);
text_buffer_terminate_string(&tex);
text_buffer_t text_buf = text_buffer_create(ScanCtx.content_size); meta_line_t *meta = malloc(sizeof(meta_line_t) + tex.dyn_buffer.cur);
for (int i = 0; i < intermediate_buf_len; i++) {
text_buffer_append_char(&text_buf, *(intermediate_buf + i));
}
text_buffer_terminate_string(&text_buf);
meta_line_t *meta = malloc(sizeof(meta_line_t) + text_buf.dyn_buffer.cur);
meta->key = MetaContent; meta->key = MetaContent;
strcpy(meta->strval, text_buf.dyn_buffer.buf); strcpy(meta->strval, tex.dyn_buffer.buf);
text_buffer_destroy(&text_buf);
free(intermediate_buf);
APPEND_META(doc, meta) APPEND_META(doc, meta)
free(intermediate_buf);
text_buffer_destroy(&tex);
} }

View File

@@ -3,6 +3,6 @@
#include "src/sist.h" #include "src/sist.h"
void parse_text(int bytes_read, int *fd, char *buf, document_t *doc); void parse_text(int bytes_read, struct vfile *f, char *buf, document_t *doc);
#endif #endif

View File

@@ -2,6 +2,7 @@
#define SIST_H #define SIST_H
#define UUID_STR_LEN 37 #define UUID_STR_LEN 37
#define UNUSED(x) __attribute__((__unused__)) x
#include <glib-2.0/glib.h> #include <glib-2.0/glib.h>
#include <unistd.h> #include <unistd.h>
@@ -12,10 +13,11 @@
#include <ftw.h> #include <ftw.h>
#include <uuid.h> #include <uuid.h>
#include <magic.h> #include <magic.h>
#include <libavformat/avformat.h> #include "libavformat/avformat.h"
#include <libswscale/swscale.h> #include "libswscale/swscale.h"
#include <libswresample/swresample.h> #include "libswresample/swresample.h"
#include <libavcodec/avcodec.h> #include "libavcodec/avcodec.h"
#include "libavutil/imgutils.h"
#include <ctype.h> #include <ctype.h>
#include <mupdf/fitz.h> #include <mupdf/fitz.h>
#include <mupdf/pdf.h> #include <mupdf/pdf.h>
@@ -25,19 +27,28 @@
#include <pthread.h> #include <pthread.h>
#include <sys/stat.h> #include <sys/stat.h>
#include <wordexp.h> #include <wordexp.h>
#include "ft2build.h"
#include "freetype/freetype.h"
#include <archive.h>
#include <archive_entry.h>
#include <libxml/xmlstring.h>
#include <libxml/parser.h>
#define BOOL int
#include <tesseract/capi.h>
#include <pcre.h>
#ifndef SIST_SCAN_ONLY
#include <onion/onion.h> #include <onion/onion.h>
#include <onion/handler.h> #include <onion/handler.h>
#include <onion/block.h> #include <onion/block.h>
#include <onion/shortcuts.h> #include <onion/shortcuts.h>
#include <onion/codecs.h>
#include <curl/curl.h> #include <curl/curl.h>
#endif
#include "cJSON/cJSON.h" #include "cJSON/cJSON.h"
#include "types.h" #include "types.h"
#include "tpool.h" #include "tpool.h"
#include "utf8.h/utf8.h"
#include "util.h" #include "util.h"
#include "io/store.h" #include "io/store.h"
#include "io/serialize.h" #include "io/serialize.h"
@@ -48,13 +59,16 @@
#include "parsing/pdf.h" #include "parsing/pdf.h"
#include "parsing/media.h" #include "parsing/media.h"
#include "parsing/font.h" #include "parsing/font.h"
#include "parsing/arc.h"
#include "parsing/doc.h"
#include "parsing/cbr.h"
#include "cli.h" #include "cli.h"
#include "log.h"
#ifndef SIST_SCAN_ONLY
#include "src/index/elastic.h" #include "src/index/elastic.h"
#include "index/web.h" #include "index/web.h"
#include "web/serve.h" #include "web/serve.h"
#endif #include "web/auth_basic.h"
; ;

View File

@@ -25,6 +25,7 @@ typedef struct tpool {
int done_cnt; int done_cnt;
int stop; int stop;
void (*cleanup_func)(); void (*cleanup_func)();
} tpool_t; } tpool_t;
@@ -100,7 +101,7 @@ static void *tpool_worker(void *arg) {
tpool_t *pool = arg; tpool_t *pool = arg;
while (1) { while (1) {
pthread_mutex_lock(&(pool->work_mutex)); pthread_mutex_lock(&pool->work_mutex);
if (pool->stop) { if (pool->stop) {
break; break;
} }
@@ -113,14 +114,21 @@ static void *tpool_worker(void *arg) {
pthread_mutex_unlock(&(pool->work_mutex)); pthread_mutex_unlock(&(pool->work_mutex));
if (work != NULL) { if (work != NULL) {
if (pool->stop) {
break;
}
work->func(work->arg); work->func(work->arg);
free(work->arg);
free(work); free(work);
} }
pthread_mutex_lock(&(pool->work_mutex)); pthread_mutex_lock(&(pool->work_mutex));
pool->done_cnt++; if (work != NULL) {
pool->done_cnt++;
}
progress_bar_print((double)pool->done_cnt / pool->work_cnt, ScanCtx.stat_tn_size, ScanCtx.stat_index_size); progress_bar_print((double) pool->done_cnt / pool->work_cnt, ScanCtx.stat_tn_size, ScanCtx.stat_index_size);
if (pool->work_head == NULL) { if (pool->work_head == NULL) {
pthread_cond_signal(&(pool->working_cond)); pthread_cond_signal(&(pool->working_cond));
@@ -128,6 +136,7 @@ static void *tpool_worker(void *arg) {
pthread_mutex_unlock(&(pool->work_mutex)); pthread_mutex_unlock(&(pool->work_mutex));
} }
LOG_INFO("tpool.c", "Executing cleaup function")
pool->cleanup_func(); pool->cleanup_func();
pthread_cond_signal(&(pool->working_cond)); pthread_cond_signal(&(pool->working_cond));
@@ -136,17 +145,24 @@ static void *tpool_worker(void *arg) {
} }
void tpool_wait(tpool_t *pool) { void tpool_wait(tpool_t *pool) {
LOG_INFO("tpool.c", "Waiting for worker threads to finish")
pthread_mutex_lock(&(pool->work_mutex)); pthread_mutex_lock(&(pool->work_mutex));
while (1) { while (1) {
if (pool->done_cnt < pool->work_cnt) { if (pool->done_cnt < pool->work_cnt) {
pthread_cond_wait(&(pool->working_cond), &(pool->work_mutex)); pthread_cond_wait(&(pool->working_cond), &(pool->work_mutex));
} else { } else {
pool->stop = 1; usleep(500000);
break; if (pool->done_cnt == pool->work_cnt) {
pool->stop = 1;
usleep(1000000);
break;
}
} }
progress_bar_print(100.0, ScanCtx.stat_tn_size, ScanCtx.stat_index_size);
} }
progress_bar_print(1.0, ScanCtx.stat_tn_size, ScanCtx.stat_index_size);
pthread_mutex_unlock(&(pool->work_mutex)); pthread_mutex_unlock(&(pool->work_mutex));
LOG_INFO("tpool.c", "Worker threads finished")
} }
void tpool_destroy(tpool_t *pool) { void tpool_destroy(tpool_t *pool) {
@@ -154,6 +170,8 @@ void tpool_destroy(tpool_t *pool) {
return; return;
} }
LOG_INFO("tpool.c", "Destroying thread pool")
pthread_mutex_lock(&(pool->work_mutex)); pthread_mutex_lock(&(pool->work_mutex));
tpool_work_t *work = pool->work_head; tpool_work_t *work = pool->work_head;
while (work != NULL) { while (work != NULL) {
@@ -168,10 +186,13 @@ void tpool_destroy(tpool_t *pool) {
for (size_t i = 0; i < pool->thread_cnt; i++) { for (size_t i = 0; i < pool->thread_cnt; i++) {
pthread_t thread = pool->threads[i]; pthread_t thread = pool->threads[i];
if (thread != 0) { if (thread != 0) {
pthread_cancel(thread); void *_;
pthread_join(thread, &_);
} }
} }
LOG_INFO("tpool.c", "Final cleanup")
pthread_mutex_destroy(&(pool->work_mutex)); pthread_mutex_destroy(&(pool->work_mutex));
pthread_cond_destroy(&(pool->has_work_cond)); pthread_cond_destroy(&(pool->has_work_cond));
pthread_cond_destroy(&(pool->working_cond)); pthread_cond_destroy(&(pool->working_cond));
@@ -188,11 +209,11 @@ tpool_t *tpool_create(size_t thread_cnt, void cleanup_func()) {
tpool_t *pool = malloc(sizeof(tpool_t)); tpool_t *pool = malloc(sizeof(tpool_t));
pool->thread_cnt = thread_cnt; pool->thread_cnt = thread_cnt;
pool->work_cnt =0; pool->work_cnt = 0;
pool->done_cnt =0; pool->done_cnt = 0;
pool->stop = 0; pool->stop = 0;
pool->cleanup_func = cleanup_func; pool->cleanup_func = cleanup_func;
pool->threads = malloc(sizeof(pthread_t) * thread_cnt); pool->threads = calloc(sizeof(pthread_t), thread_cnt);
pthread_mutex_init(&(pool->work_mutex), NULL); pthread_mutex_init(&(pool->work_mutex), NULL);
@@ -202,11 +223,14 @@ tpool_t *tpool_create(size_t thread_cnt, void cleanup_func()) {
pool->work_head = NULL; pool->work_head = NULL;
pool->work_tail = NULL; pool->work_tail = NULL;
for (size_t i = 0; i < thread_cnt; i++) {
pthread_t thread = pool->threads[i];
pthread_create(&thread, NULL, tpool_worker, pool);
pthread_detach(thread);
}
return pool; return pool;
} }
void tpool_start(tpool_t *pool) {
LOG_INFOF("tpool.c", "Starting thread pool with %d threads", pool->thread_cnt)
for (size_t i = 0; i < pool->thread_cnt; i++) {
pthread_create(&pool->threads[i], NULL, tpool_worker, pool);
}
}

View File

@@ -9,6 +9,7 @@ typedef struct tpool tpool_t;
typedef void (*thread_func_t)(void *arg); typedef void (*thread_func_t)(void *arg);
tpool_t *tpool_create(size_t num, void (*cleanup_func)()); tpool_t *tpool_create(size_t num, void (*cleanup_func)());
void tpool_start(tpool_t *pool);
void tpool_destroy(tpool_t *tm); void tpool_destroy(tpool_t *tm);
int tpool_add_work(tpool_t *pool, thread_func_t func, void *arg); int tpool_add_work(tpool_t *pool, thread_func_t func, void *arg);

View File

@@ -2,13 +2,19 @@
#define SIST2_TYPES_H #define SIST2_TYPES_H
#define META_INT_MASK 0xF0 #define META_INT_MASK 0x80
#define META_STR_MASK 0xE0 #define META_STR_MASK 0x40
#define META_LONG_MASK 0xD0 #define META_LONG_MASK 0x20
#define IS_META_INT(key) (key & META_INT_MASK) == META_INT_MASK #define IS_META_INT(key) (key & META_INT_MASK) == META_INT_MASK
#define IS_META_LONG(key) (key & META_LONG_MASK) == META_LONG_MASK #define IS_META_LONG(key) (key & META_LONG_MASK) == META_LONG_MASK
#define IS_META_STR(meta) (meta->key & META_STR_MASK) == META_STR_MASK #define IS_META_STR(meta) (meta->key & META_STR_MASK) == META_STR_MASK
#define ARC_MODE_SKIP 0
#define ARC_MODE_LIST 1
#define ARC_MODE_SHALLOW 2
#define ARC_MODE_RECURSE 3
typedef int archive_mode_t;
// This is written to file as a 8bit char! // This is written to file as a 8bit char!
enum metakey { enum metakey {
MetaContent = 1 | META_STR_MASK, MetaContent = 1 | META_STR_MASK,
@@ -24,16 +30,32 @@ enum metakey {
MetaGenre = 11 | META_STR_MASK, MetaGenre = 11 | META_STR_MASK,
MetaTitle = 12 | META_STR_MASK, MetaTitle = 12 | META_STR_MASK,
MetaFontName = 13 | META_STR_MASK, MetaFontName = 13 | META_STR_MASK,
MetaParent = 14 | META_STR_MASK,
MetaExifMake = 15 | META_STR_MASK,
MetaExifSoftware = 16 | META_STR_MASK,
MetaExifExposureTime = 17 | META_STR_MASK,
MetaExifFNumber = 18 | META_STR_MASK,
MetaExifFocalLength = 19 | META_STR_MASK,
MetaExifUserComment = 20 | META_STR_MASK,
MetaExifModel = 21 | META_STR_MASK,
MetaExifIsoSpeedRatings = 22 | META_STR_MASK,
MetaExifDateTime = 23 | META_STR_MASK,
//Note to self: this will break after 31 entries
}; };
#define INDEX_TYPE_BIN "binary"
#define INDEX_TYPE_JSON "json"
#define INDEX_VERSION_EXTERNAL "_external_v1"
typedef struct index_descriptor { typedef struct index_descriptor {
char uuid[UUID_STR_LEN]; char uuid[UUID_STR_LEN];
char version[6]; char version[64];
long timestamp; long timestamp;
char root[PATH_MAX]; char root[PATH_MAX];
char rewrite_url[8196]; char rewrite_url[8196];
short root_len; short root_len;
char name[1024]; char name[1024];
char type[64];
} index_descriptor_t; } index_descriptor_t;
typedef struct index_t { typedef struct index_t {
@@ -66,10 +88,31 @@ typedef struct document {
char *filepath; char *filepath;
} document_t; } document_t;
typedef struct vfile vfile_t;
typedef int (*read_func_t)(struct vfile *, void *buf, size_t size);
typedef void (*close_func_t)(struct vfile *);
typedef struct vfile {
union {
int fd;
struct archive *arc;
};
int is_fs_file;
char *filepath;
read_func_t read;
close_func_t close;
} vfile_t;
typedef struct parse_job_t { typedef struct parse_job_t {
int base; int base;
int ext; int ext;
struct stat info; struct stat info;
struct vfile vfile;
uuid_t parent;
char filepath[1]; char filepath[1];
} parse_job_t; } parse_job_t;

View File

@@ -1,133 +1,5 @@
#include "util.h" #include "util.h"
#include "src/ctx.h"
dyn_buffer_t dyn_buffer_create() {
dyn_buffer_t buf;
buf.size = INITIAL_BUF_SIZE;
buf.cur = 0;
buf.buf = malloc(INITIAL_BUF_SIZE);
return buf;
}
void grow_buffer(dyn_buffer_t *buf, size_t size) {
if (buf->cur + size > buf->size) {
do {
buf->size *= 2;
} while (buf->cur + size > buf->size);
buf->buf = realloc(buf->buf, buf->size);
}
}
void grow_buffer_small(dyn_buffer_t *buf) {
if (buf->cur + sizeof(long) > buf->size) {
buf->size *= 2;
buf->buf = realloc(buf->buf, buf->size);
}
}
void dyn_buffer_write(dyn_buffer_t *buf, void *data, size_t size) {
grow_buffer(buf, size);
memcpy(buf->buf + buf->cur, data, size);
buf->cur += size;
}
void dyn_buffer_write_char(dyn_buffer_t *buf, char c) {
grow_buffer_small(buf);
*(buf->buf + buf->cur) = c;
buf->cur += sizeof(c);
}
void dyn_buffer_write_str(dyn_buffer_t *buf, char *str) {
dyn_buffer_write(buf, str, strlen(str));
dyn_buffer_write_char(buf, '\0');
}
void dyn_buffer_write_int(dyn_buffer_t *buf, int d) {
grow_buffer_small(buf);
*(int *) (buf->buf + buf->cur) = d;
buf->cur += sizeof(int);
}
void dyn_buffer_write_short(dyn_buffer_t *buf, short s) {
grow_buffer_small(buf);
*(short *) (buf->buf + buf->cur) = s;
buf->cur += sizeof(short);
}
void dyn_buffer_write_long(dyn_buffer_t *buf, unsigned long l) {
grow_buffer_small(buf);
*(unsigned long *) (buf->buf + buf->cur) = l;
buf->cur += sizeof(unsigned long);
}
void dyn_buffer_destroy(dyn_buffer_t *buf) {
free(buf->buf);
}
void text_buffer_destroy(text_buffer_t *buf) {
dyn_buffer_destroy(&buf->dyn_buffer);
}
text_buffer_t text_buffer_create(int max_size) {
text_buffer_t text_buf;
text_buf.dyn_buffer = dyn_buffer_create();
text_buf.max_size = max_size;
text_buf.last_char_was_whitespace = FALSE;
return text_buf;
}
void text_buffer_terminate_string(text_buffer_t *buf) {
dyn_buffer_write_char(&buf->dyn_buffer, '\0');
}
int text_buffer_append_char(text_buffer_t *buf, int c) {
if (SHOULD_IGNORE_CHAR(c)) {
if (!buf->last_char_was_whitespace) {
dyn_buffer_write_char(&buf->dyn_buffer, ' ');
buf->last_char_was_whitespace = TRUE;
if (buf->dyn_buffer.cur >= buf->max_size) {
return TEXT_BUF_FULL;
}
}
} else {
buf->last_char_was_whitespace = FALSE;
dyn_buffer_write_char(&buf->dyn_buffer, (char) c);
if (buf->dyn_buffer.cur >= buf->max_size) {
return TEXT_BUF_FULL;
}
}
return 0;
}
void incremental_put(GHashTable *table, unsigned long inode_no, int mtime) {
g_hash_table_insert(table, (gpointer) inode_no, GINT_TO_POINTER(mtime));
}
int incremental_get(GHashTable *table, unsigned long inode_no) {
if (table != NULL) {
return GPOINTER_TO_INT(g_hash_table_lookup(table, (gpointer) inode_no));
} else {
return 0;
}
}
int incremental_mark_file_for_copy(GHashTable *table, unsigned long inode_no) {
g_hash_table_insert(table, GINT_TO_POINTER(inode_no), GINT_TO_POINTER(1));
}
#define PBSTR "========================================" #define PBSTR "========================================"
#define PBWIDTH 40 #define PBWIDTH 40
@@ -136,7 +8,7 @@ dyn_buffer_t url_escape(char *str) {
dyn_buffer_t text = dyn_buffer_create(); dyn_buffer_t text = dyn_buffer_create();
char * ptr = str; char *ptr = str;
while (*ptr) { while (*ptr) {
if (*ptr == '#') { if (*ptr == '#') {
dyn_buffer_write(&text, "%23", 3); dyn_buffer_write(&text, "%23", 3);
@@ -158,8 +30,10 @@ char *abspath(const char *path) {
if (abs == NULL) { if (abs == NULL) {
return NULL; return NULL;
} }
abs = realloc(abs, strlen(abs) + 2); if (strlen(abs) > 1) {
strcat(abs, "/"); abs = realloc(abs, strlen(abs) + 2);
strcat(abs, "/");
}
wordfree(&w); wordfree(&w);
return abs; return abs;
@@ -169,7 +43,7 @@ char *expandpath(const char *path) {
wordexp_t w; wordexp_t w;
wordexp(path, &w, 0); wordexp(path, &w, 0);
char * expanded = malloc(strlen(w.we_wordv[0]) + 2); char *expanded = malloc(strlen(w.we_wordv[0]) + 2);
strcpy(expanded, w.we_wordv[0]); strcpy(expanded, w.we_wordv[0]);
strcat(expanded, "/"); strcat(expanded, "/");
@@ -221,4 +95,29 @@ GHashTable *incremental_get_table() {
return file_table; return file_table;
} }
const char *find_file_in_paths(const char *paths[], const char *filename) {
for (int i = 0; paths[i] != NULL; i++) {
char *apath = abspath(paths[i]);
if (apath == NULL) {
continue;
}
char path[PATH_MAX];
snprintf(path, sizeof(path), "%s%s", apath, filename);
LOG_DEBUGF("util.c", "Looking for '%s' in folder '%s'", filename, apath)
free(apath);
struct stat info;
int ret = stat(path, &info);
if (ret != -1) {
return paths[i];
}
}
return NULL;
}

View File

@@ -5,7 +5,10 @@
#define TEXT_BUF_FULL -1 #define TEXT_BUF_FULL -1
#define INITIAL_BUF_SIZE 1024 * 16 #define INITIAL_BUF_SIZE 1024 * 16
#define SHOULD_IGNORE_CHAR(c) c < '0' || c > 'z'
#define SHOULD_IGNORE_CHAR(c) !(SHOULD_KEEP_CHAR(c))
#define SHOULD_KEEP_CHAR(c) ((c >= '\'' && c <= ';') || (c >= 'A' && c <= 'z') || (c > 127))
typedef struct dyn_buffer { typedef struct dyn_buffer {
char *buf; char *buf;
@@ -21,48 +24,267 @@ typedef struct text_buffer {
dyn_buffer_t dyn_buffer; dyn_buffer_t dyn_buffer;
} text_buffer_t; } text_buffer_t;
char *abspath(const char * path); char *abspath(const char *path);
char *expandpath(const char *path); char *expandpath(const char *path);
dyn_buffer_t url_escape(char *str); dyn_buffer_t url_escape(char *str);
void progress_bar_print(double percentage, size_t tn_size, size_t index_size); void progress_bar_print(double percentage, size_t tn_size, size_t index_size);
GHashTable *incremental_get_table(); GHashTable *incremental_get_table();
dyn_buffer_t dyn_buffer_create(); __always_inline
static int utf8_validchr2(const char *s) {
if (0x00 == (0x80 & *s)) {
return TRUE;
} else if (0xf0 == (0xf8 & *s)) {
if ((0x80 != (0xc0 & s[1])) || (0x80 != (0xc0 & s[2])) ||
(0x80 != (0xc0 & s[3]))) {
return FALSE;
}
void grow_buffer(dyn_buffer_t *buf, size_t size); if (0x80 == (0xc0 & s[4])) {
return FALSE;
}
void grow_buffer_small(dyn_buffer_t *buf); if ((0 == (0x07 & s[0])) && (0 == (0x30 & s[1]))) {
return FALSE;
}
} else if (0xe0 == (0xf0 & *s)) {
if ((0x80 != (0xc0 & s[1])) || (0x80 != (0xc0 & s[2]))) {
return FALSE;
}
void dyn_buffer_write(dyn_buffer_t *buf, void *data, size_t size); if (0x80 == (0xc0 & s[3])) {
return FALSE;
}
void dyn_buffer_write_char(dyn_buffer_t *buf, char c); if ((0 == (0x0f & s[0])) && (0 == (0x20 & s[1]))) {
return FALSE;
}
} else if (0xc0 == (0xe0 & *s)) {
if (0x80 != (0xc0 & s[1])) {
return FALSE;
}
void dyn_buffer_write_str(dyn_buffer_t *buf, char *str); if (0x80 == (0xc0 & s[2])) {
return FALSE;
}
void dyn_buffer_write_int(dyn_buffer_t *buf, int d); if (0 == (0x1e & s[0])) {
return FALSE;
}
} else {
return FALSE;
}
void dyn_buffer_write_short(dyn_buffer_t *buf, short s); return TRUE;
}
void dyn_buffer_write_long(dyn_buffer_t *buf, unsigned long l);
void dyn_buffer_destroy(dyn_buffer_t *buf);
void text_buffer_destroy(text_buffer_t *buf);
text_buffer_t text_buffer_create(int max_size);
void text_buffer_terminate_string(text_buffer_t *buf);
int text_buffer_append_char(text_buffer_t *buf, int c);
void incremental_put(GHashTable *table, unsigned long inode_no, int mtime);
int incremental_get(GHashTable *table, unsigned long inode_no);
int incremental_mark_file_for_copy(GHashTable *table, unsigned long inode_no);
__always_inline
static dyn_buffer_t dyn_buffer_create() {
dyn_buffer_t buf;
buf.size = INITIAL_BUF_SIZE;
buf.cur = 0;
buf.buf = malloc(INITIAL_BUF_SIZE);
return buf;
}
__always_inline
static void grow_buffer(dyn_buffer_t *buf, size_t size) {
if (buf->cur + size > buf->size) {
do {
buf->size *= 2;
} while (buf->cur + size > buf->size);
buf->buf = realloc(buf->buf, buf->size);
}
}
__always_inline
static void grow_buffer_small(dyn_buffer_t *buf) {
if (buf->cur + sizeof(long) > buf->size) {
buf->size *= 2;
buf->buf = realloc(buf->buf, buf->size);
}
}
__always_inline
static void dyn_buffer_write(dyn_buffer_t *buf, void *data, size_t size) {
grow_buffer(buf, size);
memcpy(buf->buf + buf->cur, data, size);
buf->cur += size;
}
__always_inline
static void dyn_buffer_write_char(dyn_buffer_t *buf, char c) {
grow_buffer_small(buf);
*(buf->buf + buf->cur) = c;
buf->cur += sizeof(c);
}
__always_inline
static void dyn_buffer_write_str(dyn_buffer_t *buf, char *str) {
dyn_buffer_write(buf, str, strlen(str));
dyn_buffer_write_char(buf, '\0');
}
__always_inline
static void dyn_buffer_append_string(dyn_buffer_t *buf, char *str) {
dyn_buffer_write(buf, str, strlen(str));
}
__always_inline
static void dyn_buffer_write_int(dyn_buffer_t *buf, int d) {
grow_buffer_small(buf);
*(int *) (buf->buf + buf->cur) = d;
buf->cur += sizeof(int);
}
__always_inline
static void dyn_buffer_write_short(dyn_buffer_t *buf, short s) {
grow_buffer_small(buf);
*(short *) (buf->buf + buf->cur) = s;
buf->cur += sizeof(short);
}
__always_inline
static void dyn_buffer_write_long(dyn_buffer_t *buf, unsigned long l) {
grow_buffer_small(buf);
*(unsigned long *) (buf->buf + buf->cur) = l;
buf->cur += sizeof(unsigned long);
}
__always_inline
static void dyn_buffer_destroy(dyn_buffer_t *buf) {
free(buf->buf);
}
__always_inline
static void text_buffer_destroy(text_buffer_t *buf) {
dyn_buffer_destroy(&buf->dyn_buffer);
}
__always_inline
static text_buffer_t text_buffer_create(int max_size) {
text_buffer_t text_buf;
text_buf.dyn_buffer = dyn_buffer_create();
text_buf.max_size = max_size;
text_buf.last_char_was_whitespace = FALSE;
return text_buf;
}
__always_inline
static int text_buffer_append_char(text_buffer_t *buf, int c) {
if (SHOULD_IGNORE_CHAR(c) || c == ' ') {
if (!buf->last_char_was_whitespace && buf->dyn_buffer.cur != 0) {
dyn_buffer_write_char(&buf->dyn_buffer, ' ');
buf->last_char_was_whitespace = TRUE;
if (buf->max_size > 0 && buf->dyn_buffer.cur >= buf->max_size) {
return TEXT_BUF_FULL;
}
}
} else {
buf->last_char_was_whitespace = FALSE;
grow_buffer_small(&buf->dyn_buffer);
if (0 == ((utf8_int32_t) 0xffffff80 & c)) {
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = (char) c;
} else if (0 == ((utf8_int32_t) 0xfffff800 & c)) {
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0xc0 | (char) (c >> 6);
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0x80 | (char) (c & 0x3f);
} else if (0 == ((utf8_int32_t) 0xffff0000 & c)) {
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0xe0 | (char) (c >> 12);
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0x80 | (char) ((c >> 6) & 0x3f);
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0x80 | (char) (c & 0x3f);
} else {
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0xf0 | (char) (c >> 18);
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0x80 | (char) ((c >> 12) & 0x3f);
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0x80 | (char) ((c >> 6) & 0x3f);
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur++) = 0x80 | (char) (c & 0x3f);
}
if (buf->max_size > 0 && buf->dyn_buffer.cur >= buf->max_size) {
return TEXT_BUF_FULL;
}
}
return 0;
}
__always_inline
static void text_buffer_terminate_string(text_buffer_t *buf) {
if (buf->dyn_buffer.cur > 0 && *(buf->dyn_buffer.buf + buf->dyn_buffer.cur - 1) == ' ') {
*(buf->dyn_buffer.buf + buf->dyn_buffer.cur - 1) = '\0';
} else {
dyn_buffer_write_char(&buf->dyn_buffer, '\0');
}
}
__always_inline
static int text_buffer_append_string(text_buffer_t *buf, char *str, size_t len) {
utf8_int32_t c;
if (str == NULL || len < 1 ||
(0xf0 == (0xf8 & str[0]) && len < 4) ||
(0xe0 == (0xf0 & str[0]) && len < 3) ||
(0xc0 == (0xe0 & str[0]) && len == 1) ||
*(str) == 0) {
return 0;
}
for (void *v = utf8codepoint(str, &c); c != '\0' && ((char *) v - str + 4) < len; v = utf8codepoint(v, &c)) {
if (utf8_validchr2(v)) {
text_buffer_append_char(buf, c);
}
}
return 0;
}
__always_inline
static int text_buffer_append_string0(text_buffer_t *buf, char *str) {
utf8_int32_t c;
for (void *v = utf8codepoint(str, &c); c != '\0'; v = utf8codepoint(v, &c)) {
if (utf8_validchr2(v)) {
text_buffer_append_char(buf, c);
}
}
}
__always_inline
static void incremental_put(GHashTable *table, unsigned long inode_no, int mtime) {
g_hash_table_insert(table, (gpointer) inode_no, GINT_TO_POINTER(mtime));
}
__always_inline
static int incremental_get(GHashTable *table, unsigned long inode_no) {
if (table != NULL) {
return GPOINTER_TO_INT(g_hash_table_lookup(table, (gpointer) inode_no));
} else {
return 0;
}
}
__always_inline
static int incremental_mark_file_for_copy(GHashTable *table, unsigned long inode_no) {
g_hash_table_insert(table, GINT_TO_POINTER(inode_no), GINT_TO_POINTER(1));
}
const char *find_file_in_paths(const char **paths, const char *filename);
#endif #endif

59
src/web/auth_basic.c Normal file
View File

@@ -0,0 +1,59 @@
#include "auth_basic.h"
#define UNAUTHORIZED_TEXT "Unauthorized"
typedef struct auth_basic_data {
onion_handler *inside;
const char *b64credentials;
} auth_basic_data_t;
int authenticate(const char *expected, const char *credentials) {
if (expected == NULL) {
return TRUE;
}
if (credentials && strncmp(credentials, "Basic ", 6) == 0) {
if (strcmp((credentials + 6), expected) == 0) {
return TRUE;
}
}
return FALSE;
}
int auth_basic_handler(auth_basic_data_t *d,
onion_request *req,
onion_response *res) {
const char *credentials = onion_request_get_header(req, "Authorization");
if (authenticate(d->b64credentials, credentials)) {
return onion_handler_handle(d->inside, req, res);
}
onion_response_set_header(res, "WWW-Authenticate", "Basic realm=\"sist2\"");
onion_response_set_code(res, HTTP_UNAUTHORIZED);
onion_response_write(res, UNAUTHORIZED_TEXT, sizeof(UNAUTHORIZED_TEXT));
onion_response_set_length(res, sizeof(UNAUTHORIZED_TEXT));
return OCS_PROCESSED;
}
void auth_basic_free(auth_basic_data_t *data) {
onion_handler_free(data->inside);
free(data);
}
onion_handler *auth_basic(const char *b64credentials, onion_handler *inside_level) {
auth_basic_data_t *privdata = malloc(sizeof(auth_basic_data_t));
privdata->b64credentials = b64credentials;
privdata->inside = inside_level;
return onion_handler_new((onion_handler_handler) auth_basic_handler, privdata,
(onion_handler_private_data_free) auth_basic_free);
}

4
src/web/auth_basic.h Normal file
View File

@@ -0,0 +1,4 @@
#include "src/sist.h"
onion_handler *auth_basic(const char *b64credentials, onion_handler *inside_level);

View File

@@ -43,27 +43,40 @@ int javascript(void *p, onion_request *req, onion_response *res) {
return OCS_PROCESSED; return OCS_PROCESSED;
} }
int style(void *p, onion_request *req, onion_response *res) { int client_requested_dark_theme(onion_request *req) {
set_default_headers(res); const char *cookie = onion_request_get_cookie(req, "sist");
onion_response_set_header(res, "Content-Type", "text/css"); if (cookie == NULL) {
onion_response_set_length(res, sizeof(bundle_css)); return FALSE;
onion_response_write(res, bundle_css, sizeof(bundle_css)); }
return OCS_PROCESSED;
return strcmp(cookie, "dark") == 0;
} }
int bg_bars(void *p, onion_request *req, onion_response *res) { int style(void *p, onion_request *req, onion_response *res) {
set_default_headers(res); set_default_headers(res);
onion_response_set_header(res, "Content-Type", "image/png");
onion_response_set_length(res, sizeof(bg_bars_png)); onion_response_set_header(res, "Content-Type", "text/css");
onion_response_write(res, bg_bars_png, sizeof(bg_bars_png));
if (client_requested_dark_theme(req)) {
onion_response_set_length(res, sizeof(bundle_dark_css));
onion_response_write(res, bundle_dark_css, sizeof(bundle_dark_css));
} else {
onion_response_set_length(res, sizeof(bundle_css));
onion_response_write(res, bundle_css, sizeof(bundle_css));
}
return OCS_PROCESSED; return OCS_PROCESSED;
} }
int img_sprite_skin_flag(void *p, onion_request *req, onion_response *res) { int img_sprite_skin_flag(void *p, onion_request *req, onion_response *res) {
set_default_headers(res); set_default_headers(res);
onion_response_set_header(res, "Content-Type", "image/png"); onion_response_set_header(res, "Content-Type", "image/png");
onion_response_set_length(res, sizeof(sprite_skin_flat_png)); if (client_requested_dark_theme(req)) {
onion_response_write(res, sprite_skin_flat_png, sizeof(sprite_skin_flat_png)); onion_response_set_length(res, sizeof(sprite_skin_flat_dark_png));
onion_response_write(res, sprite_skin_flat_dark_png, sizeof(sprite_skin_flat_dark_png));
} else {
onion_response_set_length(res, sizeof(sprite_skin_flat_png));
onion_response_write(res, sprite_skin_flat_png, sizeof(sprite_skin_flat_png));
}
return OCS_PROCESSED; return OCS_PROCESSED;
} }
@@ -97,7 +110,7 @@ int thumbnail(void *p, onion_request *req, onion_response *res) {
int written = onion_response_write(res, data, data_len); int written = onion_response_write(res, data, data_len);
onion_response_flush(res); onion_response_flush(res);
if (written != data_len || data_len == 0) { if (written != data_len || data_len == 0) {
printf("Couldn't write thumb\n"); LOG_DEBUG("serve.c", "Couldn't write thumbnail");
} }
free(data); free(data);
@@ -168,7 +181,12 @@ int chunked_response_file(const char *filename, const char *mime,
} }
} }
onion_response_set_length(res, length); onion_response_set_length(res, length);
onion_response_set_header(res, "Content-Type", mime); if (mime != NULL) {
onion_response_set_header(res, "Content-Type", mime);
} else {
onion_response_set_header(res, "Content-Type", "application/octet-stream");
}
onion_response_write_headers(res); onion_response_write_headers(res);
if ((onion_request_get_flags(request) & OR_HEAD) == OR_HEAD) { if ((onion_request_get_flags(request) & OR_HEAD) == OR_HEAD) {
length = 0; length = 0;
@@ -201,21 +219,13 @@ int chunked_response_file(const char *filename, const char *mime,
return OCS_PROCESSED; return OCS_PROCESSED;
} }
int search(void *p, onion_request *req, onion_response *res) { int search(UNUSED(void *p), onion_request *req, onion_response *res) {
int flags = onion_request_get_flags(req); int flags = onion_request_get_flags(req);
if ((flags & OR_METHODS) != OR_POST) { if ((flags & OR_METHODS) != OR_POST) {
return OCS_NOT_PROCESSED; return OCS_NOT_PROCESSED;
} }
char *scroll_param;
const char *scroll = onion_request_get_query(req, "scroll");
if (scroll != NULL) {
scroll_param = "?scroll=3m";
} else {
scroll_param = "";
}
const struct onion_block_t *block = onion_request_get_data(req); const struct onion_block_t *block = onion_request_get_data(req);
if (block == NULL) { if (block == NULL) {
@@ -223,7 +233,7 @@ int search(void *p, onion_request *req, onion_response *res) {
} }
char url[4096]; char url[4096];
snprintf(url, 4096, "%s/sist2/_search%s", WebCtx.es_url, scroll_param); snprintf(url, 4096, "%s/sist2/_search", WebCtx.es_url);
response_t *r = web_post(url, onion_block_data(block), "Content-Type: application/json"); response_t *r = web_post(url, onion_block_data(block), "Content-Type: application/json");
set_default_headers(res); set_default_headers(res);
@@ -232,6 +242,9 @@ int search(void *p, onion_request *req, onion_response *res) {
if (r->status_code == 200) { if (r->status_code == 200) {
onion_response_write(res, r->body, r->size); onion_response_write(res, r->body, r->size);
} else {
sist_log("serve.c", SIST_WARNING, "ElasticSearch error during query");
onion_response_set_code(res, HTTP_INTERNAL_ERROR);
} }
free_response(r); free_response(r);
@@ -239,43 +252,6 @@ int search(void *p, onion_request *req, onion_response *res) {
return OCS_PROCESSED; return OCS_PROCESSED;
} }
int scroll(void *p, onion_request *req, onion_response *res) {
int flags = onion_request_get_flags(req);
if ((flags & OR_METHODS) != OR_GET) {
return OCS_NOT_PROCESSED;
}
char url[4096];
snprintf(url, 4096, "%s/_search/scroll", WebCtx.es_url);
const char *scroll_id = onion_request_get_query(req, "scroll_id");
cJSON *json = cJSON_CreateObject();
cJSON_AddStringToObject(json, "scroll_id", scroll_id);
cJSON_AddStringToObject(json, "scroll", "3m");
char *json_str = cJSON_PrintUnformatted(json);
response_t *r = web_post(url, json_str, "Content-Type: application/json");
cJSON_Delete(json);
cJSON_free(json_str);
if (r->status_code != 200) {
free_response(r);
return OCS_NOT_PROCESSED;
}
set_default_headers(res);
onion_response_set_header(res, "Content-Type", "application/json");
onion_response_set_header(res, "Content-Disposition", "application/json");
onion_response_set_length(res, r->size);
onion_response_write(res, r->body, r->size);
free_response(r);
return OCS_PROCESSED;
}
int serve_file_from_url(cJSON *json, index_t *idx, onion_request *req, onion_response *res) { int serve_file_from_url(cJSON *json, index_t *idx, onion_request *req, onion_response *res) {
const char *path = cJSON_GetObjectItem(json, "path")->valuestring; const char *path = cJSON_GetObjectItem(json, "path")->valuestring;
@@ -312,7 +288,7 @@ int serve_file_from_disk(cJSON *json, index_t *idx, onion_request *req, onion_re
return chunked_response_file(full_path, mime, 1, req, res); return chunked_response_file(full_path, mime, 1, req, res);
} }
int index_info(void *p, onion_request *req, onion_response *res) { int index_info(UNUSED(void *p), onion_request *req, onion_response *res) {
cJSON *json = cJSON_CreateObject(); cJSON *json = cJSON_CreateObject();
cJSON *arr = cJSON_AddArrayToObject(json, "indices"); cJSON *arr = cJSON_AddArrayToObject(json, "indices");
@@ -326,7 +302,7 @@ int index_info(void *p, onion_request *req, onion_response *res) {
cJSON_AddStringToObject(idx_json, "name", idx->desc.name); cJSON_AddStringToObject(idx_json, "name", idx->desc.name);
cJSON_AddStringToObject(idx_json, "version", idx->desc.version); cJSON_AddStringToObject(idx_json, "version", idx->desc.version);
cJSON_AddStringToObject(idx_json, "id", idx->desc.uuid); cJSON_AddStringToObject(idx_json, "id", idx->desc.uuid);
cJSON_AddNumberToObject(idx_json, "timestamp", (double)idx->desc.timestamp); cJSON_AddNumberToObject(idx_json, "timestamp", (double) idx->desc.timestamp);
cJSON_AddItemToArray(arr, idx_json); cJSON_AddItemToArray(arr, idx_json);
} }
@@ -338,7 +314,8 @@ int index_info(void *p, onion_request *req, onion_response *res) {
return OCS_PROCESSED; return OCS_PROCESSED;
} }
int file(void *p, onion_request *req, onion_response *res) {
int document_info(UNUSED(void *p), onion_request *req, onion_response *res) {
const char *arg_uuid = onion_request_get_query(req, "1"); const char *arg_uuid = onion_request_get_query(req, "1");
if (arg_uuid == NULL) { if (arg_uuid == NULL) {
@@ -347,22 +324,89 @@ int file(void *p, onion_request *req, onion_response *res) {
cJSON *doc = elastic_get_document(arg_uuid); cJSON *doc = elastic_get_document(arg_uuid);
cJSON *source = cJSON_GetObjectItem(doc, "_source"); cJSON *source = cJSON_GetObjectItem(doc, "_source");
cJSON *index_id = cJSON_GetObjectItem(source, "index"); cJSON *index_id = cJSON_GetObjectItem(source, "index");
if (index_id == NULL) { if (index_id == NULL) {
cJSON_Delete(doc);
return OCS_NOT_PROCESSED; return OCS_NOT_PROCESSED;
} }
index_t *idx = get_index_by_id(index_id->valuestring);
if (idx == NULL) {
cJSON_Delete(doc);
return OCS_NOT_PROCESSED;
}
onion_response_set_header(res, "Content-Type", "application/json");
char *json_str = cJSON_PrintUnformatted(source);
onion_response_write0(res, json_str);
free(json_str);
cJSON_Delete(doc);
return OCS_PROCESSED;
}
int file(UNUSED(void *p), onion_request *req, onion_response *res) {
const char *arg_uuid = onion_request_get_query(req, "1");
if (arg_uuid == NULL) {
return OCS_PROCESSED;
}
const char *next = arg_uuid;
cJSON *doc = NULL;
cJSON *index_id = NULL;
cJSON *source = NULL;
while (true) {
doc = elastic_get_document(next);
source = cJSON_GetObjectItem(doc, "_source");
index_id = cJSON_GetObjectItem(source, "index");
if (index_id == NULL) {
cJSON_Delete(doc);
return OCS_NOT_PROCESSED;
}
cJSON *parent = cJSON_GetObjectItem(source, "parent");
if (parent == NULL) {
break;
}
next = parent->valuestring;
}
index_t *idx = get_index_by_id(index_id->valuestring); index_t *idx = get_index_by_id(index_id->valuestring);
if (idx == NULL) { if (idx == NULL) {
cJSON_Delete(doc);
return OCS_NOT_PROCESSED; return OCS_NOT_PROCESSED;
} }
int ret;
if (strlen(idx->desc.rewrite_url) == 0) { if (strlen(idx->desc.rewrite_url) == 0) {
return serve_file_from_disk(source, idx, req, res); ret = serve_file_from_disk(source, idx, req, res);
} else { } else {
return serve_file_from_url(source, idx, req, res); ret = serve_file_from_url(source, idx, req, res);
} }
cJSON_Delete(doc);
return ret;
}
int status(UNUSED(void *p), UNUSED(onion_request *req), onion_response *res) {
set_default_headers(res);
onion_response_set_header(res, "Content-Type", "application/x-empty");
char *status = elastic_get_status();
if (strcmp(status, "open") == 0) {
onion_response_set_code(res, 204);
} else {
onion_response_set_code(res, 500);
}
free(status);
return OCS_PROCESSED;
} }
void serve(const char *hostname, const char *port) { void serve(const char *hostname, const char *port) {
@@ -372,17 +416,18 @@ void serve(const char *hostname, const char *port) {
onion_set_hostname(o, hostname); onion_set_hostname(o, hostname);
onion_set_port(o, port); onion_set_port(o, port);
onion_url *urls = onion_root_url(o); onion_url *urls = onion_url_new();
// Static paths // Static paths
onion_set_root_handler(o, auth_basic(WebCtx.b64credentials, onion_url_to_handler(urls)));
onion_url_add(urls, "", search_index); onion_url_add(urls, "", search_index);
onion_url_add(urls, "css", style); onion_url_add(urls, "css", style);
onion_url_add(urls, "js", javascript); onion_url_add(urls, "js", javascript);
onion_url_add(urls, "img/bg-bars.png", bg_bars);
onion_url_add(urls, "img/sprite-skin-flat.png", img_sprite_skin_flag); onion_url_add(urls, "img/sprite-skin-flat.png", img_sprite_skin_flag);
onion_url_add(urls, "es", search); onion_url_add(urls, "es", search);
onion_url_add(urls, "scroll", scroll); onion_url_add(urls, "status", status);
onion_url_add( onion_url_add(
urls, urls,
"^t/([a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})/" "^t/([a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})/"
@@ -390,8 +435,10 @@ void serve(const char *hostname, const char *port) {
thumbnail thumbnail
); );
onion_url_add(urls, "^f/([a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})$", file); onion_url_add(urls, "^f/([a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})$", file);
onion_url_add(urls, "^d/([a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12})$", document_info);
onion_url_add(urls, "i", index_info); onion_url_add(urls, "i", index_info);
printf("Starting web server @ http://%s:%s\n", hostname, port); printf("Starting web server @ http://%s:%s\n", hostname, port);
onion_listen(o); onion_listen(o);

File diff suppressed because one or more lines are too long

1
utf8.h Submodule

Submodule utf8.h added at 2a7c5bfa95

View File

@@ -1,9 +0,0 @@
.autocomplete-suggestions {
text-align: left; cursor: default; border: 1px solid #ccc; border-top: 0; background: #fff; box-shadow: -1px 1px 3px rgba(0,0,0,.1);
/* core styles should not be changed */
position: absolute; display: none; z-index: 9999; max-height: 254px; overflow: hidden; overflow-y: auto; box-sizing: border-box;
}
.autocomplete-suggestion { position: relative; padding: 0 .6em; line-height: 23px; white-space: nowrap; overflow: hidden; text-overflow: ellipsis; font-size: 1.02em; color: #333; }
.autocomplete-suggestion b { font-weight: normal; color: #1f8dd6; }
.autocomplete-suggestion.selected { background: #f0f0f0; }

459
web/css/dark.css Normal file
View File

@@ -0,0 +1,459 @@
*:focus {
outline: 0;
}
.info-icon {
width: 1rem;
margin-right: 0.2rem;
cursor: pointer;
color: #757575;
line-height: 1rem;
height: 1.1rem;
}
.info-icon:hover {
color: inherit;
}
.modal-title {
max-width: calc(100% - 2rem);
overflow: hidden;
text-overflow: ellipsis;
}
.path-row {
display: -ms-flexbox;
display: flex;
-ms-flex-align: start;
align-items: flex-start;
}
.tag-container {
margin-left: 0.3rem;
}
.path-line {
color: #BBB;
text-overflow: ellipsis;
overflow: hidden;
}
a {
color: #00BCD4;
}
body {
overflow-y: scroll;
background: black;
}
.progress {
margin-top: 1em;
}
.card, .modal-content {
margin-top: 1em;
background: #212121;
color: #e0e0e0;
border-radius: 1px;
border: none;
}
.table {
color: #e0e0e0;
}
.table td, .table th {
border: none;
}
.table thead th {
border-bottom: 1px solid #646464;
}
.modal-header .close {
color: #e0e0e0;
text-shadow: none;
}
.modal-header {
border-bottom: 1px solid #646464;
}
.sub-document {
background: #37474F !important;
}
.list-group-item.sub-document {
border-top: 1px solid #646464 !important;
}
.sub-document .text-muted {
color: #8a949c !important;
}
.list-group-item {
background: #212121;
color: #e0e0e0;
border-top: 1px solid #424242;
border-bottom: none;
border-left: none;
border-right: none;
padding: .25rem 0.5rem;
}
.list-group-item:first-child {
border-top: none;
}
.navbar-brand {
font-size: 1.75rem;
padding: 0;
color: #f5f5f5;
}
.navbar {
background: #546b7a;
}
.navbar a:hover {
color: #fff;
}
.navbar span {
color: #eee;
}
.document {
padding: 0.5rem;
}
.document p {
margin-bottom: 0;
}
.document:hover p {
text-decoration: underline;
}
.badge-video {
color: #FFFFFF;
background-color: #F27761;
}
.badge-image {
color: #FFFFFF;
background-color: #AA99C9;
}
.badge-audio {
color: #FFFFFF;
background-color: #00ADEF;
}
.badge-resolution {
color: #212529;
background-color: #B0BEC5;
}
.badge-text {
color: #FFFFFF;
background-color: #FAAB3C;
}
.card-img-overlay {
pointer-events: none;
padding: 0.75rem;
bottom: unset;
top: 0;
left: unset;
right: unset;
}
.file-title {
width: 100%;
line-height: 1rem;
height: 1.1rem;
font-size: 10pt;
white-space: nowrap;
text-overflow: ellipsis;
overflow: hidden;
color: #00BCD4;
}
.badge {
margin-right: 3px;
}
.badge-user {
color: #212529;
background-color: #e0e0e0;
}
.fit {
display: block;
min-width: 64px;
max-width: 100%;
max-height: 175px;
margin: 0 auto 0;
padding: 3px 3px 0;
width: auto;
height: auto;
}
.fit-sm {
display: block;
max-width: 64px;
max-height: 64px;
margin: 0 auto;
width: auto;
height: auto;
}
.audio-fit {
height: 39px;
vertical-align: bottom;
display: inline;
width: 100%;
}
@media (min-width: 1200px) {
.card-columns {
column-count: 4;
}
}
@media (min-width: 1500px) {
.container {
max-width: 1440px;
}
.card-columns {
column-count: 5;
}
}
@media (min-width: 1800px) {
.container {
max-width: 1550px;
}
}
mark {
background: rgba(251, 191, 41, 0.25);
border-radius: 0;
padding: 1px 0;
color: inherit;
}
.content-div mark {
background: rgba(251, 191, 41, 0.40);
color: white;
}
.content-div {
font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
font-size: 13px;
padding: 1em;
background-color: #37474F;
border: 1px solid #616161;
border-radius: 4px;
margin: 3px;
white-space: normal;
color: rgb(224, 224, 224);
}
.irs-single, .irs-from, .irs-to {
font-size: 13px;
background-color: #00BCD4;
}
.irs-slider {
cursor: col-resize;
}
.irs {
margin-top: 1em;
margin-bottom: 1em;
}
.custom-select {
overflow: auto;
background-color: #37474F;
border: 1px solid #616161;
color: #bdbdbd;
}
.custom-select:focus {
border-color: #757575;
outline: 0;
box-shadow: 0 0 0 .2rem rgba(0, 123, 255, .25);
}
option {
outline: none;
}
.form-control {
background-color: #37474F;
border: 1px solid #616161;
color: #fff;
}
.form-control:focus {
background-color: #546E7A;
color: #fff;
}
.input-group-text {
background: #263238;
border: 1px solid #616161;
color: #dbdbdb;
}
::placeholder {
color: #BDBDBD !important;
opacity: 1;
}
.inspire-tree .selected > .wholerow, .inspire-tree .selected > .title-wrap:hover + .wholerow {
background: none;
}
.inspire-tree .icon-expand::before, .inspire-tree .icon-collapse::before {
background-color: black;
}
.inspire-tree .title {
color: #eee;
}
.inspire-tree {
font-weight: 400;
font-size: 14px;
font-family: Helvetica, Nueue, Verdana, sans-serif;
max-height: 350px;
overflow: auto;
}
.page-indicator {
line-height: 1rem;
padding: 0.5rem;
background: #212121;
color: #eee;
margin-top: 1em;
}
.btn-xs {
padding: .1rem .3rem;
font-size: .875rem;
border-radius: .2rem;
}
.btn {
color: #eee;
}
.nav-tabs .nav-link {
color: #e0e0e0;
}
.nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-link.active {
background-color: #212121;
border-color: #616161 #616161 #212121;
color: #e0e0e0;
}
.nav-tabs .nav-link:focus, .nav-tabs .nav-link:focus {
border-color: #616161 #616161 #212121;
color: #e0e0e0;
}
.nav-tabs .nav-link:focus, .nav-tabs .nav-link:hover {
border-color: #e0e0e0 #e0e0e0 #212121;
color: #e0e0e0;
}
.nav-tabs {
border-bottom: #616161;
}
.nav {
margin-top: 0.5rem;
}
@media (max-width: 800px) {
#treeTabs {
flex-basis: inherit;
flex-grow: inherit;
}
}
.list-group {
margin-top: 1em;
}
.wrapper-sm {
min-width: 64px;
}
.media-expanded {
display: inherit;
}
.media-expanded .fit {
max-height: 250px;
}
@media (max-width: 600px) {
.media-expanded .fit {
max-height: none;
}
.tagline {
display: none;
}
}
.version {
color: #00BCD4;
margin-left: -18px;
margin-top: -14px;
font-size: 11px;
}
@media (min-width: 800px) {
.small-btn {
display: none;
}
.large-btn {
display: inherit;
}
}
@media (max-width: 801px) {
.small-btn {
display: inherit;
}
.large-btn {
display: none;
}
}
#searchBar {
border-right: none;
}
#pathTree .title {
cursor: pointer;
}
svg {
fill: white;
}

1
web/css/jquery.toast.min.css vendored Normal file
View File

@@ -0,0 +1 @@
.jq-toast-wrap,.jq-toast-wrap *{margin:0;padding:0}.jq-toast-wrap{display:block;position:fixed;width:250px;pointer-events:none!important;letter-spacing:normal;z-index:9000!important}.jq-toast-wrap.bottom-left{bottom:20px;left:20px}.jq-toast-wrap.bottom-right{bottom:20px;right:40px}.jq-toast-wrap.top-left{top:20px;left:20px}.jq-toast-wrap.top-right{top:20px;right:40px}.jq-toast-single{display:block;width:100%;padding:10px;margin:0 0 5px;border-radius:4px;font-size:12px;font-family:arial,sans-serif;line-height:17px;position:relative;pointer-events:all!important;background-color:#444;color:#fff}.jq-toast-single h2{font-family:arial,sans-serif;font-size:14px;margin:0 0 7px;background:0 0;color:inherit;line-height:inherit;letter-spacing:normal}.jq-toast-single a{color:#eee;text-decoration:none;font-weight:700;border-bottom:1px solid #fff;padding-bottom:3px;font-size:12px}.jq-toast-single ul{margin:0 0 0 15px;background:0 0;padding:0}.jq-toast-single ul li{list-style-type:disc!important;line-height:17px;background:0 0;margin:0;padding:0;letter-spacing:normal}.close-jq-toast-single{position:absolute;top:3px;right:7px;font-size:14px;cursor:pointer}.jq-toast-loader{display:block;position:absolute;top:-2px;height:5px;width:0;left:0;border-radius:5px;background:red}.jq-toast-loaded{width:100%}.jq-has-icon{padding:10px 10px 10px 50px;background-repeat:no-repeat;background-position:10px}.jq-icon-info{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABgAAAAYCAYAAADgdz34AAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAGwSURBVEhLtZa9SgNBEMc9sUxxRcoUKSzSWIhXpFMhhYWFhaBg4yPYiWCXZxBLERsLRS3EQkEfwCKdjWJAwSKCgoKCcudv4O5YLrt7EzgXhiU3/4+b2ckmwVjJSpKkQ6wAi4gwhT+z3wRBcEz0yjSseUTrcRyfsHsXmD0AmbHOC9Ii8VImnuXBPglHpQ5wwSVM7sNnTG7Za4JwDdCjxyAiH3nyA2mtaTJufiDZ5dCaqlItILh1NHatfN5skvjx9Z38m69CgzuXmZgVrPIGE763Jx9qKsRozWYw6xOHdER+nn2KkO+Bb+UV5CBN6WC6QtBgbRVozrahAbmm6HtUsgtPC19tFdxXZYBOfkbmFJ1VaHA1VAHjd0pp70oTZzvR+EVrx2Ygfdsq6eu55BHYR8hlcki+n+kERUFG8BrA0BwjeAv2M8WLQBtcy+SD6fNsmnB3AlBLrgTtVW1c2QN4bVWLATaIS60J2Du5y1TiJgjSBvFVZgTmwCU+dAZFoPxGEEs8nyHC9Bwe2GvEJv2WXZb0vjdyFT4Cxk3e/kIqlOGoVLwwPevpYHT+00T+hWwXDf4AJAOUqWcDhbwAAAAASUVORK5CYII=);background-color:#31708f;color:#d9edf7;border-color:#bce8f1}.jq-icon-warning{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABgAAAAYCAYAAADgdz34AAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAGYSURBVEhL5ZSvTsNQFMbXZGICMYGYmJhAQIJAICYQPAACiSDB8AiICQQJT4CqQEwgJvYASAQCiZiYmJhAIBATCARJy+9rTsldd8sKu1M0+dLb057v6/lbq/2rK0mS/TRNj9cWNAKPYIJII7gIxCcQ51cvqID+GIEX8ASG4B1bK5gIZFeQfoJdEXOfgX4QAQg7kH2A65yQ87lyxb27sggkAzAuFhbbg1K2kgCkB1bVwyIR9m2L7PRPIhDUIXgGtyKw575yz3lTNs6X4JXnjV+LKM/m3MydnTbtOKIjtz6VhCBq4vSm3ncdrD2lk0VgUXSVKjVDJXJzijW1RQdsU7F77He8u68koNZTz8Oz5yGa6J3H3lZ0xYgXBK2QymlWWA+RWnYhskLBv2vmE+hBMCtbA7KX5drWyRT/2JsqZ2IvfB9Y4bWDNMFbJRFmC9E74SoS0CqulwjkC0+5bpcV1CZ8NMej4pjy0U+doDQsGyo1hzVJttIjhQ7GnBtRFN1UarUlH8F3xict+HY07rEzoUGPlWcjRFRr4/gChZgc3ZL2d8oAAAAASUVORK5CYII=);background-color:#8a6d3b;color:#fcf8e3;border-color:#faebcc}.jq-icon-error{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABgAAAAYCAYAAADgdz34AAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAHOSURBVEhLrZa/SgNBEMZzh0WKCClSCKaIYOED+AAKeQQLG8HWztLCImBrYadgIdY+gIKNYkBFSwu7CAoqCgkkoGBI/E28PdbLZmeDLgzZzcx83/zZ2SSXC1j9fr+I1Hq93g2yxH4iwM1vkoBWAdxCmpzTxfkN2RcyZNaHFIkSo10+8kgxkXIURV5HGxTmFuc75B2RfQkpxHG8aAgaAFa0tAHqYFfQ7Iwe2yhODk8+J4C7yAoRTWI3w/4klGRgR4lO7Rpn9+gvMyWp+uxFh8+H+ARlgN1nJuJuQAYvNkEnwGFck18Er4q3egEc/oO+mhLdKgRyhdNFiacC0rlOCbhNVz4H9FnAYgDBvU3QIioZlJFLJtsoHYRDfiZoUyIxqCtRpVlANq0EU4dApjrtgezPFad5S19Wgjkc0hNVnuF4HjVA6C7QrSIbylB+oZe3aHgBsqlNqKYH48jXyJKMuAbiyVJ8KzaB3eRc0pg9VwQ4niFryI68qiOi3AbjwdsfnAtk0bCjTLJKr6mrD9g8iq/S/B81hguOMlQTnVyG40wAcjnmgsCNESDrjme7wfftP4P7SP4N3CJZdvzoNyGq2c/HWOXJGsvVg+RA/k2MC/wN6I2YA2Pt8GkAAAAASUVORK5CYII=);background-color:#a94442;color:#f2dede;border-color:#ebccd1}.jq-icon-success{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABgAAAAYCAYAAADgdz34AAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAADsSURBVEhLY2AYBfQMgf///3P8+/evAIgvA/FsIF+BavYDDWMBGroaSMMBiE8VC7AZDrIFaMFnii3AZTjUgsUUWUDA8OdAH6iQbQEhw4HyGsPEcKBXBIC4ARhex4G4BsjmweU1soIFaGg/WtoFZRIZdEvIMhxkCCjXIVsATV6gFGACs4Rsw0EGgIIH3QJYJgHSARQZDrWAB+jawzgs+Q2UO49D7jnRSRGoEFRILcdmEMWGI0cm0JJ2QpYA1RDvcmzJEWhABhD/pqrL0S0CWuABKgnRki9lLseS7g2AlqwHWQSKH4oKLrILpRGhEQCw2LiRUIa4lwAAAABJRU5ErkJggg==);color:#dff0d8;background-color:#3c763d;border-color:#d6e9c6}

316
web/css/light.css Normal file
View File

@@ -0,0 +1,316 @@
*:focus {
outline: 0;
}
.info-icon {
width: 1rem;
margin-right: 0.2rem;
cursor: pointer;
color: #757575;
line-height: 1rem;
height: 1rem;
}
.info-icon:hover {
color: inherit;
}
.modal-title {
max-width: calc(100% - 2rem);
overflow: hidden;
text-overflow: ellipsis;
}
.path-row {
display: -ms-flexbox;
display: flex;
-ms-flex-align: start;
align-items: flex-start;
}
.tag-container {
margin-left: 0.3rem;
}
.path-line {
color: #444;
text-overflow: ellipsis;
overflow: hidden;
}
body {
overflow-y: scroll;
}
.progress {
margin-top: 1em;
}
.card {
margin-top: 1em;
box-shadow: 0 .125rem .25rem rgba(0, 0, 0, .075) !important;
}
.sub-document {
background: #AB47BC1F !important;
}
.navbar-brand {
font-size: 1.75rem;
padding: 0;
}
.navbar {
background: #F7F7F7;
border-bottom: solid 1px #dfdfdf;
}
.document {
padding: 0.5rem;
}
.document p {
margin-bottom: 0;
}
.document:hover p {
text-decoration: underline;
}
.badge-video {
color: #FFFFFF;
background-color: #F27761;
}
.badge-image {
color: #FFFFFF;
background-color: #AA99C9;
}
.badge-audio {
color: #FFFFFF;
background-color: #00ADEF;
}
.badge-resolution {
color: #212529;
background-color: #FFC107;
}
.badge-user {
color: #212529;
background-color: #e0e0e0;
}
.badge-text {
color: #FFFFFF;
background-color: #FAAB3C;
}
.card-img-overlay {
pointer-events: none;
padding: 0.75rem;
bottom: unset;
top: 0;
left: unset;
right: unset;
}
.file-title {
width: 100%;
line-height: 1rem;
height: 1.1rem;
font-size: 10pt;
white-space: nowrap;
text-overflow: ellipsis;
overflow: hidden;
}
.badge {
margin-right: 3px;
}
.fit {
display: block;
min-width: 64px;
max-width: 100%;
max-height: 175px;
margin: 0 auto 0;
padding: 3px 3px 0 3px;
width: auto;
height: auto;
}
.fit-sm {
display: block;
max-width: 64px;
max-height: 64px;
margin: 0 auto 0;
width: auto;
height: auto;
}
.audio-fit {
height: 39px;
vertical-align: bottom;
display: inline;
width: 100%;
}
@media (min-width: 1200px) {
.card-columns {
column-count: 4;
}
}
@media (min-width: 1500px) {
.container {
max-width: 1440px;
}
.card-columns {
column-count: 5;
}
}
@media (min-width: 1800px) {
.container {
max-width: 1550px;
}
}
mark {
background: #fff217;
border-radius: 0;
padding: 1px 0;
color: inherit;
}
.content-div {
font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
font-size: 13px;
padding: 1em;
background-color: #f5f5f5;
border: 1px solid #ccc;
border-radius: 4px;
margin: 3px;
white-space: normal;
color: #000;
}
.irs-single, .irs-from, .irs-to {
font-size: 13px;
}
.irs-slider {
cursor: col-resize;
}
.custom-select {
overflow: auto;
}
.irs {
margin-top: 1em;
margin-bottom: 1em;
}
.inspire-tree .selected > .wholerow, .inspire-tree .selected > .title-wrap:hover + .wholerow {
background: none;
}
.inspire-tree {
font-weight: 400;
font-size: 14px;
font-family: Helvetica, Nueue, Verdana, sans-serif;
max-height: 350px;
overflow: auto;
}
.page-indicator {
line-height: 1rem;
padding: 0.5rem;
background: #f8f9fa;
margin-top: 1em;
}
.btn-xs {
padding: .1rem .3rem;
font-size: .875rem;
border-radius: .2rem;
}
.nav {
margin-top: 0.5rem;
}
@media (max-width: 800px) {
#treeTabs {
flex-basis: inherit;
flex-grow: inherit;
}
}
.list-group {
margin-top: 1em;
}
.list-group-item {
padding: .25rem 0.5rem;
}
.wrapper-sm {
min-width: 64px;
}
.media-expanded {
display: inherit;
}
.media-expanded .fit {
max-height: 250px;
}
@media (max-width: 600px) {
.media-expanded .fit {
max-height: none;
}
.tagline {
display: none;
}
}
.version {
color: #007bff;
margin-left: -18px;
margin-top: -14px;
font-size: 11px;
}
@media (min-width: 800px) {
.small-btn {
display: none;
}
.large-btn {
display: inherit;
}
}
@media (max-width: 801px) {
.small-btn {
display: inherit;
}
.large-btn {
display: none;
}
}
#searchBar {
border-right: none;
}
#pathTree .title {
cursor: pointer;
}

View File

@@ -1,168 +0,0 @@
body {overflow-y:scroll;}
.progress {
margin-top: 1em;
}
.card {
margin-top: 1em;
}
.navbar-brand {
font-size: 1.75rem;
padding: 0;
}
.navbar {
background: #F7F7F7; border-bottom: solid 1px #dfdfdf;
}
.document {
padding: 0.5rem;
}
.document p {
margin-bottom: 0;
}
.document:hover p {
text-decoration: underline;
}
.badge-video {
color: #FFFFFF;
background-color: #F27761;
}
.badge-image {
color: #FFFFFF;
background-color: #AA99C9;
}
.badge-audio {
color: #FFFFFF;
background-color: #00ADEF;
}
.badge-resolution {
color: #212529;
background-color: #FFC107;
}
.badge-text {
color: #FFFFFF;
background-color: #FAAB3C;
}
.card-img-overlay {
pointer-events: none;
padding: 0.75rem;
bottom: unset;
top: 0;
left: unset;
right: unset;
}
.file-title {
font-size: 10pt;
white-space: nowrap;
text-overflow: ellipsis;
overflow: hidden;
}
.badge {
margin-right: 3px;
}
.fit {
display: block;
min-width: 64px;
max-width: 100%;
max-height: 175px;
margin: 0 auto 0;
padding: 3px 3px 0 3px;
width: auto;
height: auto;
}
.audio-fit {
height: 39px;
vertical-align: bottom;
display: inline;
}
@media (min-width: 1200px) {
.card-columns {
column-count: 4;
}
}
@media (min-width: 1500px) {
.container {
max-width: 1440px;
}
.card-columns {
column-count: 5;
}
}
@media (min-width: 1800px) {
.container {
max-width: 1550px;
}
}
mark {
background: #fff217;
border-radius: 0;
padding: 1px 0;
}
.content-div {
font-family: SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;
font-size: 13px;
padding: 1em;
background-color: #f5f5f5;
border: 1px solid #ccc;
border-radius: 4px;
margin: 3px;
}
.irs-single, .irs-from, .irs-to {
font-size: 13px;
}
.irs-slider {
cursor: col-resize;
}
.custom-select {
overflow: auto;
}
.irs {
margin-top: 1em;
margin-bottom: 1em;
}
.inspire-tree .selected > .wholerow, .inspire-tree .selected > .title-wrap:hover + .wholerow
{
background: none;
}
.inspire-tree {
font-weight: 400;
font-size: 14px;
font-family: Helvetica, Nueue, Verdana, sans-serif;
max-height: 350px;
overflow: auto;
}
.page-indicator {
line-height: 1rem;
padding: 0.5rem;
}
.btn-xs {
padding: .1rem .3rem;
font-size: .875rem;
border-radius: .2rem;
}

1
web/css/smartphoto.min.css vendored Normal file

File diff suppressed because one or more lines are too long

Binary file not shown.

Before

Width:  |  Height:  |  Size: 8.3 KiB

Binary file not shown.

After

Width:  |  Height:  |  Size: 595 B

5
web/js/1_popper.min.js vendored Normal file

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

1
web/js/7_jquery.toast.min.js vendored Normal file

File diff suppressed because one or more lines are too long

File diff suppressed because one or more lines are too long

View File

@@ -75,39 +75,157 @@ function shouldPlayVideo(hit) {
return videoc !== "hevc" && videoc !== "mpeg2video" && videoc !== "wmv3"; return videoc !== "hevc" && videoc !== "mpeg2video" && videoc !== "wmv3";
} }
/** function shouldDisplayRawImage(hit) {
* return hit["_source"]["mime"] && hit["_source"]["mime"].startsWith("image/") && hit["_source"]["videoc"] !== "tiff";
* @param hit }
* @returns {Element}
*/
function createDocCard(hit) {
let docCard = document.createElement("div");
docCard.setAttribute("class", "card shadow-sm");
let docCardBody = document.createElement("div"); function makePlaceholder(w, h, small) {
docCardBody.setAttribute("class", "card-body document"); let calc;
if (small) {
calc = w > h
? (64 / w / h) >= 100
? (64 * w / h)
: 64
: 64;
} else {
calc = w > h
? (175 / w / h) >= 272
? (175 * w / h)
: 175
: 175;
}
let link = document.createElement("a"); const el = document.createElement("div");
link.setAttribute("href", "f/" + hit["_id"]); el.setAttribute("style", `height: ${calc}px`);
link.setAttribute("target", "_blank"); return el;
}
//Title function ext(hit) {
let title = document.createElement("p"); return hit["_source"].hasOwnProperty("extension") && hit["_source"]["extension"] !== "" ? "." + hit["_source"]["extension"] : "";
}
function makeTitle(hit) {
let title = document.createElement("div");
title.setAttribute("class", "file-title"); title.setAttribute("class", "file-title");
let extension = hit["_source"].hasOwnProperty("extension") && hit["_source"]["extension"] !== "" ? "." + hit["_source"]["extension"] : ""; let extension = ext(hit);
applyNameToTitle(hit, title, extension); applyNameToTitle(hit, title, extension);
title.setAttribute("title", hit["_source"]["path"] + "/" + hit["_source"]["name"] + extension); title.setAttribute("title", hit["_source"]["path"] + "/" + hit["_source"]["name"] + extension);
docCard.appendChild(title); return title;
}
function getTags(hit, mimeCategory) {
let tags = [];
switch (mimeCategory) {
case "video":
case "image":
if (hit["_source"].hasOwnProperty("videoc") && hit["_source"]["videoc"]) {
const formatTag = document.createElement("span");
formatTag.setAttribute("class", "badge badge-pill badge-video");
formatTag.appendChild(document.createTextNode(hit["_source"]["videoc"].replace(" ", "")));
tags.push(formatTag);
}
break;
case "audio": {
if (hit["_source"].hasOwnProperty("audioc") && hit["_source"]["audioc"]) {
let formatTag = document.createElement("span");
formatTag.setAttribute("class", "badge badge-pill badge-audio");
formatTag.appendChild(document.createTextNode(hit["_source"]["audioc"]));
tags.push(formatTag);
}
}
break;
}
// User tags
if (hit["_source"].hasOwnProperty("tag")) {
hit["_source"]["tag"].forEach(tag => {
const userTag = document.createElement("span");
userTag.setAttribute("class", "badge badge-pill badge-user");
const tokens = tag.split("#");
if (tokens.length > 1) {
const bg = "#" + tokens[1];
const fg = lum(tokens[1]) > 40 ? "#000" : "#fff";
userTag.setAttribute("style", `background-color: ${bg}; color: ${fg}`);
}
const name = tokens[0].split(".")[tokens[0].split(".").length - 1];
userTag.appendChild(document.createTextNode(name));
tags.push(userTag);
})
}
return tags
}
function infoButtonCb(hit) {
return () => {
getDocumentInfo(hit["_id"]).then(doc => {
$("#modal-title").text(doc["name"] + ext(hit));
const tbody = $("<tbody>");
$("#modal-body").empty()
.append($("<table class='table table-sm'>")
.append($("<thead>")
.append($("<tr>")
.append($("<th>").text("Field"))
.append($("<th>").text("Value"))
)
)
.append(tbody)
);
const displayFields = new Set([
"mime", "size", "mtime", "path", "title", "width", "height", "duration", "audioc", "videoc",
"bitrate", "artist", "album", "album_artist", "genre", "title", "font_name", "tag"
]);
Object.keys(doc)
.filter(key => key.startsWith("_keyword.") || key.startsWith("_text.") || displayFields.has(key) || key.startsWith("exif_"))
.forEach(key => {
tbody.append($("<tr>")
.append($("<td>").text(key))
.append($("<td>").text(doc[key]))
);
});
if (doc.hasOwnProperty("content") && doc["content"]) {
$("#modal-body").append($("<div class='content-div'>").text(doc["content"]))
}
$("#modal").modal();
});
}
}
function createDocCard(hit) {
let docCard = document.createElement("div");
docCard.setAttribute("class", "card");
let docCardBody = document.createElement("div");
docCardBody.setAttribute("class", "card-body document");
//Title
let title = makeTitle(hit);
let isSubDocument = false;
let link = document.createElement("a");
link.setAttribute("href", "f/" + hit["_id"]);
link.setAttribute("target", "_blank");
link.style.maxWidth = "calc(100% - 1.2rem)";
link.appendChild(title);
if (hit["_source"].hasOwnProperty("parent")) {
docCard.classList.add("sub-document");
isSubDocument = true;
}
let tagContainer = document.createElement("div"); let tagContainer = document.createElement("div");
tagContainer.setAttribute("class", "card-text"); tagContainer.setAttribute("class", "card-text");
if (hit["_source"].hasOwnProperty("mime") && hit["_source"]["mime"] !== null) { if (hit["_source"].hasOwnProperty("mime") && hit["_source"]["mime"] !== null) {
let tags = [];
let thumbnail = null;
let thumbnailOverlay = null; let thumbnailOverlay = null;
let imgWrapper = document.createElement("div"); let imgWrapper = document.createElement("div");
imgWrapper.setAttribute("style", "position: relative"); imgWrapper.setAttribute("style", "position: relative");
@@ -115,27 +233,7 @@ function createDocCard(hit) {
let mimeCategory = hit["_source"]["mime"].split("/")[0]; let mimeCategory = hit["_source"]["mime"].split("/")[0];
//Thumbnail //Thumbnail
if (mimeCategory === "video" && shouldPlayVideo(hit)) { let thumbnail = makeThumbnail(mimeCategory, hit, imgWrapper, false);
thumbnail = document.createElement("video");
addVidSrc("f/" + hit["_id"], hit["_source"]["mime"], thumbnail);
thumbnail.setAttribute("class", "fit");
thumbnail.setAttribute("loop", "");
thumbnail.setAttribute("controls", "");
thumbnail.setAttribute("preload", "none");
thumbnail.setAttribute("poster", `t/${hit["_source"]["index"]}/${hit["_id"]}`);
thumbnail.addEventListener("dblclick", function () {
thumbnail.webkitRequestFullScreen();
});
} else if ((hit["_source"].hasOwnProperty("width") && hit["_source"]["width"] > 20 && hit["_source"]["height"] > 20)
|| hit["_source"]["mime"] === "application/pdf"
|| hit["_source"]["mime"] === "application/x-cbz"
|| hit["_source"].hasOwnProperty("font_name")
) {
thumbnail = document.createElement("img");
thumbnail.setAttribute("class", "card-img-top fit");
thumbnail.setAttribute("src", `t/${hit["_source"]["index"]}/${hit["_id"]}`);
}
//Thumbnail overlay //Thumbnail overlay
switch (mimeCategory) { switch (mimeCategory) {
@@ -145,15 +243,17 @@ function createDocCard(hit) {
thumbnailOverlay.setAttribute("class", "card-img-overlay"); thumbnailOverlay.setAttribute("class", "card-img-overlay");
//Resolution //Resolution
let resolutionBadge = document.createElement("span"); if (hit["_source"].hasOwnProperty("width") && hit["_source"]["width"] > 32 && hit["_source"]["height"] > 32) {
resolutionBadge.setAttribute("class", "badge badge-resolution"); let resolutionBadge = document.createElement("span");
if (hit["_source"].hasOwnProperty("width")) { resolutionBadge.setAttribute("class", "badge badge-resolution");
resolutionBadge.appendChild(document.createTextNode(hit["_source"]["width"] + "x" + hit["_source"]["height"])); if (hit["_source"].hasOwnProperty("width")) {
resolutionBadge.appendChild(document.createTextNode(hit["_source"]["width"] + "x" + hit["_source"]["height"]));
}
thumbnailOverlay.appendChild(resolutionBadge);
} }
thumbnailOverlay.appendChild(resolutionBadge);
// Hover // Hover
if (thumbnail && hit["_source"]["videoc"] === "gif") { if (thumbnail && hit["_source"]["videoc"] === "gif" && !isSubDocument) {
gifOver(thumbnail, hit); gifOver(thumbnail, hit);
} }
break; break;
@@ -163,51 +263,34 @@ function createDocCard(hit) {
if (hit["_source"].hasOwnProperty("duration")) { if (hit["_source"].hasOwnProperty("duration")) {
thumbnailOverlay = document.createElement("div"); thumbnailOverlay = document.createElement("div");
thumbnailOverlay.setAttribute("class", "card-img-overlay"); thumbnailOverlay.setAttribute("class", "card-img-overlay");
let durationBadge = document.createElement("span"); const durationBadge = document.createElement("span");
durationBadge.setAttribute("class", "badge badge-resolution"); durationBadge.setAttribute("class", "badge badge-resolution");
durationBadge.appendChild(document.createTextNode(humanTime(hit["_source"]["duration"]))); durationBadge.appendChild(document.createTextNode(humanTime(hit["_source"]["duration"])));
thumbnailOverlay.appendChild(durationBadge); thumbnailOverlay.appendChild(durationBadge);
} }
} }
//Tags // Tags
switch (mimeCategory) { let tags = getTags(hit, mimeCategory);
case "video": for (let i = 0; i < tags.length; i++) {
case "image": tagContainer.appendChild(tags[i]);
if (hit["_source"].hasOwnProperty("videoc")) {
let formatTag = document.createElement("span");
formatTag.setAttribute("class", "badge badge-pill badge-video");
formatTag.appendChild(document.createTextNode(hit["_source"]["videoc"].replace(" ", "")));
tags.push(formatTag);
}
break;
case "audio": {
if (hit["_source"].hasOwnProperty("audioc")) {
let formatTag = document.createElement("span");
formatTag.setAttribute("class", "badge badge-pill badge-audio");
formatTag.appendChild(document.createTextNode(hit["_source"]["audioc"]));
tags.push(formatTag);
}
}
break;
} }
//Content //Content
let contentHl = getContentHighlight(hit); let contentHl = getContentHighlight(hit);
if (contentHl !== undefined) { if (contentHl !== undefined) {
let contentDiv = document.createElement("div"); const contentDiv = document.createElement("div");
contentDiv.setAttribute("class", "content-div bg-light"); contentDiv.setAttribute("class", "content-div");
contentDiv.insertAdjacentHTML('afterbegin', contentHl); contentDiv.insertAdjacentHTML('afterbegin', contentHl);
docCard.appendChild(contentDiv); docCard.appendChild(contentDiv);
} }
if (thumbnail !== null) { if (thumbnail !== null) {
imgWrapper.appendChild(thumbnail);
docCard.appendChild(imgWrapper); docCard.appendChild(imgWrapper);
} }
//Audio //Audio
if (mimeCategory === "audio" && hit["_source"].hasOwnProperty("audioc")) { if (mimeCategory === "audio" && hit["_source"].hasOwnProperty("audioc") && !isSubDocument) {
let audio = document.createElement("audio"); let audio = document.createElement("audio");
audio.setAttribute("preload", "none"); audio.setAttribute("preload", "none");
@@ -222,10 +305,6 @@ function createDocCard(hit) {
if (thumbnailOverlay !== null) { if (thumbnailOverlay !== null) {
imgWrapper.appendChild(thumbnailOverlay); imgWrapper.appendChild(thumbnailOverlay);
} }
for (let i = 0; i < tags.length; i++) {
tagContainer.appendChild(tags[i]);
}
} }
//Size tag //Size tag
@@ -234,15 +313,196 @@ function createDocCard(hit) {
sizeTag.setAttribute("class", "text-muted"); sizeTag.setAttribute("class", "text-muted");
tagContainer.appendChild(sizeTag); tagContainer.appendChild(sizeTag);
docCardBody.appendChild(link); const titleWrapper = document.createElement("div");
titleWrapper.style.display = "flex";
const infoButton = makeInfoButton(hit);
titleWrapper.appendChild(infoButton);
titleWrapper.appendChild(link);
docCardBody.appendChild(titleWrapper);
docCard.appendChild(docCardBody); docCard.appendChild(docCardBody);
link.appendChild(title);
docCardBody.appendChild(tagContainer); docCardBody.appendChild(tagContainer);
return docCard; return docCard;
} }
function makeThumbnail(mimeCategory, hit, imgWrapper, small) {
let thumbnail;
let isSubDocument = hit["_source"].hasOwnProperty("parent");
if (mimeCategory === "video" && shouldPlayVideo(hit) && !isSubDocument) {
thumbnail = document.createElement("video");
addVidSrc("f/" + hit["_id"], hit["_source"]["mime"], thumbnail);
const placeholder = makePlaceholder(hit["_source"]["width"], hit["_source"]["height"], small);
imgWrapper.appendChild(placeholder);
if (small) {
thumbnail.setAttribute("class", "fit-sm");
} else {
thumbnail.setAttribute("class", "fit");
}
if (small) {
thumbnail.style.cursor = "pointer";
thumbnail.title = "Enlarge";
thumbnail.addEventListener("click", function () {
imgWrapper.classList.remove("wrapper-sm", "mr-1");
imgWrapper.parentElement.classList.add("media-expanded");
thumbnail.setAttribute("class", "fit");
thumbnail.setAttribute("controls", "");
});
} else {
thumbnail.setAttribute("controls", "");
}
thumbnail.setAttribute("preload", "none");
thumbnail.setAttribute("poster", `t/${hit["_source"]["index"]}/${hit["_id"]}`);
thumbnail.addEventListener("dblclick", function () {
thumbnail.setAttribute("controls", "");
if (thumbnail.webkitRequestFullScreen) {
thumbnail.webkitRequestFullScreen();
} else {
thumbnail.requestFullscreen();
}
});
const poster = new Image();
poster.src = thumbnail.getAttribute('poster');
poster.addEventListener("load", function () {
placeholder.remove();
imgWrapper.appendChild(thumbnail);
});
} else if ((hit["_source"].hasOwnProperty("width") && hit["_source"]["width"] > 32 && hit["_source"]["height"] > 32)
|| hit["_source"]["mime"] === "application/pdf"
|| hit["_source"]["mime"] === "application/epub+zip"
|| hit["_source"]["mime"] === "application/x-cbz"
|| hit["_source"]["mime"] === "application/x-cbr"
|| hit["_source"].hasOwnProperty("font_name")
) {
thumbnail = document.createElement("img");
if (small) {
thumbnail.setAttribute("class", "fit-sm");
} else {
thumbnail.setAttribute("class", "card-img-top fit");
}
thumbnail.setAttribute("src", `t/${hit["_source"]["index"]}/${hit["_id"]}`);
if (!hit["_source"]["parent"] && shouldDisplayRawImage(hit)) {
imgWrapper.setAttribute("id", "sp" + hit["_id"]);
imgWrapper.setAttribute("data-src", `t/${hit["_source"]["index"]}/${hit["_id"]}`);
imgWrapper.setAttribute("href", `f/${hit["_id"]}`);
imgWrapper.setAttribute("data-caption", hit["_source"]["path"] + "/" + hit["_source"]["name"] + ext(hit));
imgWrapper.setAttribute("data-group", "p" + Math.floor(docCount / SIZE));
imgWrapper.classList.add("sp");
}
const placeholder = makePlaceholder(hit["_source"]["width"], hit["_source"]["height"], small);
imgWrapper.appendChild(placeholder);
thumbnail.addEventListener("error", () => {
imgWrapper.remove();
});
thumbnail.addEventListener("load", () => {
placeholder.remove();
imgWrapper.appendChild(thumbnail);
});
}
return thumbnail;
}
function makeInfoButton(hit) {
const infoButton = document.createElement("span");
infoButton.appendChild(document.createTextNode("🛈"));
infoButton.setAttribute("class", "info-icon");
infoButton.addEventListener("click", infoButtonCb(hit));
return infoButton;
}
function createDocLine(hit) {
const mime = hit["_source"]["mime"];
let mimeCategory = mime ? mime.split("/")[0] : null;
let tags = getTags(hit, mimeCategory);
let imgWrapper = document.createElement("div");
imgWrapper.setAttribute("class", "align-self-start mr-1 wrapper-sm");
let media = document.createElement("div");
media.setAttribute("class", "media");
const line = document.createElement("div");
line.setAttribute("class", "list-group-item flex-column align-items-start");
if (hit["_source"].hasOwnProperty("parent")) {
line.classList.add("sub-document");
isSubDocument = true;
}
const infoButton = makeInfoButton(hit);
const title = makeTitle(hit);
let link = document.createElement("a");
link.setAttribute("href", "f/" + hit["_id"]);
link.setAttribute("target", "_blank");
link.appendChild(title);
const titleDiv = document.createElement("div");
const titleWrapper = document.createElement("div");
titleWrapper.style.display = "flex";
titleWrapper.appendChild(infoButton);
titleWrapper.appendChild(link);
titleDiv.appendChild(titleWrapper);
line.appendChild(media);
let thumbnail = makeThumbnail(mimeCategory, hit, imgWrapper, true);
if (thumbnail) {
media.appendChild(imgWrapper);
}
media.appendChild(titleDiv);
// Content
let contentHl = getContentHighlight(hit);
if (contentHl !== undefined) {
const contentDiv = document.createElement("div");
contentDiv.setAttribute("class", "content-div");
contentDiv.insertAdjacentHTML('afterbegin', contentHl);
titleDiv.appendChild(contentDiv);
}
let pathLine = document.createElement("div");
pathLine.setAttribute("class", "path-row");
let path = document.createElement("div");
path.setAttribute("class", "path-line");
path.setAttribute("title", hit["_source"]["path"] + "/");
path.appendChild(document.createTextNode(hit["_source"]["path"] + "/"));
let tagContainer = document.createElement("div");
tagContainer.setAttribute("class", "tag-container");
for (let i = 0; i < tags.length; i++) {
tagContainer.appendChild(tags[i]);
}
//Size tag
let sizeTag = document.createElement("small");
sizeTag.appendChild(document.createTextNode(humanFileSize(hit["_source"]["size"])));
sizeTag.setAttribute("class", "text-muted");
tagContainer.appendChild(sizeTag);
titleDiv.appendChild(pathLine);
pathLine.appendChild(path);
pathLine.appendChild(tagContainer);
return line;
}
function makePreloader() { function makePreloader() {
const elem = document.createElement("div"); const elem = document.createElement("div");
elem.setAttribute("class", "progress"); elem.setAttribute("class", "progress");
@@ -256,9 +516,8 @@ function makePreloader() {
function makePageIndicator(searchResult) { function makePageIndicator(searchResult) {
let pageIndicator = document.createElement("div"); let pageIndicator = document.createElement("div");
pageIndicator.setAttribute("class", "page-indicator shadow-sm bg-light font-weight-light"); pageIndicator.setAttribute("class", "page-indicator font-weight-light");
const totalHits = searchResult["hits"]["total"].hasOwnProperty("value") const totalHits = searchResult["aggregations"]["total_count"]["value"];
? searchResult["hits"]["total"]["value"] : searchResult["hits"]["total"];
pageIndicator.appendChild(document.createTextNode(docCount + " / " + totalHits)); pageIndicator.appendChild(document.createTextNode(docCount + " / " + totalHits));
return pageIndicator; return pageIndicator;
} }
@@ -267,18 +526,56 @@ function makePageIndicator(searchResult) {
function makeStatsCard(searchResult) { function makeStatsCard(searchResult) {
let statsCard = document.createElement("div"); let statsCard = document.createElement("div");
statsCard.setAttribute("class", "card"); statsCard.setAttribute("class", "card stat");
let statsCardBody = document.createElement("div"); let statsCardBody = document.createElement("div");
statsCardBody.setAttribute("class", "card-body"); statsCardBody.setAttribute("class", "card-body");
let stat = document.createElement("p"); const resultMode = document.createElement("div");
const totalHits = searchResult["hits"]["total"].hasOwnProperty("value") resultMode.setAttribute("class", "btn-group btn-group-toggle");
? searchResult["hits"]["total"]["value"] : searchResult["hits"]["total"]; resultMode.setAttribute("data-toggle", "buttons");
resultMode.style.cssFloat = "right";
const listMode = document.createElement("label");
listMode.setAttribute("class", "btn btn-primary");
listMode.appendChild(document.createTextNode("List"));
const gridMode = document.createElement("label");
gridMode.setAttribute("class", "btn btn-primary");
gridMode.appendChild(document.createTextNode("Grid"));
resultMode.appendChild(gridMode);
resultMode.appendChild(listMode);
if (CONF.options.display === "grid") {
gridMode.classList.add("active")
} else {
listMode.classList.add("active")
}
gridMode.addEventListener("click", () => {
console.log("what");
console.log(CONF.options);
CONF.options.display = "grid";
console.log(CONF.options);
CONF.save();
console.log(CONF.options);
searchDebounced();
});
listMode.addEventListener("click", () => {
CONF.options.display = "list";
CONF.save();
searchDebounced();
});
let stat = document.createElement("span");
const totalHits = searchResult["aggregations"]["total_count"]["value"];
stat.appendChild(document.createTextNode(totalHits + " results in " + searchResult["took"] + "ms")); stat.appendChild(document.createTextNode(totalHits + " results in " + searchResult["took"] + "ms"));
statsCardBody.appendChild(stat); statsCardBody.appendChild(stat);
statsCardBody.appendChild(resultMode);
if (totalHits !== 0) { if (totalHits !== 0) {
let sizeStat = document.createElement("span"); let sizeStat = document.createElement("div");
sizeStat.appendChild(document.createTextNode(humanFileSize(searchResult["aggregations"]["total_size"]["value"]))); sizeStat.appendChild(document.createTextNode(humanFileSize(searchResult["aggregations"]["total_size"]["value"])));
statsCardBody.appendChild(sizeStat); statsCardBody.appendChild(sizeStat);
} }
@@ -290,7 +587,11 @@ function makeStatsCard(searchResult) {
function makeResultContainer() { function makeResultContainer() {
let resultContainer = document.createElement("div"); let resultContainer = document.createElement("div");
resultContainer.setAttribute("class", "card-columns");
if (CONF.options.display === "grid") {
resultContainer.setAttribute("class", "card-columns");
} else {
resultContainer.setAttribute("class", "list-group");
}
return resultContainer; return resultContainer;
} }

56
web/js/jquery-smartphoto.min.js vendored Normal file

File diff suppressed because one or more lines are too long

View File

@@ -1,14 +1,64 @@
const SIZE = 40; const SIZE = 40;
let mimeMap = []; let mimeMap = [];
let tree; let tagMap = [];
let mimeTree;
let tagTree;
let searchBar = document.getElementById("searchBar"); let searchBar = document.getElementById("searchBar");
let pathBar = document.getElementById("pathBar"); let pathBar = document.getElementById("pathBar");
let scroll_id = null; let lastDoc = null;
let reachedEnd = false;
let docCount = 0; let docCount = 0;
let coolingDown = false; let coolingDown = false;
let searchBusy = true; let searchBusy = true;
let selectedIndices = []; let selectedIndices = [];
let indexMap = {};
const CONF = new Settings();
const _defaults = {
display: "grid",
fuzzy: true,
highlight: true
};
function Settings() {
this.options = {};
this._onUpdate = function () {
$("#fuzzyToggle").prop("checked", this.options.fuzzy);
}
this.load = function () {
const raw = window.localStorage.getItem("options");
if (raw === null) {
this.options = _defaults;
} else {
this.options = JSON.parse(raw);
}
this._onUpdate();
}
this.save = function () {
window.localStorage.setItem("options", JSON.stringify(this.options));
this._onUpdate();
}
}
function showEsError() {
$.toast({
heading: "Elasticsearch connection error",
text: "sist2 web module encountered an error while connecting " +
"to Elasticsearch. See server logs for more information.",
stack: false,
bgColor: "#a94442",
textColor: "#f2dede",
position: 'bottom-right',
hideAfter: false
});
}
jQuery["jsonPost"] = function (url, data) { jQuery["jsonPost"] = function (url, data) {
return jQuery.ajax({ return jQuery.ajax({
@@ -17,25 +67,76 @@ jQuery["jsonPost"] = function (url, data) {
data: JSON.stringify(data), data: JSON.stringify(data),
contentType: "application/json" contentType: "application/json"
}).fail(err => { }).fail(err => {
showEsError();
console.log(err); console.log(err);
}); });
}; };
function toggleSearchBar() { window.onload = () => {
$("#theme").on("click", () => {
if (!document.cookie.includes("sist")) {
document.cookie = "sist=dark";
} else {
document.cookie = "sist=; Max-Age=-99999999;";
}
window.location.reload();
})
CONF.load();
};
function toggleFuzzy() {
searchDebounced(); searchDebounced();
} }
$.jsonPost("i").then(resp => { $.jsonPost("i").then(resp => {
const urlIndices = (new URLSearchParams(location.search)).get("i");
resp["indices"].forEach(idx => { resp["indices"].forEach(idx => {
$("#indices").append($("<option>") indexMap[idx.id] = idx.name;
const opt = $("<option>")
.attr("value", idx.id) .attr("value", idx.id)
.attr("selected", !idx.name.includes("(nsfw)")) .append(idx.name);
.append(idx.name)
); if (urlIndices) {
selectedIndices.push(idx.id); if (urlIndices.split(",").indexOf(idx.name) !== -1) {
opt.attr("selected", true);
selectedIndices.push(idx.id);
}
} else if (!idx.name.includes("(nsfw)")) {
opt.attr("selected", true);
selectedIndices.push(idx.id);
}
$("#indices").append(opt);
}); });
createPathTree("#pathTree");
}); });
function getDocumentInfo(id) {
return $.getJSON("d/" + id).fail(e => {
console.log(e);
showEsError();
})
}
function handleTreeClick(tree) {
return (event, node, handler) => {
event.preventTreeDefault();
if (node.id === "any") {
if (!node.itree.state.checked) {
tree.deselect();
}
} else {
tree.node("any").deselect();
}
handler();
searchDebounced();
}
}
//TODO: filter based on selected indexes, sort mime types
$.jsonPost("es", { $.jsonPost("es", {
aggs: { aggs: {
mimeTypes: { mimeTypes: {
@@ -72,104 +173,108 @@ $.jsonPost("es", {
}); });
mimeMap.push({"text": "All", "id": "any"}); mimeMap.push({"text": "All", "id": "any"});
tree = new InspireTree({ mimeTree = new InspireTree({
selection: { selection: {
mode: 'checkbox' mode: 'checkbox'
}, },
data: mimeMap data: mimeMap
}); });
new InspireTreeDOM(tree, { new InspireTreeDOM(mimeTree, {
target: '.tree' target: '#mimeTree'
}); });
tree.on("node.click", function (event, node, handler) { mimeTree.on("node.click", handleTreeClick(mimeTree));
event.preventTreeDefault(); mimeTree.deselect();
mimeTree.node("any").select();
});
if (node.id === "any") { // Tags tree
if (!node.itree.state.checked) { $.jsonPost("es", {
tree.deselect(); aggs: {
tags: {
terms: {
field: "tag",
size: 10000
} }
} else {
tree.node("any").deselect();
} }
},
size: 0,
}).then(resp => {
resp["aggregations"]["tags"]["buckets"]
.sort((a, b) => a["key"].localeCompare(b["key"]))
.forEach(bucket => {
addTag(tagMap, bucket["key"], bucket["key"], bucket["doc_count"])
});
handler(); tagMap.push({"text": "All", "id": "any"});
searchDebounced(); tagTree = new InspireTree({
selection: {
mode: 'checkbox'
},
data: tagMap
}); });
tree.select(); new InspireTreeDOM(tagTree, {
tree.node("any").deselect(); target: '#tagTree'
});
tagTree.on("node.click", handleTreeClick(tagTree));
tagTree.node("any").select();
searchBusy = false; searchBusy = false;
}); });
new autoComplete({ function addTag(map, tag, id, count) {
selector: '#pathBar', let tags = tag.split("#")[0].split(".");
minChars: 1,
delay: 75,
renderItem: function (item) {
return '<div class="autocomplete-suggestion" data-val="' + item + '">' + item + '</div>';
},
source: async function (term, suggest) {
term = term.toLowerCase();
const choices = await getPathChoices(); let child = {
id: id,
text: tags.length !== 1 ? tags[0] : `${tags[0]} (${count})`,
children: []
};
let matches = []; let found = false;
for (let i = 0; i < choices.length; i++) { map.forEach(node => {
if (~choices[i].toLowerCase().indexOf(term)) { if (node.text === child.text) {
matches.push(choices[i]); found = true;
if (tags.length !== 1) {
addTag(node.children, tags.slice(1).join("."), id, count);
} }
} }
suggest(matches); });
}, if (!found) {
onSelect: function () { if (tags.length !== 1) {
searchDebounced(); addTag(child.children, tags.slice(1).join("."), id, count);
map.push(child);
} else {
map.push(child);
}
} }
}); }
function insertHits(resultContainer, hits) { function insertHits(resultContainer, hits) {
for (let i = 0; i < hits.length; i++) { for (let i = 0; i < hits.length; i++) {
resultContainer.appendChild(createDocCard(hits[i]));
if (CONF.options.display === "grid") {
resultContainer.appendChild(createDocCard(hits[i]));
} else {
resultContainer.appendChild(createDocLine(hits[i]));
}
docCount++; docCount++;
} }
} }
window.addEventListener("scroll", function () { window.addEventListener("scroll", function () {
if (!coolingDown && !searchBusy) { if (!searchBusy) {
let threshold = 400; let threshold = 400;
if ((window.innerHeight + window.scrollY) >= document.body.offsetHeight - threshold) { if ((window.innerHeight + window.scrollY) >= document.body.offsetHeight - threshold) {
coolingDown = true; if (!reachedEnd) {
doScroll(); coolingDown = true;
search(lastDoc);
}
} }
} }
}); });
function doScroll() { function getSelectedNodes(tree) {
$.get("scroll", {scroll_id: scroll_id}) let selectedNodes = [];
.then(searchResult => {
let searchResults = document.getElementById("searchResults");
let hits = searchResult["hits"]["hits"];
//Page indicator
let pageIndicator = makePageIndicator(searchResult);
searchResults.appendChild(pageIndicator);
//Result container
let resultContainer = makeResultContainer();
searchResults.appendChild(resultContainer);
insertHits(resultContainer, hits);
if (hits.length === SIZE) {
coolingDown = false;
}
})
.fail(() => {
window.location.reload();
})
}
function getSelectedMimeTypes() {
let mimeTypes = [];
let selected = tree.selected(); let selected = tree.selected();
@@ -181,111 +286,142 @@ function getSelectedMimeTypes() {
//Only get children //Only get children
if (selected[i].text.indexOf("(") !== -1) { if (selected[i].text.indexOf("(") !== -1) {
mimeTypes.push(selected[i].id); selectedNodes.push(selected[i].id);
} }
} }
return mimeTypes return selectedNodes
} }
function search() { function search(after = null) {
lastDoc = null;
if (searchBusy) { if (searchBusy) {
return; return;
} }
searchBusy = true; searchBusy = true;
//Clear old search results
let searchResults = document.getElementById("searchResults"); let searchResults = document.getElementById("searchResults");
while (searchResults.firstChild) { //Clear old search results
searchResults.removeChild(searchResults.firstChild); let preload;
if (!after) {
while (searchResults.firstChild) {
searchResults.removeChild(searchResults.firstChild);
}
preload = makePreloader();
searchResults.appendChild(preload);
} }
const preload = makePreloader();
searchResults.appendChild(preload);
let query = searchBar.value; let query = searchBar.value;
let empty = query === ""; let empty = query === "";
let condition = $("#barToggle").prop("checked") && !empty ? "must" : "should"; let condition = empty ? "should" : "must";
let filters = [ let filters = [
{range: {size: {gte: size_min, lte: size_max}}}, {range: {size: {gte: size_min, lte: size_max}}},
{terms: {index: selectedIndices}} {terms: {index: selectedIndices}}
]; ];
let fields = [
"name^8",
"content^3",
"album^8", "artist^8", "title^8", "genre^2", "album_artist^8",
"font_name^6"
];
if ($("#fuzzyToggle").prop("checked")) {
fields.push("content.nGram");
fields.push("name.nGram^3");
}
let path = pathBar.value.replace(/\/$/, "").toLowerCase(); //remove trailing slashes let path = pathBar.value.replace(/\/$/, "").toLowerCase(); //remove trailing slashes
if (path !== "") { if (path !== "") {
filters.push([{term: {path: path}}]) filters.push([{term: {path: path}}])
} }
let mimeTypes = getSelectedMimeTypes(); let mimeTypes = getSelectedNodes(mimeTree);
if (!mimeTypes.includes("any")) { if (!mimeTypes.includes("any")) {
filters.push([{terms: {"mime": mimeTypes}}]); filters.push([{terms: {"mime": mimeTypes}}]);
} }
$.jsonPost("es?scroll=1", { let tags = getSelectedNodes(tagTree);
if (!tags.includes("any")) {
filters.push([{terms: {"tag": tags}}]);
}
let q = {
"_source": { "_source": {
excludes: ["content"] excludes: ["content", "_tie"]
}, },
query: { query: {
bool: { bool: {
[condition]: { [condition]: {
multi_match: { simple_query_string: {
query: query, query: query,
type: "most_fields", fields: fields,
fields: [ default_operator: "and"
"name^8", "name.nGram^3", "content^3",
"content.nGram",
"album^8", "artist^8", "title^8", "genre^2", "album_artist^8",
"font_name^6"
],
operator: "and"
} }
}, },
filter: filters filter: filters
} }
}, },
sort: [ "sort": [
"_score" {"_score": {"order": "desc"}},
{"_tie": {"order": "asc"}}
], ],
highlight: { aggs:
{
total_size: {"sum": {"field": "size"}},
total_count: {"value_count": {"field": "size"}}
},
size: SIZE,
};
if (after) {
q.search_after = [after["_score"], after["_id"]];
}
if (CONF.options.highlight) {
q.highlight = {
pre_tags: ["<mark>"], pre_tags: ["<mark>"],
post_tags: ["</mark>"], post_tags: ["</mark>"],
fields: { fields: {
content: {}, content: {},
// "content.nGram": {},
name: {}, name: {},
"name.nGram": {}, "name.nGram": {},
// font_name: {}, font_name: {},
} }
}, };
aggs: { }
total_size: {"sum": {"field": "size"}}
},
size: SIZE,
}).then(searchResult => {
scroll_id = searchResult["_scroll_id"];
preload.remove(); $.jsonPost("es", q).then(searchResult => {
//Search stats let hits = searchResult["hits"]["hits"];
searchResults.appendChild(makeStatsCard(searchResult)); if (hits) {
lastDoc = hits[hits.length - 1];
}
//Autocomplete if (!after) {
if (searchResult.hasOwnProperty("suggest") && searchResult["suggest"].hasOwnProperty("path")) { preload.remove();
pathAutoComplete = []; searchResults.appendChild(makeStatsCard(searchResult));
for (let i = 0; i < searchResult["suggest"]["path"][0]["options"].length; i++) { } else {
pathAutoComplete.push(searchResult["suggest"]["path"][0]["options"][i].text) let pageIndicator = makePageIndicator(searchResult);
} searchResults.appendChild(pageIndicator);
} }
//Setup page //Setup page
let resultContainer = makeResultContainer(); let resultContainer = makeResultContainer();
searchResults.appendChild(resultContainer); searchResults.appendChild(resultContainer);
docCount = 0; window.setTimeout(() => {
insertHits(resultContainer, searchResult["hits"]["hits"]); $(".sp").SmartPhoto({animationSpeed: 0, swipeTopToClose: true, showAnimation: false, forceInterval: 50});
}, 100);
if (!after) {
docCount = 0;
}
reachedEnd = hits.length !== SIZE;
insertHits(resultContainer, hits);
searchBusy = false; searchBusy = false;
}); });
} }
let pathAutoComplete = [];
let size_min = 0; let size_min = 0;
let size_max = 10000000000000; let size_max = 10000000000000;
@@ -293,8 +429,8 @@ let searchDebounced = _.debounce(function () {
coolingDown = false; coolingDown = false;
search() search()
}, 500); }, 500);
searchBar.addEventListener("keyup", searchDebounced); searchBar.addEventListener("keyup", searchDebounced);
document.getElementById("pathBar").addEventListener("keyup", searchDebounced);
//Size slider //Size slider
$("#sizeSlider").ionRangeSlider({ $("#sizeSlider").ionRangeSlider({
@@ -342,18 +478,136 @@ function updateIndices() {
document.getElementById("indices").addEventListener("change", updateIndices); document.getElementById("indices").addEventListener("change", updateIndices);
updateIndices(); updateIndices();
//Suggest window.onkeyup = function (e) {
function getPathChoices() { if (e.key === "/" || e.key === "Escape") {
return new Promise(getPaths => { const bar = document.getElementById("searchBar");
bar.scrollIntoView();
bar.focus();
}
};
let xhttp = new XMLHttpRequest(); function getNextDepth(node) {
xhttp.onreadystatechange = function () { let q = {
if (this.readyState === 4 && this.status === 200) { query: {
getPaths(JSON.parse(xhttp.responseText)) bool: {
filter: [
{term: {index: node.index}},
{term: {_depth: node.depth + 1}}
]
}
},
aggs: {
paths: {
terms: {
field: "path",
size: 10000
}
}
},
size: 0
}
if (node.depth > 0) {
q.query.bool.must = {
prefix: {
path: node.id,
} }
}; };
xhttp.open("GET", "suggest?prefix=" + pathBar.value, true); }
xhttp.send();
return $.jsonPost("es", q).then(resp => {
const buckets = resp["aggregations"]["paths"]["buckets"];
if (!buckets) {
return false;
}
return buckets
.filter(bucket => bucket.key.length > node.id.length || node.id.startsWith("/"))
.sort((a, b) => a.key > b.key)
.map(bucket => {
const i = bucket.key.lastIndexOf("/");
const name = (i === -1 || i === 1) ? bucket.key : bucket.key.slice(i + 1);
return {
id: bucket.key,
text: `${name}/ (${bucket.doc_count})`,
depth: node.depth + 1,
index: node.index,
children: true,
}
})
})
}
function handlePathTreeClick(tree) {
return (event, node, handler) => {
if (node.depth !== 0) {
$("#pathBar").val(node.id)
$("#pathTreeModal").modal("hide")
searchDebounced();
}
handler();
}
}
function createPathTree(target) {
let pathTree = new InspireTree({
data: function (node, resolve, reject) {
return getNextDepth(node);
}
});
selectedIndices.forEach(index => {
pathTree.addNode({
id: "/" + index,
text: `/[${indexMap[index]}]`,
index: index,
depth: 0,
children: true
})
})
new InspireTreeDOM(pathTree, {
target: target
});
pathTree.on("node.click", handlePathTreeClick(pathTree));
const button = document.querySelector("#pathBarHelper")
const tooltip = document.querySelector("#pathTreeTooltip")
console.log(button)
console.log(tooltip)
Popper.createPopper(button, tooltip ,{
trigger: "click",
placement: "right",
}); });
} }
function updateSettings() {
CONF.options.display = $("#settingDisplay").val();
CONF.options.fuzzy = $("#settingFuzzy").prop("checked");
CONF.options.highlight = $("#settingHighlight").prop("checked");
CONF.save();
searchDebounced();
$.toast({
heading: "Settings updated",
text: "Settings saved to browser storage",
stack: 3,
bgColor: "#00a4bc",
textColor: "#fff",
position: 'bottom-right',
hideAfter: 3000,
loaderBg: "#08c7e8",
});
}
function loadSettings() {
CONF.load();
$("#settingDisplay").val(CONF.options.display);
$("#settingFuzzy").prop("checked", CONF.options.fuzzy);
$("#settingHighlight").prop("checked", CONF.options.highlight);
}

View File

@@ -3,7 +3,7 @@
*/ */
function humanFileSize(bytes) { function humanFileSize(bytes) {
if (bytes === 0) { if (bytes === 0) {
return "? B" return "0 B"
} }
let thresh = 1000; let thresh = 1000;
@@ -43,9 +43,9 @@ function humanTime(sec_num) {
function debounce(func, wait) { function debounce(func, wait) {
let timeout; let timeout;
return function() { return function () {
let context = this, args = arguments; let context = this, args = arguments;
let later = function() { let later = function () {
timeout = null; timeout = null;
func.apply(context, args); func.apply(context, args);
}; };
@@ -54,3 +54,13 @@ function debounce(func, wait) {
func.apply(context, args); func.apply(context, args);
}; };
} }
function lum(c) {
c = c.substring(1);
let rgb = parseInt(c, 16);
let r = (rgb >> 16) & 0xff;
let g = (rgb >> 8) & 0xff;
let b = (rgb >> 0) & 0xff;
return 0.2126 * r + 0.7152 * g + 0.0722 * b;
}

View File

@@ -9,27 +9,46 @@
</head> </head>
<body> <body>
<nav class="navbar navbar-expand-lg navbar-light"> <nav class="navbar navbar-expand-lg">
<a class="navbar-brand" href="/">sist2</a> <a class="navbar-brand" href="/">sist2</a>
<span class="badge badge-pill version">v1.3.0</span>
<span class="tagline">Lightning-fast file system indexer and search tool </span> <span class="tagline">Lightning-fast file system indexer and search tool </span>
<button style="margin-left: auto" class="btn" type="button" data-toggle="modal" data-target="#settings" onclick="loadSettings()">Settings</button>
<a id="theme" class="btn" title="Toggle theme" href="/">Theme</a>
</nav> </nav>
<div class="container"> <div class="container">
<div class="card"> <div class="card">
<div class="card-body"> <div class="card-body">
<div class="form-group"> <div class="form-group">
<input id="pathBar" type="search" class="form-control" placeholder="Filter path"> <div class="input-group">
<div class="input-group-prepend">
<button id="pathBarHelper" class="btn btn-outline-secondary" data-toggle="modal" data-target="#pathTreeModal">
<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 576 512" width="20px"><path d="M288 224h224a32 32 0 0 0 32-32V64a32 32 0 0 0-32-32H400L368 0h-80a32 32 0 0 0-32 32v64H64V8a8 8 0 0 0-8-8H40a8 8 0 0 0-8 8v392a16 16 0 0 0 16 16h208v64a32 32 0 0 0 32 32h224a32 32 0 0 0 32-32V352a32 32 0 0 0-32-32H400l-32-32h-80a32 32 0 0 0-32 32v64H64V128h192v64a32 32 0 0 0 32 32zm0 96h66.74l32 32H512v128H288zm0-288h66.74l32 32H512v128H288z"/></svg>
</button>
</div>
<input id="pathBar" type="search" class="form-control" placeholder="Filter path">
</div>
</div> </div>
<div class="input-group"> <div class="input-group">
<div class="input-group-prepend"> <div class="input-group-prepend">
<div class="input-group-text"> <div class="input-group-text">
<span onclick="document.getElementById('barToggle').click()">Must match&nbsp</span> <span title="Toggle fuzzy searching" onclick="document.getElementById('fuzzyToggle').click()">Fuzzy&nbsp</span>
<input title="Toggle between 'Should' and 'Must' match mode" type="checkbox" id="barToggle" <input title="Toggle fuzzy searching" type="checkbox" id="fuzzyToggle"
onclick="toggleSearchBar()" checked> onclick="toggleFuzzy()" checked>
</div> </div>
</div> </div>
<input id="searchBar" type="search" class="form-control" placeholder="Search"> <input id="searchBar" type="search" class="form-control" placeholder="Search">
<div class="input-group-append">
<button class="btn btn-outline-secondary small-btn" type="button" data-toggle="modal"
data-target="#help">?
</button>
<button class="btn btn-outline-secondary large-btn" type="button" data-toggle="modal"
data-target="#help">Help
</button>
</div>
</div> </div>
<input title="File size" id="sizeSlider" name="size"> <input title="File size" id="sizeSlider" name="size">
@@ -40,10 +59,152 @@
<select class="custom-select" id="indices" multiple size="6"></select> <select class="custom-select" id="indices" multiple size="6"></select>
</div> </div>
<div class="col"> <div class="col" id="treeTabs">
<label>Mime types</label> <ul class="nav nav-tabs" role="tablist">
<li class="nav-item">
<a class="nav-link active" data-toggle="tab" href="#mime" role="tab" aria-controls="home"
aria-selected="true">Mime Types</a>
</li>
<li class="nav-item">
<a class="nav-link" data-toggle="tab" href="#tag" role="tab" aria-controls="profile"
aria-selected="false" title="User-defined tags">Tags</a>
</li>
</ul>
<div class="tab-content" id="myTabContent">
<div class="tab-pane fade show active" id="mime" role="tabpanel" aria-labelledby="home-tab">
<div id="mimeTree" class="tree"></div>
</div>
<div class="tab-pane fade" id="tag" role="tabpanel" aria-labelledby="profile-tab">
<div id="tagTree" class="tree"></div>
</div>
</div>
</div>
<div class="tree"></div> </div>
</div>
</div>
<div class="modal" id="modal" tabindex="-1" role="dialog" aria-labelledby="modal-title" aria-hidden="true">
<div class="modal-dialog modal-lg modal-dialog-centered" role="document">
<div class="modal-content">
<div class="modal-header">
<h5 class="modal-title" id="modal-title"></h5>
<button type="button" class="close" data-dismiss="modal" aria-label="Close">
<span aria-hidden="true">&times;</span>
</button>
</div>
<div class="modal-body" id="modal-body"></div>
</div>
</div>
</div>
<div class="modal" id="help" tabindex="-1" role="dialog" aria-labelledby="modal-title" aria-hidden="true">
<div class="modal-dialog modal-lg modal-dialog-centered" role="document">
<div class="modal-content">
<div class="modal-header">
<h5 class="modal-title">Search help</h5>
<button type="button" class="close" data-dismiss="modal" aria-label="Close">
<span aria-hidden="true">&times;</span>
</button>
</div>
<div class="modal-body">
<table class="table">
<tbody>
<tr>
<td><code>+</code></td>
<td>signifies AND operation</td>
</tr>
<tr>
<td><code>|</code></td>
<td>signifies OR operation</td>
</tr>
<tr>
<td><code>-</code></td>
<td>negates a single token</td>
</tr>
<tr>
<td><code>""</code></td>
<td>wraps a number of tokens to signify a phrase for searching</td>
</tr>
<tr>
<td><code>*</code></td>
<td>at the end of a term signifies a prefix query</td>
</tr>
<tr>
<td><code>(</code> and <code>)</code></td>
<td>signify precedence</td>
</tr>
<tr>
<td><code>~N</code></td>
<td>after a word signifies edit distance (fuzziness)</td>
</tr>
<tr>
<td><code>~N</code></td>
<td>after a phrase signifies slop amount</td>
</tr>
</tbody>
</table>
<p>For example: <code>"fried eggs" +(eggplant | potato) -frittata</code> will match the phrase
<i>fried eggs</i> and either <i>eggplant</i> or <i>potato</i>, but will ignore results
containing <i>frittata</i>.</p>
<p>When neither <code>+</code> or <code>|</code> is specified, the default operator is <code>+</code> (and).</p>
<p>When the <b>Fuzzy</b> option is checked, partial matches are also returned.</p>
<br>
<p>For more information, see <a target="_blank"
href="//www.elastic.co/guide/en/elasticsearch/reference/current/query-dsl-simple-query-string-query.html">Elasticsearch
documentation</a></p>
</div>
</div>
</div>
</div>
<div class="modal" id="settings" tabindex="-1" role="dialog" aria-labelledby="modal-title" aria-hidden="true">
<div class="modal-dialog modal-dialog-centered" role="document">
<div class="modal-content">
<div class="modal-header">
<h5 class="modal-title">Settings</h5>
<button type="button" class="close" data-dismiss="modal" aria-label="Close">
<span aria-hidden="true">&times;</span>
</button>
</div>
<div class="modal-body">
<div class="custom-control custom-checkbox">
<input type="checkbox" class="custom-control-input" id="settingHighlight">
<label class="custom-control-label" for="settingHighlight">Enable highlighting</label>
</div>
<div class="custom-control custom-checkbox">
<input type="checkbox" class="custom-control-input" id="settingFuzzy">
<label class="custom-control-label" for="settingFuzzy">Set fuzzy search by default</label>
</div>
<label for="settingDisplay">Display</label>
<select id="settingDisplay" class="form-control form-control-sm">
<option value="grid">Grid</option>
<option value="list">List</option>
</select>
<br>
<button style="float: right" class="btn btn-primary" onclick="updateSettings()">Update settings</button>
</div>
</div>
</div>
</div>
<div class="modal" id="pathTreeModal" tabindex="-1" role="dialog" aria-labelledby="modal-title" aria-hidden="true">
<div class="modal-dialog modal-lg" role="document">
<div class="modal-content">
<div class="modal-header">
<h5 class="modal-title">Select path</h5>
<button type="button" class="close" data-dismiss="modal" aria-label="Close">
<span aria-hidden="true">&times;</span>
</button>
</div>
<div class="modal-body">
<div id="pathTree" class="tree"></div>
</div> </div>
</div> </div>
</div> </div>